Zu "K08080" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
N-Glycolylneuraminic acid
Artikelnummer: TGM-T19456-100mg
Description: N-Glycolylneuraminic acid (GcNeu) is a nonhuman sialic acid molecule synthesized in pigs. N-Glycolylneuraminic acid is a receptor of human and animal IAVs. Target: Influenza Virus, Endogenous Metabolite. Smiles: OC[C@@H](O)[C@@H](O)[C@@H]1O[C@@](O)(C[C@H](O)[C@H]1NC(=O)CO)C(O)=O. References: Takahashi...
| Schlagworte: | NeuGc, GcNeu |
| Anwendung: | Sialic acid, CMAH product |
| CAS | 1113-83-3 |
| MW: | 325.27 D |
ab 45,00 €
N-Glycolylneuraminic Acid
Artikelnummer: Cay30283-10
N-Glycolylneuraminic acid (Neu5Gc) is a sialic acid that is found in non-human primate tissues. It is not endogenously produced in humans due to a mutation in the gene that encodes CMP-Neu5Ac hydroxylase, the enzyme that hydrolyzes N-acetylneuraminic acid to form Neu5Gc, but accumulates in human cells after...
| Schlagworte: | Neu5Gc, N-glycolyl-Neuraminic Acid, N-(2-hydroxyacetyl)-neuraminic acid |
| Anwendung: | Sialic acid, CMAH product |
| CAS | 1113-83-3 |
| MW: | 325.3 D |
ab 85,00 €
NEU
Anti-cmah
Artikelnummer: CSB-PA750189XA01DIL.2
Make to order. Production time: 70-80 business days. Deliverables: 1. 200 µg antigen (used as positive control), 2. 1 ml pre-immune serum (used as negative control) , 3. Rabbit polyclonal antibody, antigen affinity purified. Quality Guarantee: 1. Antibody purity > 90% confirmed by SDS-PAGE, 2. Antibody titer > 1:...
| Schlagworte: | Anti-cmah, EC=1.14.18.2, Anti-CMP-NeuAc hydroxylase, Anti-CMP-Neu5Ac hydroxylase, Anti-CMP-N-acetylneuraminate... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | Danio rerio (Zebrafish) (Brachydanio rerio) |
ab 1.529,00 €
