Zu "K11833" wurden 38 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
USP2 active domain (human recombinant)
Artikelnummer: Cay22784-100
Ubiquitin-specific protease 2 (USP2), also known as ubiquitin carboxyl-terminal hydrolase 2, is a cysteine protease involved in intracellular protein degradation by deubiquitinating degraded protein, including Mdm2, Mdm4, and CCND1. In both normal and cancer cells, it regulates G1/S cell-cycle transition. It may...
| Schlagworte: | USP2, UBP41, Ubiquitin thioesterase 2, Ubiquitin thioesterase 2, Deubiquitinating enzyme 2, Deubiquitinating enzyme 2, 41... |
| Anwendung: | ELISA, electrophoresis, HTS, MS, WB |
498,00 €
USP2 (E. coli) active human recombinant protein
Artikelnummer: BPS-80392-1
Human USP2 (Ubiquitin-Specific Protease 2) or UPB41, GenBank Accession No. NM_004205, amino-acids 259-605(end) with an N-terminal His-tag, MW=40.9 kDa, expressed in an E. coli cell expression system.
| Schlagworte: | USP2, UBP41, EC=3.4.19.12, Ubiquitin thioesterase 2, Deubiquitinating enzyme 2, 41 kDa ubiquitin-specific protease,... |
| Anwendung: | Enzyme kinetics, inhibitor screening, selectivity profiling |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 40.9 kD |
ab 295,00 €
NSC 632839
Artikelnummer: Cay16893-25
Protein ubiquitination is a dynamic process that can be reversed by deubiquitinating enzymes (DUBs) that remove ubiquitin from proteins, sparing them from degradation by the proteasome. The DUBs have been divided into various groups, the largest being the ubiquitin-specific proteases (USPs). NSC 632839 inhibits USP2...
| Schlagworte: | F6, Ubiquitin Isopeptidase Inhibitor II, 3,5-bis[(4-methylphenyl)methylene]-4-piperidinone, monohydrochloride |
| Anwendung: | USP2 / USP7 / SENP2 inhibitor |
| CAS | 157654-67-6 |
| MW: | 339.9 D |
ab 49,00 €
ML-364
Artikelnummer: Cay21774-1
ML-364 is a reversible inhibitor of ubiquitin-specific protease 2 (USP2), a deubiquitinase, that has an IC50 value of 1.1 µM in a fluorescence-based assay using di-ubiquitin substrates. It inhibits USP8, which is closely related to USP2, with an IC50 value of 0.95 µM in the same assay. It has no activity at the...
| Schlagworte: | 2-[[(4-methylphenyl)sulfonyl]amino]-N-(4-phenyl-2-thiazolyl)-4-(trifluoromethyl)-benzamide |
| Anwendung: | USP2 inhibitor |
| CAS | 1991986-30-1 |
| MW: | 517.5 D |
ab 50,00 €
Anti-USP2
Artikelnummer: E-AB-10878.120
This gene encodes a member of the family of de-ubiquitinating enzymes, which belongs to the peptidase C19 superfamily. The encoded protein is a ubiquitin-specific protease which is required for TNF-alpha (tumor necrosis factor alpha) -induced NF-kB (nuclear factor kB) signaling. This protein deubiquitinates...
| Schlagworte: | Anti-USP2, Anti-UBP41, EC=3.4.19.12, Anti-Ubiquitin thioesterase 2, Anti-Deubiquitinating enzyme 2, Anti-41 kDa... |
| Anwendung: | IHC, ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 89,00 €
Anti-USP2
Artikelnummer: ATA-HPA006777.100
Protein function: Hydrolase that deubiquitinates polyubiquitinated target proteins such as MDM2, MDM4 and CCND1 (PubMed:17290220, PubMed:19917254, PubMed:19838211). Isoform 1 and isoform 4 possess both ubiquitin-specific peptidase and isopeptidase activities. Deubiquitinates MDM2 without reversing MDM2-mediated...
| Schlagworte: | Anti-USP2, Anti-UBP41, EC=3.4.19.12, Anti-Ubiquitin thioesterase 2, Anti-Deubiquitinating enzyme 2, Anti-41 kDa... |
| Anwendung: | ICC, IHC, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 330,00 €
Anti-USP2
Artikelnummer: ATA-HPA007222.100
Protein function: Hydrolase that deubiquitinates polyubiquitinated target proteins such as MDM2, MDM4 and CCND1 (PubMed:17290220, PubMed:19917254, PubMed:19838211). Isoform 1 and isoform 4 possess both ubiquitin-specific peptidase and isopeptidase activities. Deubiquitinates MDM2 without reversing MDM2-mediated...
| Schlagworte: | Anti-USP2, Anti-UBP41, EC=3.4.19.12, Anti-Ubiquitin thioesterase 2, Anti-Deubiquitinating enzyme 2, Anti-41 kDa... |
| Anwendung: | WB, IHC, ICC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 330,00 €
USP2 Inhibitor Screening Assay Kit
Artikelnummer: BPS-78859
The Ubiquitin specific peptidase 2 (USP2) Inhibitor Screening Assay Kit is a homogeneous fluorogenic assay designed to measure the activity of the deubiquitinating (DUB) enzyme USP2 for screening and profiling applications. The kit contains enough purified USP2 recombinant protein, Ubiquitinated-AMC substrate, and...
| Schlagworte: | USP 2, Ubiquitin-Specific Protease 2, UPB41, USP-2, |
| Anwendung: | Enzyme kinetic studies, small molecule inhibitor screening, drug discovery, HTS |
| Spezies-Reaktivität: | human |
1.285,00 €
DUB-Freedom(TM) Inhibitor Screening Assay Kit
Artikelnummer: BPS-78895
The DUB-Freedom(TM) Inhibitor Screening Assay Kit is a fluorogenic assay designed to measure the activity of several purified deubiquitinating (DUB) enzymes of interest in a homogeneous 96-reaction format and is ideal for screening and profiling applications. The kit contains enough Ubiquitinated-AMC substrate and...
| Schlagworte: | USP2, UBP41, EC=3.4.19.12, Ubiquitin thioesterase 2, Deubiquitinating enzyme 2, 41 kDa ubiquitin-specific protease,... |
| Anwendung: | Deubiquitination assays, deubiquitinase characteriziation, inhibitor screening, HTS, IC50 determination |
| Spezies-Reaktivität: | human |
1.490,00 €
Anti-USP2
Artikelnummer: CSB-PA155084.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: USP2. Antigen Species: Human
| Schlagworte: | Anti-USP2, Anti-UBP41, EC=3.4.19.12, Anti-Ubiquitin thioesterase 2, Anti-Deubiquitinating enzyme 2, Anti-41 kDa... |
| Anwendung: | ELISA, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 167,00 €
Anti-USP2
Artikelnummer: CSB-PA673833.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: USP2. Antigen Species: Human
| Schlagworte: | Anti-USP2, Anti-UBP41, EC=3.4.19.12, Anti-Ubiquitin thioesterase 2, Anti-Deubiquitinating enzyme 2, Anti-41 kDa... |
| Anwendung: | ELISA, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 167,00 €
ML364
Artikelnummer: TGM-T3555-100mg
Description: ML364 is an inhibitor of ubiquitin specific peptidase 2 (USP2) and can be used for the research of breast cancer. Target: DUB. Smiles: Cc1ccc(cc1)S(=O)(=O)Nc1cc(ccc1C(=O)Nc1nc(cs1)-c1ccccc1)C(F)(F)F. References: Davis MI,et al. Small Molecule Inhibition of the Ubiquitin-specific Protease USP2...
| Anwendung: | USP2 inhibitor |
| CAS | 1991986-30-1 |
| MW: | 517.54 D |
ab 62,00 €