Zu "K08231" wurden 11 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-MCT8
Artikelnummer: A304-351A
Protein function: Very active and specific thyroid hormone transporter. Stimulates cellular uptake of thyroxine (T4), triiodothyronine (T3), reverse triiodothyronine (rT3) and diidothyronine. Does not transport Leu, Phe, Trp or Tyr. [The UniProt Consortium]
| Schlagworte: | Anti-MCT8, Anti-MCT 8, Anti-MCT 7, Anti-SLC16A2, Anti-Monocarboxylate transporter 7, Anti-Monocarboxylate transporter 8,... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 165,00 €
Anti-SLC16A2
Artikelnummer: ATA-HPA003353.100
Protein function: Very active and specific thyroid hormone transporter. Stimulates cellular uptake of thyroxine (T4), triiodothyronine (T3), reverse triiodothyronine (rT3) and diidothyronine. Does not transport Leu, Phe, Trp or Tyr. [The UniProt Consortium] Buffer: 40% glycerol and PBS (pH 7.2). 0.02% sodium azide...
| Schlagworte: | Anti-MCT8, Anti-MCT 7, Anti-MCT 8, Anti-SLC16A2, Anti-Monocarboxylate transporter 8, Anti-Monocarboxylate transporter 7,... |
| Anwendung: | IHC, ICC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 330,00 €
Silychristin
Artikelnummer: TGM-T3879-100mg
Description: Silychristin (Silicristin) is a plant growth regulator. Silychristin is an anti-hepatotoxic agent. Silychristin is the inhibitor of horseradish peroxidases and lipoxygenase. Target: Lipoxygenase. Smiles: COc1cc(ccc1O)[C@@H]1Oc2c(cc(cc2O)[C@H]2Oc3cc(O)cc(O)c3C(=O)[C@@H]2O)[C@H]1CO. References: Vavríková...
| Schlagworte: | Silicristin |
| Anwendung: | Bioactive flavonolignan |
| CAS | 33889-69-9 |
| MW: | 482.44 D |
ab 41,00 €
Silychristin
Artikelnummer: Cay34658-10
Silychristin is a flavonolignan that has been found in S. marianum and has diverse biological activities. It inhibits monocarboxylate transporter 8 (MCT8, IC50 = ~100 nM) and MCT8-dependent uptake of the thyroid hormone 3,3',5-triiodo-L-thyronine (T3) in MDCK cells and primary mouse astrocytes (IC50s = 170 and 50...
| Schlagworte: | (+)-Silychristin, Silychristin A,... |
| Anwendung: | Bioactive flavonolignan |
| CAS | 33889-69-9 |
| MW: | 482.4 D |
ab 265,00 €
Anti-SLC16A2
Artikelnummer: ATA-HPA072719.100
Protein function: Very active and specific thyroid hormone transporter. Stimulates cellular uptake of thyroxine (T4), triiodothyronine (T3), reverse triiodothyronine (rT3) and diidothyronine. Does not transport Leu, Phe, Trp or Tyr. [The UniProt Consortium] Buffer: 40% glycerol and PBS (pH 7.2). 0.02% sodium azide...
| Schlagworte: | Anti-MCT8, Anti-MCT 7, Anti-MCT 8, Anti-SLC16A2, Anti-Monocarboxylate transporter 8, Anti-Monocarboxylate transporter 7,... |
| Anwendung: | ICC, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 330,00 €
Anti-SLC16A2
Artikelnummer: CSB-PA062013.100
Host Species: Rabbit. Isotype: IgG. Buffer: Rabbit IgG in phosphate buffered saline (without Mg2+ and Ca2+), pH 7.4, 150mM NaCl, 0.02% sodium azide and 50% glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by...
| Schlagworte: | Anti-MCT8, Anti-MCT 7, Anti-MCT 8, Anti-SLC16A2, Anti-Monocarboxylate transporter 7, Anti-Monocarboxylate transporter 8,... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
284,00 €
SLC16A2 PrEST Antigen
Artikelnummer: ATA-APrEST93099.100
Protein function: Very active and specific thyroid hormone transporter. Stimulates cellular uptake of thyroxine (T4), triiodothyronine (T3), reverse triiodothyronine (rT3) and diidothyronine. Does not transport Leu, Phe, Trp or Tyr. [The UniProt Consortium] Buffer: PBS and 1M Urea, pH 7.4.
| Schlagworte: | MCT8, MCT 7, MCT 8, SLC16A2, Monocarboxylate transporter 8, Monocarboxylate transporter 7, Solute carrier family 16 member... |
| Anwendung: | Control antigen |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
264,00 €
Anti-SLC16A2
Artikelnummer: G-CAB3636.20
Protein function: Very active and specific thyroid hormone transporter. Stimulates cellular uptake of thyroxine (T4), triiodothyronine (T3), reverse triiodothyronine (rT3) and diidothyronine. Does not transport Leu, Phe, Trp or Tyr. [The UniProt Consortium]
| Schlagworte: | Anti-MCT8, Anti-MCT 7, Anti-MCT 8, Anti-SLC16A2, Anti-Monocarboxylate transporter 7, Anti-Monocarboxylate transporter 8,... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
103,00 €
Anti-MCT8
Artikelnummer: ELK-ES7234.100
This gene encodes an integral membrane protein that functions as a transporter of thyroid hormone. The encoded protein facilitates the cellular importation of thyroxine (T4), triiodothyronine (T3), reverse triiodothyronine (rT3) and diidothyronine (T2). This gene is expressed in many tissues and likely plays an...
| Schlagworte: | Anti-MCT 7, Anti-MCT 8, Anti-SLC16A2, Anti-Monocarboxylate transporter 7, Anti-Monocarboxylate transporter 8, Anti-Solute... |
| Anwendung: | WB, ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 173,00 €
Anti-SLC16A2
Artikelnummer: CSB-PA050099.100
Host Species: Rabbit. Isotype: IgG. Buffer: Liquid in PBS containing 50% glycerol, 0.5% BSA and 0.02% sodium azide. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by affinity-chromatography using epitope-specific...
| Schlagworte: | Anti-MCT8, Anti-MCT 7, Anti-MCT 8, Anti-SLC16A2, Anti-Monocarboxylate transporter 7, Anti-Monocarboxylate transporter 8,... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 126,00 €
Anti-SLC16A2
Artikelnummer: CSB-PA021409GA01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: PBS with 0.1% Sodium Azide, 50% Glycerol, pH 7.3. -20°C, Avoid freeze / thaw cycles. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen Affinity Purified. Target Name: SLC16A2. Antigen Species: Human
| Schlagworte: | Anti-MCT8, Anti-MCT 7, Anti-MCT 8, Anti-SLC16A2, Anti-Monocarboxylate transporter 7, Anti-Monocarboxylate transporter 8,... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
552,00 €