- Suchergebnis für K10351
Cookie-Einstellungen
Diese Website benutzt Cookies, die für den technischen Betrieb der Website erforderlich sind und stets gesetzt werden. Andere Cookies, die den Komfort bei Benutzung dieser Website erhöhen, der Direktwerbung dienen oder die Interaktion mit anderen Websites und sozialen Netzwerken vereinfachen sollen, werden nur mit Ihrer Zustimmung gesetzt.
Konfiguration
Technisch erforderlich
Diese Cookies sind für die Grundfunktionen des Shops notwendig.
"Alle Cookies ablehnen" Cookie
"Alle Cookies annehmen" Cookie
Ausgewählter Shop
CSRF-Token
Cookie-Einstellungen
FACT-Finder Tracking
Individuelle Preise
Kundenspezifisches Caching
Session
Währungswechsel
Komfortfunktionen
Diese Cookies werden genutzt um das Einkaufserlebnis noch ansprechender zu gestalten, beispielsweise für die Wiedererkennung des Besuchers.
Facebook-Seite in der rechten Blog - Sidebar anzeigen
Merkzettel
Statistik & Tracking
Endgeräteerkennung
Kauf- und Surfverhalten mit Google Tag Manager
Partnerprogramm
Zu "K10351" wurden 46 Artikel gefunden!
Filter schließen
Filtern nach:
Für die Filterung wurden keine Ergebnisse gefunden!
Artikelnummer: NSJ-FY13066
Adding 0.2 ml of distilled water will yield a concentration of 500 ug/ml. MYL2 antibody detects myosin regulatory light chain 2, a contractile protein critical for cardiac and skeletal muscle contraction. The UniProt recommended name is Myosin regulatory light chain 2 (MYL2). This 166-amino-acid protein binds to the...
| Schlagworte: | Anti-MYL2, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2, Anti-Myosin light chain 2, slow... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, monkey, mouse, rat |
790,00 €
Artikelnummer: Cay42816-100
Myosin light-chain 2 (MLC2), also known as myosin regulatory light chain 2, is a subtype of MLC expressed in cardiac ventricular and skeletal slow-twitch muscles. MLC2 is composed of three calcium-binding EF-hand domains and is found in the head-stem interface of myosin with other MLC isoforms. It is phosphorylated...
| Schlagworte: | MLC-2v, MYL2, Myosin Light Chain 2, Myosin Regulatory Light Chain 2, RLC2, Ventricular Myosin Light Chain 2 |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
554,00 €
Artikelnummer: Cay36304-1
Aficamten is an inhibitor of cardiac myosin ATPase (IC50 = 1.26 µM for the bovine enzyme). It reduces fractional shortening in isolated rat cardiac ventricular myocytes (IC50 = 7.9 µM) and in rats in a dose-dependent manner.Formal Name:...
| Schlagworte: | CK-274, CK-3773274, N-[(1R)-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,3-dihydro-1H-inden-1-yl]-1-methyl-1H-pyrazole-4-carboxamide |
| Anwendung: | Cardiac myosin ATPase inhibitor |
| CAS | 2364554-48-1 |
| MW: | 337.4 D |
ab 143,00 €
Artikelnummer: TGM-T9258-25mg
Description: Aficamten is a Next-Generation Cardiac Myosin Inhibitor for the Treatment of Hypertrophic Cardiomyopathy. Target: Others, Myosin. Smiles: CCc1nc(no1)-c1ccc2[C@@H](CCc2c1)NC(=O)c1cnn(C)c1
| Anwendung: | Targets myosin heavy chain 6/7 (MYH6_7) |
| CAS | 2364554-48-1 |
| MW: | 337.38 D |
ab 65,00 €
Artikelnummer: ARG56986.50
Protein function: Contractile protein that plays a role in heart development and function. Following phosphorylation, plays a role in cross-bridge cycling kinetics and cardiac muscle contraction by increasing myosin lever arm stiffness and promoting myosin head diffusion, as a consequence of the increase in maximum...
| Schlagworte: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Anwendung: | WB, FC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human, rat |
518,00 €
Artikelnummer: E-AB-10476.120
Thus gene encodes the regulatory light chain associated with cardiac myosin beta (or slow) heavy chain. Ca+ triggers the phosphorylation of regulatory light chain that in turn triggers contraction. Mutations in this gene are associated with mid-left ventricular chamber type hypertrophic cardiomyopathy. Protein...
| Schlagworte: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Anwendung: | WB, ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 89,00 €
Artikelnummer: E-AB-14231.120
Thus gene encodes the regulatory light chain associated with cardiac myosin beta (or slow) heavy chain. Ca+ triggers the phosphorylation of regulatory light chain that in turn triggers contraction. Mutations in this gene are associated with mid-left ventricular chamber type hypertrophic cardiomyopathy. Protein...
| Schlagworte: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Anwendung: | WB, ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 89,00 €
Artikelnummer: E-AB-70328.120
MYL2,also named as MLC-2v and MLC-2,is ventricular/cardiac muscle isoform. Defects in MYL2 are the cause of cardiomyopathy familial hypertrophic type 10 (CMH10). Defects in MYL2 are the cause of cardiomyopathy familial hypertrophic with mid-left ventricular chamber type 2 (MVC2). MYL2 has been widely used as a...
| Schlagworte: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Myosin light chain 2, slow skeletal/ventricular muscle isoform, Anti-Myosin... |
| Anwendung: | IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | mouse, rat |
ab 195,00 €
Artikelnummer: NSJ-RQ5348
Antibody in PBS with 0.02% sodium azide, 50% glycerol and 0.4-0.5mg/ml BSA. The MYL2 gene encodes the regulatory light chain associated with cardiac myosin beta (or slow) heavy chain. Ca+ triggers the phosphorylation of regulatory light chain that in turn triggers contraction. Mutations in this gene are associated...
| Schlagworte: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | mouse |
790,00 €
Artikelnummer: ARG41514.100
Protein function: Contractile protein that plays a role in heart development and function. Following phosphorylation, plays a role in cross-bridge cycling kinetics and cardiac muscle contraction by increasing myosin lever arm stiffness and promoting myosin head diffusion, as a consequence of the increase in maximum...
| Schlagworte: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Anwendung: | IHC (paraffin), IP, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
658,00 €
Artikelnummer: ATA-HPA019763.100
Protein function: Contractile protein that plays a role in heart development and function. Following phosphorylation, plays a role in cross-bridge cycling kinetics and cardiac muscle contraction by increasing myosin lever arm stiffness and promoting myosin head diffusion, as a consequence of the increase in maximum...
| Schlagworte: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Anwendung: | WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 330,00 €
Artikelnummer: ATA-HPA039262.100
Protein function: Contractile protein that plays a role in heart development and function. Following phosphorylation, plays a role in cross-bridge cycling kinetics and cardiac muscle contraction by increasing myosin lever arm stiffness and promoting myosin head diffusion, as a consequence of the increase in maximum...
| Schlagworte: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Anwendung: | IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 330,00 €