Zu "K11832" wurden 32 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-USP1
Artikelnummer: A301-700A
Protein function: Negative regulator of DNA damage repair which specifically deubiquitinates monoubiquitinated FANCD2 (PubMed:15694335). Also involved in PCNA-mediated translesion synthesis (TLS) by deubiquitinating monoubiquitinated PCNA (PubMed:16531995). Has almost no deubiquitinating activity by itself and...
| Schlagworte: | Anti-hUBP, Anti-USP1, Anti-Ubiquitin thioesterase 1, Anti-Deubiquitinating enzyme 1, Anti-Ubiquitin carboxyl-terminal... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 165,00 €
ML-323
Artikelnummer: Cay18010-5
The USP1 deubiquitinating enzyme, which regulates the DNA translesion synthesis (TLS) and Fanconi anemia (FA) DNA damage response pathways by deubiquitinating the central players of these pathways, is activated by the WD40-repeat containing UAF1 protein through formation of a stable USP1-UAF1 protein complex. ML-323...
| Schlagworte: | 5-methyl-2-[2-(1-methylethyl)phenyl]-N-[[4-(1H-1,2,3-triazol-1-yl)phenyl]methyl]-4-pyrimidinamine |
| Anwendung: | USP1-UAF1 inhibitor |
| CAS | 1572414-83-5 |
| MW: | 384.5 D |
ab 138,00 €
Anti-USP1
Artikelnummer: A301-699A
Protein function: Negative regulator of DNA damage repair which specifically deubiquitinates monoubiquitinated FANCD2 (PubMed:15694335). Also involved in PCNA-mediated translesion synthesis (TLS) by deubiquitinating monoubiquitinated PCNA (PubMed:16531995). Has almost no deubiquitinating activity by itself and...
| Schlagworte: | Anti-hUBP, Anti-USP1, Anti-Ubiquitin thioesterase 1, Anti-Deubiquitinating enzyme 1, Anti-Ubiquitin carboxyl-terminal... |
| Anwendung: | WB, IP, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 165,00 €
KSQ-4279
Artikelnummer: LKT-K740640.1
KSQ-4279 is an inhibitor of the deubiquitinating enzyme USP1. SMILES: CC(C)N1C=C(N=C1C2=CC=C(C=C2)CN3C4=NC(=NC=C4C=N3)C5=C(N=CN=C5OC)C6CC6)C(F)(F)F
| Schlagworte: | USP1-IN-1, KSQ4279,... |
| Anwendung: | USP1 inhibitor |
| CAS | 2446480-97-1 |
| MW: | 534.55 D |
ab 146,00 €
Anti-USP1
Artikelnummer: A301-698A
Protein function: Negative regulator of DNA damage repair which specifically deubiquitinates monoubiquitinated FANCD2 (PubMed:15694335). Also involved in PCNA-mediated translesion synthesis (TLS) by deubiquitinating monoubiquitinated PCNA (PubMed:16531995). Has almost no deubiquitinating activity by itself and...
| Schlagworte: | Anti-hUBP, Anti-USP1, Anti-Ubiquitin thioesterase 1, Anti-Deubiquitinating enzyme 1, Anti-Ubiquitin carboxyl-terminal... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 165,00 €
Anti-USP1 (IHC)
Artikelnummer: IHC-00391
Protein function: Negative regulator of DNA damage repair which specifically deubiquitinates monoubiquitinated FANCD2 (PubMed:15694335). Also involved in PCNA-mediated translesion synthesis (TLS) by deubiquitinating monoubiquitinated PCNA (PubMed:16531995). Has almost no deubiquitinating activity by itself and...
| Schlagworte: | Anti-hUBP, Anti-USP1, Anti-Ubiquitin thioesterase 1, Anti-Deubiquitinating enzyme 1, Anti-Ubiquitin carboxyl-terminal... |
| Anwendung: | IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 165,00 €
C527
Artikelnummer: Cay21771-10
C527 is an inhibitor of USP1/UAF complex deubiquitinase activity (IC50 = 0.88 µM). It also inhibits USP5, UCL-H3, and USP12/46 but not UCL-H1 activity (IC50s = 1.65, 2.18, 5.97, and >10 µM, respectively). C527 increases ubiquinated Fanconi anemia complementation group D2 (FANCD2-Ub) and FANCI-Ub levels in a...
