Zu "K10351" wurden 46 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-MYL2 / Myosin regulatory light chain 2
Artikelnummer: NSJ-FY13066
Adding 0.2 ml of distilled water will yield a concentration of 500 ug/ml. MYL2 antibody detects myosin regulatory light chain 2, a contractile protein critical for cardiac and skeletal muscle contraction. The UniProt recommended name is Myosin regulatory light chain 2 (MYL2). This 166-amino-acid protein binds to the...
| Schlagworte: | Anti-MYL2, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2, Anti-Myosin light chain 2, slow... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, monkey, mouse, rat |
790,00 €
Anti-MLC2 (Phospho-Ser19) Rabbit (Clone RM484
Artikelnummer: Cay42816-100
Myosin light-chain 2 (MLC2), also known as myosin regulatory light chain 2, is a subtype of MLC expressed in cardiac ventricular and skeletal slow-twitch muscles. MLC2 is composed of three calcium-binding EF-hand domains and is found in the head-stem interface of myosin with other MLC isoforms. It is phosphorylated...
| Schlagworte: | MLC-2v, MYL2, Myosin Light Chain 2, Myosin Regulatory Light Chain 2, RLC2, Ventricular Myosin Light Chain 2 |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
554,00 €
Aficamten
Artikelnummer: Cay36304-1
Aficamten is an inhibitor of cardiac myosin ATPase (IC50 = 1.26 µM for the bovine enzyme). It reduces fractional shortening in isolated rat cardiac ventricular myocytes (IC50 = 7.9 µM) and in rats in a dose-dependent manner.Formal Name:...
| Schlagworte: | CK-274, CK-3773274, N-[(1R)-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,3-dihydro-1H-inden-1-yl]-1-methyl-1H-pyrazole-4-carboxamide |
| Anwendung: | Cardiac myosin ATPase inhibitor |
| CAS | 2364554-48-1 |
| MW: | 337.4 D |
ab 143,00 €
Aficamten
Artikelnummer: TGM-T9258-25mg
Description: Aficamten is a Next-Generation Cardiac Myosin Inhibitor for the Treatment of Hypertrophic Cardiomyopathy. Target: Others, Myosin. Smiles: CCc1nc(no1)-c1ccc2[C@@H](CCc2c1)NC(=O)c1cnn(C)c1
| Anwendung: | Targets myosin heavy chain 6/7 (MYH6_7) |
| CAS | 2364554-48-1 |
| MW: | 337.38 D |
ab 65,00 €
Anti-Myosin Light Chain 2, clone 3B2
Artikelnummer: ARG56986.50
Protein function: Contractile protein that plays a role in heart development and function. Following phosphorylation, plays a role in cross-bridge cycling kinetics and cardiac muscle contraction by increasing myosin lever arm stiffness and promoting myosin head diffusion, as a consequence of the increase in maximum...
| Schlagworte: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Anwendung: | WB, FC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human, rat |
518,00 €
Anti-MYL2
Artikelnummer: E-AB-10476.120
Thus gene encodes the regulatory light chain associated with cardiac myosin beta (or slow) heavy chain. Ca+ triggers the phosphorylation of regulatory light chain that in turn triggers contraction. Mutations in this gene are associated with mid-left ventricular chamber type hypertrophic cardiomyopathy. Protein...
| Schlagworte: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Anwendung: | WB, ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 89,00 €
Anti-MYL2
Artikelnummer: E-AB-14231.120
Thus gene encodes the regulatory light chain associated with cardiac myosin beta (or slow) heavy chain. Ca+ triggers the phosphorylation of regulatory light chain that in turn triggers contraction. Mutations in this gene are associated with mid-left ventricular chamber type hypertrophic cardiomyopathy. Protein...
| Schlagworte: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Anwendung: | WB, ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 89,00 €
Anti-MYL2
Artikelnummer: E-AB-70328.120
MYL2,also named as MLC-2v and MLC-2,is ventricular/cardiac muscle isoform. Defects in MYL2 are the cause of cardiomyopathy familial hypertrophic type 10 (CMH10). Defects in MYL2 are the cause of cardiomyopathy familial hypertrophic with mid-left ventricular chamber type 2 (MVC2). MYL2 has been widely used as a...
| Schlagworte: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Myosin light chain 2, slow skeletal/ventricular muscle isoform, Anti-Myosin... |
| Anwendung: | IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | mouse, rat |
ab 195,00 €
Anti-Myosin Light Chain 2 / MLC2 / MYL2, clone FHO-13
Artikelnummer: NSJ-RQ5348
Antibody in PBS with 0.02% sodium azide, 50% glycerol and 0.4-0.5mg/ml BSA. The MYL2 gene encodes the regulatory light chain associated with cardiac myosin beta (or slow) heavy chain. Ca+ triggers the phosphorylation of regulatory light chain that in turn triggers contraction. Mutations in this gene are associated...
| Schlagworte: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | mouse |
790,00 €
Anti-Myosin Light Chain 2
Artikelnummer: ARG41514.100
Protein function: Contractile protein that plays a role in heart development and function. Following phosphorylation, plays a role in cross-bridge cycling kinetics and cardiac muscle contraction by increasing myosin lever arm stiffness and promoting myosin head diffusion, as a consequence of the increase in maximum...
| Schlagworte: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Anwendung: | IHC (paraffin), IP, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
658,00 €
Anti-MYL2
Artikelnummer: ATA-HPA019763.100
Protein function: Contractile protein that plays a role in heart development and function. Following phosphorylation, plays a role in cross-bridge cycling kinetics and cardiac muscle contraction by increasing myosin lever arm stiffness and promoting myosin head diffusion, as a consequence of the increase in maximum...
| Schlagworte: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Anwendung: | WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 330,00 €
Anti-MYL2
Artikelnummer: ATA-HPA039262.100
Protein function: Contractile protein that plays a role in heart development and function. Following phosphorylation, plays a role in cross-bridge cycling kinetics and cardiac muscle contraction by increasing myosin lever arm stiffness and promoting myosin head diffusion, as a consequence of the increase in maximum...
| Schlagworte: | Anti-MLC-2, Anti-MLC-2v, Anti-MLC-2s/v, Anti-Cardiac myosin light chain 2, Anti-Ventricular myosin light chain 2,... |
| Anwendung: | IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 330,00 €