Zu "K12352" wurden 19 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-SMPD3 / Sphingomyelin phosphodiesterase 3 / nSMase2
Artikelnummer: NSJ-FY13150
Adding 0.2 ml of distilled water will yield a concentration of 500 ug/ml. SMPD3 antibody detects Sphingomyelin phosphodiesterase 3, a membrane-associated enzyme that hydrolyzes sphingomyelin to generate ceramide and phosphocholine. The UniProt recommended name is Sphingomyelin phosphodiesterase 3 (SMPD3). This...
| Schlagworte: | Anti-SMPD3, Anti-Neutral sphingomyelinase 2, Anti-Neutral sphingomyelinase II, Anti-Sphingomyelin phosphodiesterase 3,... |
| Anwendung: | WB, ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
790,00 €
PDDC inhibitor
Artikelnummer: TGM-T69757-10mg
Description: PDDC inhibitor (Phenyl (R)-(1-(3-(3,4-dimethoxyphenyl)-2,6-dimethylimidazo[1,2-b]pyridazin-8-yl)pyrrolidin-3-yl)carbamate) is a selective and highly potent nSMase2 inhibitor. Target: HIV Protease. Smiles: CC=1N=C2N(C1C3=CC(OC)=C(OC)C=C3)N=C(C)C=C2N4C[C@H](NC(OC5=CC=CC=C5)=O)CC4. References: Siew ZY, et...
| Anwendung: | nSMase2 inhibitor |
| CAS | 2232878-43-0 |
| MW: | 487.55 D |
ab 238,00 €
Sphingomyelin phosphodiesterase 3 (SMPD3), partial,...
Artikelnummer: CSB-EP878920HU1.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 86-655aa. Protein Length: Partial. Tag Info: N-terminal 10xHis-tagged and C-terminal Myc-tagged. Target Protein Sequence: SPLQSARRPY IYSRLEDKGL AGGAALLSEW KGTGPGKSFC FATANVCLLP DSLARVNNLF NTQARAKEIG QRIRNGAARP QIKIYIDSPT NTSISAASFS SLVSPQGGDG...
| Schlagworte: | nSMase2, nSMase-2, Neutral sphingomyelinase 2, Neutral sphingomyelinase II, Sphingomyelin phosphodiesterase 3, Recombinant... |
| Anwendung: | Activity not tested |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 68.8 kD |
ab 292,00 €
Anti-SMPD3
Artikelnummer: ABS-KC-3999.100
Protein function: Catalyzes the hydrolysis of sphingomyelin to form ceramide and phosphocholine. Ceramide mediates numerous cellular functions, such as apoptosis and growth arrest, and is capable of regulating these 2 cellular events independently. Also hydrolyzes sphingosylphosphocholine. Regulates the cell cycle...
| Schlagworte: | Anti-Sphingomyelin phosphodiesterase 3, Anti-Neutral sphingomyelinase 2, Anti-nSMase-2, Anti-nSMase2, Anti-Neutral... |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
Anti-SMPD3, recombinant antibody
Artikelnummer: ABS-RN-13691.100
Protein function: Catalyzes the hydrolysis of sphingomyelin to form ceramide and phosphocholine. Ceramide mediates numerous cellular functions, such as apoptosis and growth arrest, and is capable of regulating these 2 cellular events independently. Also hydrolyzes sphingosylphosphocholine. Regulates the cell cycle...
| Schlagworte: | Anti-nSMase2, Anti-nSMase-2, Anti-Neutral sphingomyelinase 2, Anti-Neutral sphingomyelinase II, Anti-Sphingomyelin... |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
Anti-SMPD3, recombinant antibody
Artikelnummer: ABS-RN-13731.100
Protein function: Catalyzes the hydrolysis of sphingomyelin to form ceramide and phosphocholine. Ceramide mediates numerous cellular functions, such as apoptosis and growth arrest, and is capable of regulating these 2 cellular events independently. Also hydrolyzes sphingosylphosphocholine. Regulates the cell cycle...
| Schlagworte: | Anti-nSMase2, Anti-nSMase-2, Anti-Neutral sphingomyelinase 2, Anti-Neutral sphingomyelinase II, Anti-Sphingomyelin... |
| Anwendung: | IP, ChIP |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
SMPD3 (human), recombinant protein
Artikelnummer: ABS-PP-1187-L.100
Protein function: Catalyzes the hydrolysis of sphingomyelin to form ceramide and phosphocholine. Ceramide mediates numerous cellular functions, such as apoptosis and growth arrest, and is capable of regulating these 2 cellular events independently. Also hydrolyzes sphingosylphosphocholine. Regulates the cell cycle...
| Schlagworte: | Sphingomyelin phosphodiesterase 3, Neutral sphingomyelinase 2, nSMase-2, nSMase2, Neutral sphingomyelinase II, Recombinant... |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 11 kD |
ab 115,00 €
SMPD3, Human sphingomyelin phosphodiesterase 3, neutral...
Artikelnummer: VHPS-8671
Primers are provided as a 40 µl solution containing both primers at a final concentration of 50 µM in 10 mM Tris-HCl (pH 7.5), 0.1 mM EDTA. Dilute with water as needed prior to use. This amount is sufficient for 1000 x 20µl PCR reactions assuming a final primer concentration of 0.1 µM. Add cDNA template....
| Schlagworte: | SMPD3, nSMase2, nSMase-2, EC=3.1.4.12, Neutral sphingomyelinase 2, Neutral sphingomyelinase II, Sphingomyelin... |
| Anwendung: | RNA quantification |
45,00 €
Smpd3, Mouse sphingomyelin phosphodiesterase 3, neutral,...
Artikelnummer: VMPS-6132
Primers are provided as a 40 µl solution containing both primers at a final concentration of 50 µM in 10 mM Tris-HCl (pH 7.5), 0.1 mM EDTA. Dilute with water as needed prior to use. This amount is sufficient for 1000 x 20µl PCR reactions assuming a final primer concentration of 0.1 µM. Add cDNA template....
| Schlagworte: | Smpd3, nSMase2, nSMase-2, EC=3.1.4.12, Neutral sphingomyelinase 2, Neutral sphingomyelinase II, Sphingomyelin... |
| Anwendung: | RNA quantification |
45,00 €
Smpd3, Rat sphingomyelin phosphodiesterase 3, neutral,...
Artikelnummer: VRPS-5844
Primers are provided as a 40 µl solution containing both primers at a final concentration of 50 µM in 10 mM Tris-HCl (pH 7.5), 0.1 mM EDTA. Dilute with water as needed prior to use. This amount is sufficient for 1000 x 20µl PCR reactions assuming a final primer concentration of 0.1 µM. Add cDNA template....
| Schlagworte: | Cca1, Smpd3, nSMase2, nSMase-2, EC=3.1.4.12, Neutral sphingomyelinase 2, Neutral sphingomyelinase II, Sphingomyelin... |
| Anwendung: | RNA quantification |
54,00 €
Anti-SMPD3, NT (SMPD3, Sphingomyelin phosphodiesterase 3,...
Artikelnummer: 042056.200
SMPD3 catalyzes the hydrolysis of sphingomyelin to form ceramide and phosphocholine. Ceramide mediates numerous cellular functions, such as apoptosis and growth arrest, and is capable of regulating these 2 cellular events independently. Also hydrolyzes sphingosylphosphocholine. Regulates the cell cycle by acting as...
| Schlagworte: | Anti-SMPD3, Anti-nSMase2, Anti-nSMase-2, EC=3.1.4.12, Anti-Neutral sphingomyelinase 2, Anti-Neutral sphingomyelinase II,... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
865,00 €
Anti-SMPD3
Artikelnummer: G-CAB10197.20
Protein function: Catalyzes the hydrolysis of sphingomyelin to form ceramide and phosphocholine. Ceramide mediates numerous cellular functions, such as apoptosis and growth arrest, and is capable of regulating these 2 cellular events independently. Also hydrolyzes sphingosylphosphocholine. Regulates the cell cycle...
| Schlagworte: | Anti-nSMase2, Anti-nSMase-2, Anti-Neutral sphingomyelinase 2, Anti-Neutral sphingomyelinase II, Anti-Sphingomyelin... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
103,00 €