| Schlagworte: | 2-(4-fluorophenyl)-naphth[2,3-d]oxazole-4,9-dione |
| Anwendung: | USP1/UAF complex deubiquitinase inhibitor |
| CAS | 192718-06-2 |
| MW: | 293.3 D |
ab 122,00 €
Anti-USP1
Artikelnummer: ARG54998.100
Protein function: Negative regulator of DNA damage repair which specifically deubiquitinates monoubiquitinated FANCD2 (PubMed:15694335). Also involved in PCNA-mediated translesion synthesis (TLS) by deubiquitinating monoubiquitinated PCNA (PubMed:16531995). Has almost no deubiquitinating activity by itself and...
| Schlagworte: | Anti-USP1, Anti-hUBP, Anti-Ubiquitin thioesterase 1, Anti-Deubiquitinating enzyme 1, Anti-Ubiquitin carboxyl-terminal... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
616,00 €
Anti-USP1
Artikelnummer: ATA-HPA028387.100
Protein function: Negative regulator of DNA damage repair which specifically deubiquitinates monoubiquitinated FANCD2 (PubMed:15694335). Also involved in PCNA-mediated translesion synthesis (TLS) by deubiquitinating monoubiquitinated PCNA (PubMed:16531995). Has almost no deubiquitinating activity by itself and...
| Schlagworte: | Anti-USP1, Anti-hUBP, Anti-Ubiquitin thioesterase 1, Anti-Deubiquitinating enzyme 1, Anti-Ubiquitin carboxyl-terminal... |
| Anwendung: | WB, ICC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 246,00 €
Anti-USP1
Artikelnummer: ATA-HPA028440.100
Protein function: Negative regulator of DNA damage repair which specifically deubiquitinates monoubiquitinated FANCD2 (PubMed:15694335). Also involved in PCNA-mediated translesion synthesis (TLS) by deubiquitinating monoubiquitinated PCNA (PubMed:16531995). Has almost no deubiquitinating activity by itself and...
| Schlagworte: | Anti-USP1, Anti-hUBP, Anti-Ubiquitin thioesterase 1, Anti-Deubiquitinating enzyme 1, Anti-Ubiquitin carboxyl-terminal... |
| Anwendung: | WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 246,00 €
Anti-USP1
Artikelnummer: NSJ-RQ6728
0.5mg/ml if reconstituted with 0.2ml sterile DI water. Ubiquitin carboxyl-terminal hydrolase 1 is an enzyme that in humans is encoded by the USP1 gene. This gene encodes a member of the ubiquitin-specific processing (UBP) family of proteases that is a deubiquitinating enzyme (DUB) with His and Cys domains. This...
| Schlagworte: | Anti-USP1, USP1 Antibody |
| Anwendung: | WB, FC, Direct ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, monkey |
790,00 €
Ubiquitin carboxyl-terminal hydrolase 1 (USP1), human,...
Artikelnummer: CSB-EP025695HUa0.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 1-785aa. Protein Length: Full Length. Tag Info: N-terminal 6xHis-tagged. Target Protein Sequence: MPGVIPSESN GLSRGSPSKK NRLSLKFFQK KETKRALDFT DSQENEEKAS EYRASEIDQV VPAAQSSPIN CEKRENLLPF VGLNNLGNTC YLNSILQVLY FCPGFKSGVK HLFNIISRKK EALKDEANQK...
| Schlagworte: | hUBP, USP1, Ubiquitin thioesterase 1, Deubiquitinating enzyme 1, Ubiquitin carboxyl-terminal hydrolase 1,... |
| Anwendung: | Activity not tested |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 94.3 kD |
ab 219,00 €