Zu "K11841" wurden 37 Artikel gefunden!

1 von 4 Seiten
Für die Filterung wurden keine Ergebnisse gefunden!
Spautin-1
Spautin-1

Artikelnummer: Cay17769-5

Spautin-1 is an autophagy inhibitor, inducing cell death in human breast cancer Bcap-37 cells grown in glucose-free media (EC50 = ~1.25 µM). It does not significantly affect the viability of Bcap-37 cells grown in complete media. Spautin-1 promotes the degradation of Vps34 PI3K complex by inhibiting the...
Schlagworte: 6-fluoro-N-[(4-fluorophenyl)methyl]-4-quinazolinamine
Anwendung: Autophagy inhibitor, USP10 / USP13 inhibitor
CAS 1262888-28-7
MW: 271.3 D
ab 49,00 €
Bewerten
Anti-USP10
Anti-USP10

Artikelnummer: A300-900A

Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
Schlagworte: Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin...
Anwendung: WB, IP, IHC
Wirt: Rabbit
Spezies-Reaktivität: human, mouse
ab 165,00 €
Bewerten
Anti-USP10
Anti-USP10

Artikelnummer: A300-901A

Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
Schlagworte: Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin...
Anwendung: WB, IP, IHC
Wirt: Rabbit
Spezies-Reaktivität: human
ab 165,00 €
Bewerten
Anti-USP10
Anti-USP10

Artikelnummer: ATA-HPA006731.100

Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
Schlagworte: Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin...
Anwendung: WB, IHC, ICC
Wirt: Rabbit
Spezies-Reaktivität: human
ab 246,00 €
Bewerten
USP10 Inhibitor Screening Assay Kit
USP10 Inhibitor Screening Assay Kit

Artikelnummer: BPS-79094

The USP10 Inhibitor Screening Assay Kit is a fluorogenic assay designed to measure the activity of the deubiquitinating (DUB) enzyme USP10 (Ubiquitin Specific Peptidase 10) for screening and profiling applications. The kit comes in a convenient 96-well format and contains enough purified recombinant human USP10...
Schlagworte: Ubiquitin thioesterase 10, Deubiquitinating enzyme 10, Ubiquitin carboxyl-terminal hydrolase 10,...
Anwendung: Enzyme kinetics, small molecule inhibitor screening, drug discovery, HTS
Spezies-Reaktivität: human
1.336,00 €
Bewerten
USP10, active human recombinant protein, N-terminal FLAG-tag
USP10, active human recombinant protein, N-terminal FLAG-tag

Artikelnummer: BPS-80360

Human USP10 (Ubiquitin-Specific Protease 10) or Ubiquitin C-terminal Hydrolase 10, GenBank Accession No. NM_005153, amino-acids 2-798(end) with an N-terminal FLAG-tag, MW=88 kDa, expressed in a baculovirus-infected Sf9 cell expression system.
Schlagworte: Ubiquitin thioesterase 10, Deubiquitinating enzyme 10, Ubiquitin carboxyl-terminal hydrolase 10,...
Anwendung: Enzyme kinetics, inhibitor screening, selectivity profiling
Exprimiert in: Baculovirus
Ursprungsart: human
MW: 88 kD
640,00 €
Bewerten
Anti-USP10 (IHC)
Anti-USP10 (IHC)

Artikelnummer: IHC-00175

Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
Schlagworte: Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin...
Anwendung: IHC
Wirt: Rabbit
Spezies-Reaktivität: human
ab 165,00 €
Bewerten
Anti-USP10
Anti-USP10

Artikelnummer: ARG59722.100

Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
Schlagworte: Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin...
Anwendung: ICC, IF, IHC (paraffin), IP, WB
Wirt: Rabbit
Spezies-Reaktivität: human
658,00 €
Bewerten
Anti-USP10
Anti-USP10

Artikelnummer: ARG59808.100

Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
Schlagworte: Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin...
Anwendung: ICC, IF, WB
Wirt: Rabbit
Spezies-Reaktivität: human, mouse
707,00 €
Bewerten
Anti-USP10
Anti-USP10

Artikelnummer: ATA-HPA006749.100

Protein function: Hydrolase that can remove conjugated ubiquitin from target proteins such as p53/TP53, BECN1, SNX3 and CFTR. Acts as an essential regulator of p53/TP53 stability: in unstressed cells, specifically deubiquitinates p53/TP53 in the cytoplasm, leading to counteract MDM2 action and stabilize p53/TP53....
Schlagworte: Anti-USP10, Anti-KIAA0190, Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin...
Anwendung: IHC, ICC
Wirt: Rabbit
Spezies-Reaktivität: human
ab 246,00 €
Bewerten
Anti-USP10 / Ubiquitin carboxyl-terminal hydrolase 10
Anti-USP10 / Ubiquitin carboxyl-terminal hydrolase 10

Artikelnummer: NSJ-RQ7110

0.5mg/ml if reconstituted with 0.2ml sterile DI water. Ubiquitin specific peptidase 10, also known as USP10, is an enzyme which in humans is encoded by the USP10 gene. Ubiquitin is a highly conserved protein that is covalently linked to other proteins to regulate their function and degradation. This gene encodes a...
Schlagworte: Anti-Ubiquitin thioesterase 10, Anti-Deubiquitinating enzyme 10, Anti-Ubiquitin carboxyl-terminal hydrolase 10,...
Anwendung: WB, Direct ELISA
Wirt: Rabbit
Spezies-Reaktivität: human, mouse, rat
790,00 €
Bewerten
Spautin-1
Spautin-1

Artikelnummer: TGM-T1937-100mg

Description: Spautin-1 is a novel autophagy inhibitor, IM inhibited the growth of K562 cells with IC50 of 1.03 µM. In contrast, co-treatment with Spautin-1 increased IM-induced inhibition of cell viability with IC50 of 0.45 µM. Target: Apoptosis, DUB, Autophagy. Smiles: Fc1ccc(CNc2ncnc3ccc(F)cc23)cc1. References:...
Schlagworte: Spautin 1
Anwendung: Autophagy inhibitor, USP10 / USP13 inhibitor
CAS 1262888-28-7
MW: 271.26 D
ab 32,00 €
Bewerten
1 von 4 Seiten