Zu "K11832" wurden 32 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
KSQ-4279
Artikelnummer: LKT-K740640.1
KSQ-4279 is an inhibitor of the deubiquitinating enzyme USP1. SMILES: CC(C)N1C=C(N=C1C2=CC=C(C=C2)CN3C4=NC(=NC=C4C=N3)C5=C(N=CN=C5OC)C6CC6)C(F)(F)F
| Schlagworte: | USP1-IN-1, KSQ4279,... |
| Anwendung: | USP1 inhibitor |
| CAS | 2446480-97-1 |
| MW: | 534.55 D |
ab 145,00 €
KSQ-4279
Artikelnummer: Cay41862-1
KSQ-4279 is an inhibitor of ubiquitin-specific protease 1 (USP1, IC50 = 21.1 nM). It reduces the viability of H1299 non-small cell lung cancer (NSCLC) cells when used at a concentration of 500 nM. KSQ-4279 (1 µM) induces cell cycle arrest at the S phase in MDA-MB-436 breast cancer cells.Formal Name:...
| Schlagworte: | Ubiquitin-specific Protease 1 Inhibitor 1, USP1 Inhibitor 1, USP1-IN-1,... |
| Anwendung: | USP1 inhibitor |
| CAS | 2446480-97-1 |
| MW: | 534.5 D |
ab 136,00 €
SJB2-043
Artikelnummer: TGM-T7678-100mg
Description: SJB2-043, an inhibitor of USP1-UAF1, has an IC50 of 544 nM. Target: DUB. Smiles: O=C1c2nc(oc2C(=O)c2ccccc12)-c1ccccc1. References: Jussara, Maria, Goncalves, et al. The Role of the Complex USP1/WDR48 in Differentiation and Proliferation Processes in Cancer Stem Cells.[J]. Current stem cell research &...
| Anwendung: | USP1-UAF complex / SARS-CoV-2 CLpro inhibitor |
| CAS | 63388-44-3 |
| MW: | 275.26 D |
ab 46,00 €
ML-323
Artikelnummer: TGM-T1757-100mg
Description: ML323 is a reversible and effective USP1-UAF1 inhibitor in a Ub-Rho assay (IC50: 76 nM) and in orthogonal gel-based assays using K63-linked diubiquitin (di-Ub) (IC50: 174 nM 820 nM)and monoubiquitinated PCNA (Ub-PCNA) (IC50: 820 nM) as substrates, respectively. Target: DUB. Smiles:...
| Schlagworte: | ML323 |
| Anwendung: | USP1-UAF1 inhibitor |
| CAS | 1572414-83-5 |
| MW: | 384.48 D |
ab 217,00 €
Anti-USP1
Artikelnummer: CSB-PA274411.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: USP1. Antigen Species: Human
| Schlagworte: | Anti-USP1, Anti-hUBP, Anti-Ubiquitin thioesterase 1, Anti-Deubiquitinating enzyme 1, Anti-Ubiquitin carboxyl-terminal... |
| Anwendung: | ELISA, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 167,00 €
Ubiquitin carboxyl-terminal hydrolase 1 (USP1), human,...
Artikelnummer: CSB-EP025695HUa0.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 1-785aa. Protein Length: Full Length. Tag Info: N-terminal 6xHis-tagged. Target Protein Sequence: MPGVIPSESN GLSRGSPSKK NRLSLKFFQK KETKRALDFT DSQENEEKAS EYRASEIDQV VPAAQSSPIN CEKRENLLPF VGLNNLGNTC YLNSILQVLY FCPGFKSGVK HLFNIISRKK EALKDEANQK...
| Schlagworte: | hUBP, USP1, Ubiquitin thioesterase 1, Deubiquitinating enzyme 1, Ubiquitin carboxyl-terminal hydrolase 1,... |
| Anwendung: | Activity not tested |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 94.3 kD |
ab 219,00 €
Anti-USP1
Artikelnummer: A301-700A
Protein function: Negative regulator of DNA damage repair which specifically deubiquitinates monoubiquitinated FANCD2 (PubMed:15694335). Also involved in PCNA-mediated translesion synthesis (TLS) by deubiquitinating monoubiquitinated PCNA (PubMed:16531995). Has almost no deubiquitinating activity by itself and...
| Schlagworte: | Anti-hUBP, Anti-USP1, Anti-Ubiquitin thioesterase 1, Anti-Deubiquitinating enzyme 1, Anti-Ubiquitin carboxyl-terminal... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 178,00 €
ML-323
Artikelnummer: Cay18010-5
The USP1 deubiquitinating enzyme, which regulates the DNA translesion synthesis (TLS) and Fanconi anemia (FA) DNA damage response pathways by deubiquitinating the central players of these pathways, is activated by the WD40-repeat containing UAF1 protein through formation of a stable USP1-UAF1 protein complex. ML-323...
| Schlagworte: | 5-methyl-2-[2-(1-methylethyl)phenyl]-N-[[4-(1H-1,2,3-triazol-1-yl)phenyl]methyl]-4-pyrimidinamine |
| Anwendung: | USP1-UAF1 inhibitor |
| CAS | 1572414-83-5 |
| MW: | 384.5 D |
ab 126,00 €
Anti-USP1
Artikelnummer: A301-699A
Protein function: Negative regulator of DNA damage repair which specifically deubiquitinates monoubiquitinated FANCD2 (PubMed:15694335). Also involved in PCNA-mediated translesion synthesis (TLS) by deubiquitinating monoubiquitinated PCNA (PubMed:16531995). Has almost no deubiquitinating activity by itself and...
| Schlagworte: | Anti-hUBP, Anti-USP1, Anti-Ubiquitin thioesterase 1, Anti-Deubiquitinating enzyme 1, Anti-Ubiquitin carboxyl-terminal... |
| Anwendung: | WB, IP, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 178,00 €
Anti-USP1
Artikelnummer: A301-698A
Protein function: Negative regulator of DNA damage repair which specifically deubiquitinates monoubiquitinated FANCD2 (PubMed:15694335). Also involved in PCNA-mediated translesion synthesis (TLS) by deubiquitinating monoubiquitinated PCNA (PubMed:16531995). Has almost no deubiquitinating activity by itself and...
| Schlagworte: | Anti-hUBP, Anti-USP1, Anti-Ubiquitin thioesterase 1, Anti-Deubiquitinating enzyme 1, Anti-Ubiquitin carboxyl-terminal... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 178,00 €
Anti-USP1 (IHC)
Artikelnummer: IHC-00391
Protein function: Negative regulator of DNA damage repair which specifically deubiquitinates monoubiquitinated FANCD2 (PubMed:15694335). Also involved in PCNA-mediated translesion synthesis (TLS) by deubiquitinating monoubiquitinated PCNA (PubMed:16531995). Has almost no deubiquitinating activity by itself and...
| Schlagworte: | Anti-hUBP, Anti-USP1, Anti-Ubiquitin thioesterase 1, Anti-Deubiquitinating enzyme 1, Anti-Ubiquitin carboxyl-terminal... |
| Anwendung: | IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 178,00 €
C527
Artikelnummer: Cay21771-10
C527 is an inhibitor of USP1/UAF complex deubiquitinase activity (IC50 = 0.88 µM). It also inhibits USP5, UCL-H3, and USP12/46 but not UCL-H1 activity (IC50s = 1.65, 2.18, 5.97, and >10 µM, respectively). C527 increases ubiquinated Fanconi anemia complementation group D2 (FANCD2-Ub) and FANCI-Ub levels in a...
| Schlagworte: | 2-(4-fluorophenyl)-naphth[2,3-d]oxazole-4,9-dione |
| Anwendung: | USP1/UAF complex deubiquitinase inhibitor |
| CAS | 192718-06-2 |
| MW: | 293.3 D |
ab 111,00 €