Zu "K11479" wurden 138 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-Recombinant Aurora B, clone A136
Artikelnummer: E-AN301441L.100
Serine/threonine-protein kinase component of the chromosomal passenger complex (CPC), a complex that acts as a key regulator of mitosis. The CPC complex has essential functions at the centromere in ensuring correct chromosome alignment and segregation and is required for chromatin-induced microtubule stabilization...
| Schlagworte: | Anti-STK-1, Anti-AURKB, Anti-Aurora 1, Anti-Aurora kinase B, Anti-Aurora/IPL1-related kinase 2,... |
| Anwendung: | WB, IHC, IF |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 304,00 €
Anti-AURKB
Artikelnummer: ATA-HPA073516.100
Rabbit Polyclonal AURKB Antibody against Human aurora kinase B. Validated for Western Blot. Buffer: 40% glycerol and PBS (pH 7.2). 0.02% sodium azide is added as preservative. Interspecies information: Highest antigen sequence indentity to the following orthologs: ENSMUSG00000020897: 55%, ENSRNOG00000005659: 53%....
| Schlagworte: | Anti-AIK2, Anti-STK-1, Anti-AURKB, Anti-AIM-1, Anti-ARK-2, Anti-Aurora 1, EC=2.7.11.1, Anti-Aurora kinase B,... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 264,00 €
ZM 447439
Artikelnummer: Cay13601-10
The Aurora kinases have important roles in regulating mitosis and cytokinesis, with Aurora B involved in centromere function as part of the Chromosomal Passenger Complex, with survivin, INCENP, and borealin. ZM 447439 is a selective inhibitor of Aurora B kinase (IC50 = 50 nM), less potently inhibiting Aurora C and A...
| Schlagworte: | N-[4-[[6-methoxy-7-[3-(4-morpholinyl)propoxy]-4-quinazolinyl]amino]phenyl]-benzamide |
| Anwendung: | Aurora B kinase inhibitor |
| CAS | 331771-20-1 |
| MW: | 513.6 D |
ab 92,00 €
Anti-phospho-Aurora B (Thr232)
Artikelnummer: 600-401-677
Protein function: Serine/threonine-protein kinase component of the chromosomal passenger complex (CPC), a complex that acts as a key regulator of mitosis. The CPC complex has essential functions at the centromere in ensuring correct chromosome alignment and segregation and is required for chromatin-induced...
| Schlagworte: | Anti-phospho-AIK2, Anti-phospho-AURKB, Anti-phospho-ARK-2, Anti-phospho-STK-1, Anti-phospho-AIM-1, Anti-phospho-Aurora 1,... |
| Anwendung: | ELISA, IHC, IFM, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 180,00 €
BI-847325
Artikelnummer: TGM-T6785-5mg
Description: BI-847325 is a selective dual inhibitor of MEK and aurora kinases (AK) with IC50 values of 4 and 15 nM for human MEK2 and AK-C, respectively. Target: MEK, Aurora Kinase, Apoptosis. Smiles: CCNC(=O)C#Cc1ccc2\C(=C(\Nc3ccc(CN(C)C)cc3)c3ccccc3)C(=O)Nc2c1. References: Phadke MS, et al. Mol Cancer Ther....
| Anwendung: | MEK / Aurora kinase inhibitor |
| CAS | 1207293-36-4 |
| MW: | 464.56 D |
ab 40,00 €
AMG 900
Artikelnummer: Cay19176-1
Three Aurora kinases, A-C, are involved in phosphorylation events that are critical for the completion of mitosis. Their expression is elevated in a variety of human cancers. AMG 900 is an orally bioavailable, selective Aurora kinase inhibitor with IC50 values of 5, 4, and 1 nM for Aurora A, B, and C, respectively....
