Zu "K10865" wurden 53 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
MRE11 (human, recombinant, aa 1-411)
Artikelnummer: Cay40752-10
Meiotic recombination 11 homolog (MRE11) is an endo- and exonuclease and member of the MRE11-RAD50-NBS1 (MRN) complex, which is involved in DNA double-strand break repair. It exists as a homodimer and is composed of an N-terminal nuclease domain with five phosphodiesterase motifs, two dimerization motifs, and a...
| Schlagworte: | HNGS1, MRE11 homolog 1, MRE11 homolog A, MRE11 homolog 1, MRE11 homolog A, Meiotic recombination 11 homolog 1, Meiotic... |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
ab 350,00 €
PFM01
Artikelnummer: TGM-T8880-100mg
Description: PFM01 is an inhibitor of MRE11 endonuclease. PFM01 can regulate double-strand break repair (DSBR) by nonhomologous end-joining (NHEJ) versus homologous recombination (HR). Target: Others. Smiles: CC(C)CN1C(=S)S\C(=C/c2ccc(O)cc2)C1=O. References: Shibata A, et, al. DNA double-strand break repair pathway...
| Anwendung: | Mre11 endonuclease activity inhibitor |
| CAS | 1558598-41-6 |
| MW: | 293.4 D |
ab 40,00 €
Mirin
Artikelnummer: Cay13208-10
Mirin is an inhibitor of the Mre11/Rad50/Nbs1 (MRN) complex, which functions as a DNA damage sensor and activates the DNA repair enzyme ataxia-telangiectasia mutated kinase (ATM). It inhibits phosphorylation of H2AX induced by DNA containing dsDNA breaks (DSBs), indicating decreased ATM activation, with an IC50...
| Schlagworte: | 2-amino-5-[(4-hydroxyphenyl)methylene]-4(5H)-thiazolone |
| Anwendung: | MRN complex inhibitor |
| CAS | 299953-00-7 |
| MW: | 220.3 D |
ab 61,00 €
Anti-MRE11A
Artikelnummer: CSB-PA003273.100
Host Species: Rabbit. Isotype: IgG. Buffer: Liquid in PBS containing 50% glycerol, 0.5% BSA and 0.02% sodium azide. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by affinity-chromatography using epitope-specific...
| Schlagworte: | Anti-HNGS1, Anti-MRE11 homolog 1, Anti-MRE11 homolog A, Anti-Meiotic recombination 11 homolog 1, Anti-Meiotic... |
| Anwendung: | ELISA, WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat, monkey |
ab 126,00 €
Anti-Phospho-MRE11A (S264)
Artikelnummer: CSB-PA010222.100
Host Species: Rabbit. Isotype: IgG. Buffer: Liquid in PBS containing 50% glycerol, 0.5% BSA and 0.02% sodium azide. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by affinity-chromatography using epitope-specific...
| Schlagworte: | Anti-phospho-HNGS1, Anti-phospho-MRE11 homolog 1, Anti-phospho-MRE11 homolog A, Anti-phospho-Meiotic recombination 11... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 126,00 €
Anti-MRE11A
Artikelnummer: CSB-PA056873.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: MRE11. Antigen Species: Human
| Schlagworte: | Anti-HNGS1, Anti-MRE11 homolog 1, Anti-MRE11 homolog A, Anti-Meiotic recombination 11 homolog 1, Anti-Meiotic... |
| Anwendung: | ELISA, WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 167,00 €
Anti-MRE11A
Artikelnummer: CSB-PA584586.100
Host Species: Rabbit. Isotype: IgG. Buffer: Rabbit IgG in phosphate buffered saline (without Mg2+ and Ca2+), pH 7.4, 150mM NaCl, 0.02% sodium azide and 50% glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by...
| Schlagworte: | Anti-HNGS1, Anti-MRE11 homolog 1, Anti-MRE11 homolog A, Anti-Meiotic recombination 11 homolog 1, Anti-Meiotic... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
283,00 €
Anti-MRE11A
Artikelnummer: CSB-PA620425.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: MRE11. Antigen Species: Human
| Schlagworte: | Anti-HNGS1, Anti-MRE11 homolog 1, Anti-MRE11 homolog A, Anti-Meiotic recombination 11 homolog 1, Anti-Meiotic... |
| Anwendung: | ELISA, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €
Anti-MRE11A
Artikelnummer: CSB-PA926920.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: MRE11. Antigen Species: Human
| Schlagworte: | Anti-HNGS1, Anti-MRE11 homolog 1, Anti-MRE11 homolog A, Anti-Meiotic recombination 11 homolog 1, Anti-Meiotic... |
| Anwendung: | ELISA, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 167,00 €
Anti-Mre11
Artikelnummer: A303-998A-T
Protein function: Component of the MRN complex, which plays a central role in double-strand break (DSB) repair, DNA recombination, maintenance of telomere integrity and meiosis. The complex possesses single-strand endonuclease activity and double-strand- specific 3'-5' exonuclease activity, which are provided by...
| Schlagworte: | Anti-HNGS1, Anti-MRE11 homolog A, Anti-MRE11 homolog 1, Anti-Meiotic recombination 11 homolog A, Anti-Meiotic... |
| Anwendung: | WB, IP, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 178,00 €
Anti-Mre11
Artikelnummer: 600-401-872
Protein function: Involved in DNA double-strand break repair (DSBR). Possesses single-strand endonuclease activity and double-strand- specific 3'-5' exonuclease activity. Also involved in meiotic DSB processing. [The UniProt Consortium]
| Schlagworte: | Anti-MRE11, Anti-YMR224C, Anti-Double-strand break repair protein MRE11 |
| Anwendung: | ELISA, ChIP, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | s.cerivisiae |
719,00 €
Anti-Mre11
Artikelnummer: 600-401-896
Protein function: Component of the MRN complex, which plays a central role in double-strand break (DSB) repair, DNA recombination, maintenance of telomere integrity and meiosis. The complex possesses single-strand endonuclease activity and double-strand- specific 3'-5' exonuclease activity, which are provided by...
| Schlagworte: | Anti-Mre11, Anti-Mre11a, Anti-MmMRE11A, Anti-MRE11 homolog A, Anti-MRE11 homolog 1, Anti-Meiotic recombination 11 homolog... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | mouse |
719,00 €