Zu "K09406" wurden 30 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
FOxM1 Protein, Human, Recombinant (GST)
Artikelnummer: TGM-TMPH-01350-100ug
Description: Transcriptional factor regulating the expression of cell cycle genes essential for DNA replication and mitosis. Plays a role in the control of cell proliferation. Plays also a role in DNA breaks repair participating in the DNA damage checkpoint response. FOxM1 Protein, Human, Recombinant (GST) is...
| Schlagworte: | Hepatocyte nuclear factor 3 forkhead homolog 11, Forkhead box protein M1, FOXM1, Transcription factor Trident,... |
| MW: | 43.8 kD |
ab 236,00 €
FOxM1 Protein, Human, Recombinant (His & Myc & SUMO)
Artikelnummer: TGM-TMPH-01351-100ug
Description: Transcriptional factor regulating the expression of cell cycle genes essential for DNA replication and mitosis. Plays a role in the control of cell proliferation. Plays also a role in DNA breaks repair participating in the DNA damage checkpoint response. FOxM1 Protein, Human, Recombinant (His & Myc &...
| Schlagworte: | M-phase phosphoprotein 2, Forkhead box protein M1, Forkhead-related protein FKHL16, Hepatocyte nuclear factor 3 forkhead... |
| MW: | 31.2 kD |
ab 236,00 €
FDI-6
Artikelnummer: TGM-T4005-100mg
Description: FDI-6 is an effective and selective inhibitor of FOXM1 that blocks DNA binding. FDI-6(FDI6) binds to the FOXM1 protein and specifically downregulates FOXM1-activated genes. Target: Others. Smiles: Nc1c(sc2nc(cc(c12)C(F)(F)F)-c1cccs1)C(=O)Nc1ccc(F)cc1. References: Gormally MV., et al. Suppression of the...
| Schlagworte: | FDI6, FDI 6 |
| Anwendung: | FOXM1 DNA-binding activity inhibitor |
| CAS | 313380-27-7 |
| MW: | 437.43 D |
ab 34,00 €
Forkhead box protein M1 (FOxM1), partial, human, recombinant
Artikelnummer: CSB-EP008828HU.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 235-327aa. Protein Length: Partial. Tag Info: N-terminal 10xHis-SUMO-tagged and C-terminal Myc-tagged. Target Protein Sequence: ERPPYSYMAM IQFAINSTER KRMTLKDIYT WIEDHFPYFK HIAKPGWKNS IRHNLSLHDM FVRETSANGK VSFWTIHPSA NRYLTLDQVF KPL. Purity: Greater...
| Schlagworte: | FOXM1, FKHL16, HFH-11, Forkhead box protein M1, M-phase phosphoprotein 2, HNF-3/fork-head homolog 11, Transcription factor... |
| Anwendung: | Activity not tested |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 31.2 kD |
ab 247,00 €
Forkhead box protein M1 (FOxM1), partial, human, recombinant
Artikelnummer: CSB-EP008828HU1.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 222-360aa. Protein Length: Partial. Tag Info: N-terminal GST-tagged. Target Protein Sequence: PSRPSASWQN SVSERPPYSY MAMIQFAINS TERKRMTLKD IYTWIEDHFP YFKHIAKPGW KNSIRHNLSL HDMFVRETSA NGKVSFWTIH PSANRYLTLD QVFKPLDPGS PQLPEHLESQ QKRPNPELRR NMTIKTELP....
| Schlagworte: | FOXM1, FKHL16, HFH-11, Forkhead box protein M1, M-phase phosphoprotein 2, HNF-3/fork-head homolog 11, Transcription factor... |
| Anwendung: | Activity not tested |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 43.8 kD |
ab 247,00 €
Siomycin A
Artikelnummer: Cay15378-500
The mammalian transcription factor forkhead box M1 (FoxM1) is induced during G1 phase, with expression continuing through S phase and mitosis. Siomycin A is a peptide thiazole antibiotic, first isolated from S. sioyaensis, that interacts with the 23S rRNA of bacteria. It inhibits FoxM1 (IC50 = ~5 µM), preventing the...
