Zu "K07439" wurden 23 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
7alpha-Hydroxycholesterol
Artikelnummer: TGM-T19161-10mg
Description: 7alpha-Hydroxycholesterol, a cholesterol oxide formed through both enzymatic and non-enzymatic oxidation, can serve as a biomarker for lipid peroxidation. Target: Others. Smiles: [H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCCC(C)C. References: Ferderbar...
| Anwendung: | Bile acid precursor |
| CAS | 566-26-7 |
| MW: | 402.65 D |
ab 42,00 €
Anti-CYP39A1
Artikelnummer: CSB-PA001977.50
Host Species: Rabbit. Isotype: IgG. Buffer: Liquid in PBS containing 50% glycerol, 0.5% BSA and 0.02% sodium azide. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by affinity-chromatography using epitope-specific...
| Schlagworte: | Anti-hCYP39A1, Anti-Cytochrome P450 39A1, Anti-Oxysterol 7-alpha-hydroxylase, Anti-24-hydroxycholesterol... |
| Anwendung: | ELISA, WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
126,00 €
Anti-CYP39A1
Artikelnummer: CSB-PA234598.100
Host Species: Rabbit. Isotype: IgG. Buffer: Rabbit IgG in phosphate buffered saline (without Mg2+ and Ca2+), pH 7.4, 150mM NaCl, 0.02% sodium azide and 50% glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by...
| Schlagworte: | Anti-hCYP39A1, Anti-Cytochrome P450 39A1, Anti-Oxysterol 7-alpha-hydroxylase, Anti-24-hydroxycholesterol... |
| Anwendung: | ELISA, WB, IF |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
283,00 €
Anti-CYP39A1
Artikelnummer: CSB-PA447749.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: CYP39A1. Antigen Species: Human
| Schlagworte: | Anti-hCYP39A1, Anti-Cytochrome P450 39A1, Anti-Oxysterol 7-alpha-hydroxylase, Anti-24-hydroxycholesterol... |
| Anwendung: | ELISA, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €
Anti-CYP39A1
Artikelnummer: CSB-PA932307.100
Host Species: Rabbit. Isotype: IgG. Buffer: Rabbit IgG in phosphate buffered saline (without Mg2+ and Ca2+), pH 7.4, 150mM NaCl, 0.02% sodium azide and 50% glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: The antibody was affinity-purified from rabbit antiserum by...
| Schlagworte: | Anti-hCYP39A1, Anti-Cytochrome P450 39A1, Anti-Oxysterol 7-alpha-hydroxylase, Anti-24-hydroxycholesterol... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
283,00 €
Anti-CYP39A1
Artikelnummer: CSB-PA956260.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: CYP39A1. Antigen Species: Human
| Schlagworte: | Anti-hCYP39A1, Anti-Cytochrome P450 39A1, Anti-Oxysterol 7-alpha-hydroxylase, Anti-24-hydroxycholesterol... |
| Anwendung: | ELISA, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €
Anti-CYP39A1
Artikelnummer: E-AB-14913.60
This gene encodes a member of the cytochrome P450 superfamily of enzymes. The cytochrome P450 proteins are monooxygenases which catalyze many reactions involved in drug metabolism and synthesis of cholesterol, steroids and other lipids. This endoplasmic reticulum protein is involved in the conversion of cholesterol...
| Schlagworte: | Anti-CYP39A1, Anti-hCYP39A1, Anti-Cytochrome P450 39A1, Anti-Oxysterol 7-alpha-hydroxylase, Anti-24-hydroxycholesterol... |
| Anwendung: | IHC, ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 89,00 €
Anti-CYP39A1
Artikelnummer: E-AB-11122.120
This gene encodes a member of the cytochrome P450 superfamily of enzymes. The cytochrome P450 proteins are monooxygenases which catalyze many reactions involved in drug metabolism and synthesis of cholesterol, steroids and other lipids. This endoplasmic reticulum protein is involved in the conversion of cholesterol...
| Schlagworte: | Anti-CYP39A1, Anti-hCYP39A1, Anti-Cytochrome P450 39A1, Anti-Oxysterol 7-alpha-hydroxylase, Anti-24-hydroxycholesterol... |
| Anwendung: | IHC, ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 89,00 €
Anti-CYP39A1, FITC conjugated
Artikelnummer: CSB-PA882143LC01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, pH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: CYP39A1. Antigen Species: Human
| Schlagworte: | Anti-hCYP39A1, Anti-Cytochrome P450 39A1, Anti-Oxysterol 7-alpha-hydroxylase, Anti-24-hydroxycholesterol... |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €
Anti-CYP39A1, Biotin conjugated
Artikelnummer: CSB-PA882143LD01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, pH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: CYP39A1. Antigen Species: Human
| Schlagworte: | Anti-hCYP39A1, Anti-Cytochrome P450 39A1, Anti-Oxysterol 7-alpha-hydroxylase, Anti-24-hydroxycholesterol... |
| Anwendung: | ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €
Anti-CYP39A1, HRP conjugated
Artikelnummer: CSB-PA882143LB01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, pH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: CYP39A1. Antigen Species: Human
| Schlagworte: | Anti-hCYP39A1, Anti-Cytochrome P450 39A1, Anti-Oxysterol 7-alpha-hydroxylase, Anti-24-hydroxycholesterol... |
| Anwendung: | ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €
Anti-CYP39A1
Artikelnummer: CSB-PA882143LA01HU.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, pH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: CYP39A1. Antigen Species: Human
| Schlagworte: | Anti-hCYP39A1, Anti-Cytochrome P450 39A1, Anti-Oxysterol 7-alpha-hydroxylase, Anti-24-hydroxycholesterol... |
| Anwendung: | ELISA, WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €