Zu "K06643" wurden 154 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
(±)-Nutlin-3
Artikelnummer: Cay10004372-5
(±)-Nutlin-3 is a racemic mixture of the p53-Mdm2 protein-protein interaction inhibitor (-)-nutlin-3 (Cay-18585) and its less active enantiomer (+)-nutlin-3 (Cay-10009816). In vivo, (±)-nutlin-3 (200 mg/kg twice daily) reduces tumor volume in an SJSA-1 osteosarcoma mouse xenograft model.Formal Name:...
| Schlagworte: | rel-4-[[(4R,5S)-4,5-bis(4-chlorophenyl)-4,5-dihydro-2-[4-methoxy-2-(1-methylethoxy)phenyl]-1H-imidazol-1-yl]carbonyl]-2-pi... |
| Anwendung: | Cell cycle arrest promotor |
| CAS | 548472-68-0 |
| MW: | 581.5 D |
ab 52,00 €
Anti-MDM2
Artikelnummer: ABS-KC-1054.100
Protein function: E3 ubiquitin-protein ligase that mediates ubiquitination of p53/TP53, leading to its degradation by the proteasome. Inhibits p53/TP53- and p73/TP73-mediated cell cycle arrest and apoptosis by binding its transcriptional activation domain. Also acts as a ubiquitin ligase E3 toward itself and ARRB1....
| Schlagworte: | Anti-E3 ubiquitin-protein ligase Mdm2, Anti-Double minute 2 protein, Anti-Hdm2, Anti-Oncoprotein Mdm2, Anti-RING-type E3... |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
Anti-MDM2
Artikelnummer: ABS-KC-1055.100
Protein function: E3 ubiquitin-protein ligase that mediates ubiquitination of p53/TP53, leading to its degradation by the proteasome. Inhibits p53/TP53- and p73/TP73-mediated cell cycle arrest and apoptosis by binding its transcriptional activation domain. Also acts as a ubiquitin ligase E3 toward itself and ARRB1....
| Schlagworte: | Anti-E3 ubiquitin-protein ligase Mdm2, Anti-Double minute 2 protein, Anti-Hdm2, Anti-Oncoprotein Mdm2, Anti-RING-type E3... |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 232,00 €
Anti-MDM2
Artikelnummer: ABS-KC-1056.100
Protein function: E3 ubiquitin-protein ligase that mediates ubiquitination of p53/TP53, leading to its degradation by the proteasome. Inhibits p53/TP53- and p73/TP73-mediated cell cycle arrest and apoptosis by binding its transcriptional activation domain. Also acts as a ubiquitin ligase E3 toward itself and ARRB1....
| Schlagworte: | Anti-E3 ubiquitin-protein ligase Mdm2, Anti-Double minute 2 protein, Anti-Hdm2, Anti-Oncoprotein Mdm2, Anti-RING-type E3... |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
Anti-MDM2 (phospho S166)
Artikelnummer: ABS-KC-2243.100
Protein function: E3 ubiquitin-protein ligase that mediates ubiquitination of p53/TP53, leading to its degradation by the proteasome. Inhibits p53/TP53- and p73/TP73-mediated cell cycle arrest and apoptosis by binding its transcriptional activation domain. Also acts as a ubiquitin ligase E3 toward itself and ARRB1....
| Schlagworte: | Anti-E3 ubiquitin-protein ligase Mdm2, Anti-Double minute 2 protein, Anti-Hdm2, Anti-Oncoprotein Mdm2, Anti-RING-type E3... |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
Anti-MDM2 (phospho S166)
Artikelnummer: ABS-KC-2244.100
Protein function: E3 ubiquitin-protein ligase that mediates ubiquitination of p53/TP53, leading to its degradation by the proteasome. Inhibits p53/TP53- and p73/TP73-mediated cell cycle arrest and apoptosis by binding its transcriptional activation domain. Also acts as a ubiquitin ligase E3 toward itself and ARRB1....