| Schlagworte: | N-[4-[[3-(2-amino-4-pyrimidinyl)-2-pyridinyl]oxy]phenyl]-4-(4-methyl-2-thienyl)-1-phthalazinamine |
| Anwendung: | Aurora kinase inhibitor |
| CAS | 945595-80-2 |
| MW: | 503.6 D |
ab 67,00 €
Anti-Aurora B
Artikelnummer: A300-431A
Protein function: Serine/threonine-protein kinase component of the chromosomal passenger complex (CPC), a complex that acts as a key regulator of mitosis. The CPC complex has essential functions at the centromere in ensuring correct chromosome alignment and segregation and is required for chromatin-induced...
| Schlagworte: | Anti-AIK2, Anti-STK-1, Anti-AIM-1, Anti-AURKB, Anti-ARK-2, Anti-Aurora 1, EC=2.7.11.1, Anti-Aurora kinase B,... |
| Anwendung: | WB, IP, ICC-IF |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 165,00 €
Tozasertib
Artikelnummer: SYN-1092-M001
Soluble in DMSO or ethanol. In mammals, three Aurora kinases, Aurora A, Aurora B, and Aurora C, are expressed. Aurora C expression is mainly restricted to testis, where it functions during meiosis, whereas Aurora A and B play key functions regulating mitosis. Aurora A is localized to the centrosome and spindle...
| Schlagworte: | MK-0457, VX-680 |
| Anwendung: | Aurora inhibitor |
| CAS | 639089-54-6 |
| MW: | 464,6 D |
ab 77,00 €
Aurora Kinase B, active human recombinant protein
Artikelnummer: BPS-40002
Active human Aurora kinase B (GenBank Accession No. NM_004217), (a.a. 2- 344), with N-terminal GST-HIS6-tag , expressed in a Baculovirus infected Sf9 cell expression system. The theoretical MW is 70 kDa.
| Schlagworte: | AURKB, STK-1, ARK-2, AIM-1, Aurora 1, Aurora kinase B, Aurora-related kinase 2, Aurora/IPL1-related kinase 2,... |
| Anwendung: | Enzyme kinetics, inhibitor screening |
| MW: | 70 kD |
536,00 €
AZD 1152 (hydrochloride)
Artikelnummer: Cay13647-1
AZD 1152 is an orally bioavailable prodrug of AZD 1152-HQPA, a selective inhibitor of Aurora kinase B (IC50 = 0.36 nM). AZD 1152 is converted to AZD 1152-HQPA in plasma. Inhibition of Aurora B results in disruption of spindle checkpoint functions and chromosome alignment, resulting in inhibition of cytokinesis...
| Schlagworte: | Barasertib,... |
| Anwendung: | Aurora kinase B inhibitor prodrug |
| CAS | 722543-50-2 |
| MW: | 660.5 D |
ab 38,00 €
Hesperadin
Artikelnummer: Cay24199-1
Hesperadin is a multi-kinase inhibitor. It inhibits human Aurora kinase B (IC50 = 250 nM) and its T. brucei homolog Aurora kinase-1 (IC50 = 40 nM) in in vitro kinase assays. Hesperadin (1 µM) inhibits AMPK, LCK, MKK1, MAPKAP-K1, CHK1, and PHK in a panel of 25 kinases. It also inhibits MEKK2 in ATPase and...
| Schlagworte: | N-[2,3-dihydro-2-oxo-3-[(3Z)-phenyl[[4-(1-piperidinylmethyl)phenyl]amino]methylene]-1H-indol-5-yl]-ethanesulfonamide |
| Anwendung: | Multi-kinase inhibitor |
| CAS | 422513-13-1 |
| MW: | 516.7 D |
ab 73,00 €
Danusertib
Artikelnummer: Cay18387-1
Danusertib is a pan-Aurora kinase inhibitor (IC50s = 13, 79, and 61 nM for Aurora A, B, and C, respectively) that also targets Abl, Ret, TrkA and FGFR1 (IC50s = 25, 31, 31, and 47 nM, respectively). It exhibits anti-proliferative and pro-apoptotic activity against a panel of cancer cells in vitro, including those...
| Schlagworte: | PHA-739358,... |
| Anwendung: | Aurora kinase inhibitor |
| CAS | 827318-97-8 |
| MW: | 474.6 D |
ab 57,00 €