- Suchergebnis für K11841
Cookie-Einstellungen
Diese Website benutzt Cookies, die für den technischen Betrieb der Website erforderlich sind und stets gesetzt werden. Andere Cookies, die den Komfort bei Benutzung dieser Website erhöhen, der Direktwerbung dienen oder die Interaktion mit anderen Websites und sozialen Netzwerken vereinfachen sollen, werden nur mit Ihrer Zustimmung gesetzt.
Konfiguration
Technisch erforderlich
Diese Cookies sind für die Grundfunktionen des Shops notwendig.
"Alle Cookies ablehnen" Cookie
"Alle Cookies annehmen" Cookie
Ausgewählter Shop
CSRF-Token
Cookie-Einstellungen
FACT-Finder Tracking
Individuelle Preise
Kundenspezifisches Caching
Session
Währungswechsel
Komfortfunktionen
Diese Cookies werden genutzt um das Einkaufserlebnis noch ansprechender zu gestalten, beispielsweise für die Wiedererkennung des Besuchers.
Facebook-Seite in der rechten Blog - Sidebar anzeigen
Merkzettel
Statistik & Tracking
Endgeräteerkennung
Kauf- und Surfverhalten mit Google Tag Manager
Partnerprogramm
Zu "K11841" wurden 35 Artikel gefunden!
Filter schließen
Filtern nach:
Für die Filterung wurden keine Ergebnisse gefunden!
Artikelnummer: TGM-T1937-100mg
Description: Spautin-1 is a novel autophagy inhibitor, IM inhibited the growth of K562 cells with IC50 of 1.03 µM. In contrast, co-treatment with Spautin-1 increased IM-induced inhibition of cell viability with IC50 of 0.45 µM. Target: Apoptosis, DUB, Autophagy. Smiles: Fc1ccc(CNc2ncnc3ccc(F)cc23)cc1. References:...
Schlagworte: | Spautin 1 |
Anwendung: | Autophagy inhibitor, USP10 / USP13 inhibitor |
CAS | 1262888-28-7 |
MW: | 271.26 D |
ab 34,00 €
Artikelnummer: Cay17769-5
Spautin-1 is an autophagy inhibitor, inducing cell death in human breast cancer Bcap-37 cells grown in glucose-free media (EC50 = ~1.25 µM). It does not significantly affect the viability of Bcap-37 cells grown in complete media. Spautin-1 promotes the degradation of Vps34 PI3K complex by inhibiting the...
Schlagworte: | 6-fluoro-N-[(4-fluorophenyl)methyl]-4-quinazolinamine |
Anwendung: | Autophagy inhibitor, USP10 / USP13 inhibitor |
CAS | 1262888-28-7 |
MW: | 271.3 D |
ab 44,00 €
Artikelnummer: A300-900A
Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
Schlagworte: | Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin... |
Anwendung: | WB, IP, IHC |
Wirt: | Rabbit |
Spezies-Reaktivität: | human, mouse |
ab 178,00 €
Artikelnummer: A300-901A
Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
Schlagworte: | Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin... |
Anwendung: | WB, IP, IHC |
Wirt: | Rabbit |
Spezies-Reaktivität: | human |
ab 178,00 €
Artikelnummer: BPS-79094
The USP10 Inhibitor Screening Assay Kit is a fluorogenic assay designed to measure the activity of the deubiquitinating (DUB) enzyme USP10 (Ubiquitin Specific Peptidase 10) for screening and profiling applications. The kit comes in a convenient 96-well format and contains enough purified recombinant human USP10...
Schlagworte: | Ubiquitin thioesterase 10, Deubiquitinating enzyme 10, Ubiquitin carboxyl-terminal hydrolase 10,... |
Anwendung: | Enzyme kinetics, small molecule inhibitor screening, drug discovery, HTS |
Spezies-Reaktivität: | human |
1.336,00 €
Artikelnummer: BPS-80360
Human USP10 (Ubiquitin-Specific Protease 10) or Ubiquitin C-terminal Hydrolase 10, GenBank Accession No. NM_005153, amino-acids 2-798(end) with an N-terminal FLAG-tag, MW=88 kDa, expressed in a baculovirus-infected Sf9 cell expression system.
Schlagworte: | Ubiquitin thioesterase 10, Deubiquitinating enzyme 10, Ubiquitin carboxyl-terminal hydrolase 10,... |
Anwendung: | Enzyme kinetics, inhibitor screening, selectivity profiling |
Exprimiert in: | Baculovirus |
Ursprungsart: | human |
MW: | 88 kD |
640,00 €
Artikelnummer: IHC-00175
Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
Schlagworte: | Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin... |
Anwendung: | IHC |
Wirt: | Rabbit |
Spezies-Reaktivität: | human |
ab 178,00 €
Artikelnummer: ARG59722.100
Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
Schlagworte: | Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin... |
Anwendung: | ICC, IF, IHC (paraffin), IP, WB |
Wirt: | Rabbit |
Spezies-Reaktivität: | human |
658,00 €
Artikelnummer: ARG59808.100
Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
Schlagworte: | Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin... |
Anwendung: | ICC, IF, WB |
Wirt: | Rabbit |
Spezies-Reaktivität: | human, mouse |
658,00 €
Artikelnummer: ARG59869.100
Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
Schlagworte: | Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin... |
Anwendung: | ICC, IF, IHC (paraffin) |
Wirt: | Rabbit |
Spezies-Reaktivität: | human, mouse |
658,00 €
Artikelnummer: ATA-HPA006731.100
Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
Schlagworte: | Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin... |
Anwendung: | WB, IHC, ICC |
Wirt: | Rabbit |
Spezies-Reaktivität: | human |
ab 239,00 €
Artikelnummer: ATA-HPA006749.100
Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
Schlagworte: | Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin... |
Anwendung: | IHC, ICC |
Wirt: | Rabbit |
Spezies-Reaktivität: | human |
ab 239,00 €