| Schlagworte: | NSC 285116,... |
| Anwendung: | FoxM1 expression inhibitor |
| CAS | 12656-09-6 |
| MW: | 1648.9 D |
542,00 €
Thiostrepton
Artikelnummer: Cay19200-500
The mammalian transcription factor forkhead box M1 (FoxM1) is induced during G1 phase, with expression continuing through S phase and mitosis. Thiostrepton is a natural peptide thiazole antibiotic that inhibits FoxM1 in mammalian cells, preventing the expression of FoxM1-regulated genes, which includes FoxM1 itself....
| Schlagworte: | Bryamycin, NSC 170365, NSC 81722, Thiactin, Thiostreptin A,... |
| Anwendung: | FoxM1 inhibitor |
| CAS | 1393-48-2 |
| MW: | 1664.9 D |
ab 90,00 €
Anti-FOXM1
Artikelnummer: A301-533A
Protein function: Transcriptional factor regulating the expression of cell cycle genes essential for DNA replication and mitosis. Plays a role in the control of cell proliferation. Plays also a role in DNA breaks repair participating in the DNA damage checkpoint response. [The UniProt Consortium]
| Schlagworte: | Anti-FOXM1, Anti-HFH-11, Anti-FKHL16, Anti-Forkhead box protein M1, Anti-M-phase phosphoprotein 2, Anti-HNF-3/fork-head... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 178,00 €
Anti-FOXM1
Artikelnummer: A301-532A
Protein function: Transcriptional factor regulating the expression of cell cycle genes essential for DNA replication and mitosis. Plays a role in the control of cell proliferation. Plays also a role in DNA breaks repair participating in the DNA damage checkpoint response. [The UniProt Consortium]
| Schlagworte: | Anti-FOXM1, Anti-HFH-11, Anti-FKHL16, Anti-Forkhead box protein M1, Anti-M-phase phosphoprotein 2, Anti-HNF-3/fork-head... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 178,00 €
Anti-FOXM1
Artikelnummer: NSJ-R31607
0.5mg/ml if reconstituted with 0.2ml sterile DI water. Forkhead box protein M1 is encoded by the FOXM1 gene. It is a member of the FOX family of transcription factors. FOXM1 is known to play a key role in cell cycle progression where endogenous FOXM1 expression peaks at S and G2/M phases and also in the control of...
| Schlagworte: | Anti-FOXM1, Anti-HFH-11, Anti-FKHL16, Anti-Forkhead box protein M1, Anti-M-phase phosphoprotein 2, Anti-HNF-3/fork-head... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
772,00 €
Anti-FOXM1
Artikelnummer: ARG57595.100
Protein function: Transcriptional factor regulating the expression of cell cycle genes essential for DNA replication and mitosis. Plays a role in the control of cell proliferation. Plays also a role in DNA breaks repair participating in the DNA damage checkpoint response. [The UniProt Consortium]
| Schlagworte: | Anti-FOXM1, Anti-FKHL16, Anti-HFH-11, Anti-Forkhead box protein M1, Anti-M-phase phosphoprotein 2, Anti-HNF-3/fork-head... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
658,00 €
Anti-FOXM1
Artikelnummer: ATA-HPA029974.100
Protein function: Transcriptional factor regulating the expression of cell cycle genes essential for DNA replication and mitosis. Plays a role in the control of cell proliferation. Plays also a role in DNA breaks repair participating in the DNA damage checkpoint response. [The UniProt Consortium] Buffer: 40%...
| Schlagworte: | Anti-FOXM1, Anti-HFH-11, Anti-FKHL16, Anti-Forkhead box protein M1, Anti-M-phase phosphoprotein 2, Anti-HNF-3/fork-head... |
| Anwendung: | IHC, ChIP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 320,00 €