| Schlagworte: | Anti-E3 ubiquitin-protein ligase Mdm2, Anti-Double minute 2 protein, Anti-Hdm2, Anti-Oncoprotein Mdm2, Anti-RING-type E3... |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
MDM2 (human), recombinant protein
Artikelnummer: ABS-PP-364.20
| Schlagworte: | E3 ubiquitin-protein ligase Mdm2, Double minute 2 protein, Hdm2, Oncoprotein Mdm2, RING-type E3 ubiquitin transferase... |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 29 kD |
ab 90,00 €
(-)-Nutlin-3
Artikelnummer: Cay18585-1
(-)-Nutlin-3 is an inhibitor of the protein-protein interaction between p53 and Mdm2 (IC50 = 0.09 µM). It increases p53 levels, induces apoptosis, and reduces cell viability in HCT116, SJSA-1, and RKO cells that express wild-type p53 but not MDA-MB-435 or SW480 cells expressing mutant p53. (-)-Nutlin-3 (200 mg/kg)...
| Schlagworte: | Nutlin 3a,... |
| Anwendung: | Mdm2-p53 binding inhibitor |
| CAS | 675576-98-4 |
| MW: | 581.5 D |
ab 128,00 €
DS-3032
Artikelnummer: Cay41838-1
DS-3032 is an inhibitor of the protein-protein interaction between murine double minute 2 (MDM2) and p53. It induces apoptosis in WaGa and PeTa Merkel cell carcinoma cells when used at a concentration of 100 nM. DS-3032 (1 µM) decreases the viability of p53 wild-type MKL-1 cells but not p53 knockout MLK-1 cells. In...
| Schlagworte: | DS-3032b, Milademetan, RAIN-32,... |
| Anwendung: | MDM2-p53 protein-protein interaction inhibitor |
| CAS | 1398568-47-2 |
| MW: | 618.5 D |
ab 217,00 €
HDM-201 succinate
Artikelnummer: TGM-T70328-100mg
Description: HDM-201 succinate is an orally bioavailable human double minute 2 homolog (HDM2) inhibitor with potential antineoplastic activity. Target: Others. Smiles: OC(=O)CCC(O)=O.COc1ncc(-c2nc3C(=O)N([C@H](c3n2C(C)C)c2ccc(Cl)cc2)c2cc(Cl)cn(C)c2=O)c(OC)n1
| Anwendung: | Targets E3 ubiquitin-protein ligase Mdm2 [EC:2.3.2.27] (MDM2) |
| CAS | 1638193-48-2 |
| MW: | 673.5 D |
ab 1.820,00 €
Nutlin-3b
Artikelnummer: TGM-T6614-100mg
Description: Nutlin-3b ((+)-Nutlin-3) is a p53/MDM2 antagonist or inhibitor (IC50: 13.6 µM), 150-fold less potent (+)-enantiomer of Nutlin-3 as in comparison with opposite (-)-enantiomer Nutlin-3a. Target: Mdm2, E1/E2/E3 Enzyme. Smiles:...
| Schlagworte: | (+)-Nutlin-3 |
| Anwendung: | Control |
| CAS | 675576-97-3 |
| MW: | 581.49 D |
ab 37,00 €
Brigimadlin
Artikelnummer: TGM-T69923-25mg
Description: Brigimadlin (BI 907828) is an orally active and highly potent E3 ubiquitin-protein ligase MDM2-p53 antagonist with antitumor activity.Brigimadlin can be used to study metastatic BTC, PDAC, lung adenocarcinoma, or bladder cancer. Target: Others, p53, Mdm2. Smiles:...
| Schlagworte: | BI907828, BI-907828, BI 907828 |
| Anwendung: | Targets E3 ubiquitin-protein ligase Mdm2 [EC:2.3.2.27] (MDM2) |
| CAS | 2095116-40-6 |
| MW: | 591.46 D |
ab 269,00 €