Zu "K12352" wurden 17 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-SMPD3
Artikelnummer: ABS-KC-3999.100
Protein function: Catalyzes the hydrolysis of sphingomyelin to form ceramide and phosphocholine. Ceramide mediates numerous cellular functions, such as apoptosis and growth arrest, and is capable of regulating these 2 cellular events independently. Also hydrolyzes sphingosylphosphocholine. Regulates the cell cycle...
| Schlagworte: | Anti-Sphingomyelin phosphodiesterase 3, Anti-Neutral sphingomyelinase 2, Anti-nSMase-2, Anti-nSMase2, Anti-Neutral... |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
PDDC inhibitor
Artikelnummer: TGM-T69757-10mg
Description: PDDC inhibitor (Phenyl (R)-(1-(3-(3,4-dimethoxyphenyl)-2,6-dimethylimidazo[1,2-b]pyridazin-8-yl)pyrrolidin-3-yl)carbamate) is a selective and highly potent nSMase2 inhibitor. Target: HIV Protease. Smiles: CC=1N=C2N(C1C3=CC(OC)=C(OC)C=C3)N=C(C)C=C2N4C[C@H](NC(OC5=CC=CC=C5)=O)CC4. References: Siew ZY, et...
| Anwendung: | nSMase2 inhibitor |
| CAS | 2232878-43-0 |
| MW: | 487.55 D |
ab 455,00 €
Sphingomyelin phosphodiesterase 3 (SMPD3), partial,...
Artikelnummer: CSB-EP878920HU1.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 86-655aa. Protein Length: Partial. Tag Info: N-terminal 10xHis-tagged and C-terminal Myc-tagged. Target Protein Sequence: SPLQSARRPY IYSRLEDKGL AGGAALLSEW KGTGPGKSFC FATANVCLLP DSLARVNNLF NTQARAKEIG QRIRNGAARP QIKIYIDSPT NTSISAASFS SLVSPQGGDG...
| Schlagworte: | nSMase2, nSMase-2, Neutral sphingomyelinase 2, Neutral sphingomyelinase II, Sphingomyelin phosphodiesterase 3, Recombinant... |
| Anwendung: | Activity not tested |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 68.8 kD |
ab 292,00 €
Anti-smpd5
Artikelnummer: CSB-PA197921XA01DIL.2
Make to order. Production time: 70-80 business days. Deliverables: 1. 200 µg antigen (used as positive control), 2. 1 ml pre-immune serum (used as negative control) , 3. Rabbit polyclonal antibody, antigen affinity purified. Quality Guarantee: 1. Antibody purity > 90% confirmed by SDS-PAGE, 2. Antibody titer > 1:...
| Schlagworte: | Anti-mtnSMase, Anti-Sphingomyelin phosphodiesterase 5, Anti-Mitochondrial neutral sphingomyelinase, smpd5 Antibody |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | Danio rerio (Zebrafish) (Brachydanio rerio) |
ab 1.529,00 €
SMPD3 (human), recombinant protein
Artikelnummer: ABS-PP-1187.20
| Schlagworte: | Sphingomyelin phosphodiesterase 3, Neutral sphingomyelinase 2, nSMase-2, nSMase2, Neutral sphingomyelinase II, Recombinant... |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 11 kD |
ab 90,00 €
Anti-SMPD3, FITC conjugated
Artikelnummer: CSB-PA878920LC01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, PH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: SMPD3. Antigen Species: Human
| Schlagworte: | Anti-nSMase2, Anti-nSMase-2, Anti-Neutral sphingomyelinase 2, Anti-Neutral sphingomyelinase II, Anti-Sphingomyelin... |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €
Anti-SMPD3
Artikelnummer: CSB-PA878920LA01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, PH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: SMPD3. Antigen Species: Human
| Schlagworte: | Anti-nSMase2, Anti-nSMase-2, Anti-Neutral sphingomyelinase 2, Anti-Neutral sphingomyelinase II, Anti-Sphingomyelin... |
| Anwendung: | ELISA, IHC, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 167,00 €
Anti-SMPD3, HRP conjugated
Artikelnummer: CSB-PA878920LB01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, PH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: SMPD3. Antigen Species: Human
| Schlagworte: | Anti-nSMase2, Anti-nSMase-2, Anti-Neutral sphingomyelinase 2, Anti-Neutral sphingomyelinase II, Anti-Sphingomyelin... |
| Anwendung: | ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €
Anti-SMPD3, Biotin conjugated
Artikelnummer: CSB-PA878920LD01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, PH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: SMPD3. Antigen Species: Human
| Schlagworte: | Anti-nSMase2, Anti-nSMase-2, Anti-Neutral sphingomyelinase 2, Anti-Neutral sphingomyelinase II, Anti-Sphingomyelin... |
| Anwendung: | ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €
SMPD3 (Vector Vector will be determined during the...
Artikelnummer: CSB-CL878920HU.10
Length: 1968 Sequence: ATGGTTTTGT ACACGACCCC CTTTCCTAAC AGCTGTCTGT CCGCCCTGCA CTGTGTGTCC TGGGCCCTTA TCTTTCCATG CTACTGGCTG GTGGACCGGC TCGCTGCCTC CTTCATACCC ACCACCTACG AGAAGCGCCA GCGGGCAGAC GACCCGTGCT GCCTGCAGCT GCTCTGCACT GCCCTCTTCA CGCCCATCTA CCTGGCCCTC CTGGTGGCCT CGCTGCCCTT TGCGTTTCTC GGCTTTCTCT TCTGGTCCCC...
| Schlagworte: | nSMase2, nSMase-2, Neutral sphingomyelinase 2, Neutral sphingomyelinase II, Sphingomyelin phosphodiesterase 3 |
| Anwendung: | Molecular biology, clone |
| Spezies-Reaktivität: | human |
357,00 €
SMPD3, Human sphingomyelin phosphodiesterase 3, neutral...
Artikelnummer: VHPS-8671
Primers are provided as a 40 µl solution containing both primers at a final concentration of 50 µM in 10 mM Tris-HCl (pH 7.5), 0.1 mM EDTA. Dilute with water as needed prior to use. This amount is sufficient for 1000 x 20µl PCR reactions assuming a final primer concentration of 0.1 µM. Add cDNA template....
| Schlagworte: | SMPD3, nSMase2, nSMase-2, EC=3.1.4.12, Neutral sphingomyelinase 2, Neutral sphingomyelinase II, Sphingomyelin... |
| Anwendung: | RNA quantification |
44,00 €
Smpd3, Mouse sphingomyelin phosphodiesterase 3, neutral,...
Artikelnummer: VMPS-6132
Primers are provided as a 40 µl solution containing both primers at a final concentration of 50 µM in 10 mM Tris-HCl (pH 7.5), 0.1 mM EDTA. Dilute with water as needed prior to use. This amount is sufficient for 1000 x 20µl PCR reactions assuming a final primer concentration of 0.1 µM. Add cDNA template....
| Schlagworte: | Smpd3, nSMase2, nSMase-2, EC=3.1.4.12, Neutral sphingomyelinase 2, Neutral sphingomyelinase II, Sphingomyelin... |
| Anwendung: | RNA quantification |
44,00 €