Zu "K05925" wurden 40 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-Recombinant METTL3, clone 9F2
Artikelnummer: E-AN301064L.100
This gene encodes the 70 kDa subunit of MT-A which is part of N6-adenosine-methyltransferase. This enzyme is involved in the posttranscriptional methylation of internal adenosine residues in eukaryotic mRNAs, forming N6-methyladenosine.
| Schlagworte: | Anti-METTL3, Anti-Methyltransferase-like protein 3, Anti-N(6)-adenosine-methyltransferase 70 kDa subunit,... |
| Anwendung: | WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 258,00 €
STM2457
Artikelnummer: Cay34280-10
STM2457 is an inhibitor of the methyltransferase-like 3 (METTL3) and METTL14 complex (IC50 = 16.9 µM). It inhibits growth in a panel of acute myeloid leukemia (AML) cell lines (IC50s = 0.6-10.3 µM). STM2457 also inhibits the proliferation, migration, and invasion of HuCC-T1 and HCCC-9810 intrahepatic...
| Schlagworte: | N-[[6-[[(cyclohexylmethyl)amino]methyl]imidazo[1,2-a]pyridin-2-yl]methyl]-4-oxo-4H-pyrido[1,2-a]pyrimidine-2-carboxamide |
| Anwendung: | The METTL3/14 complex inhibitor |
| CAS | 2499663-01-1 |
| MW: | 444.5 D |
ab 123,00 €
Anti-METTL3/MT-A70
Artikelnummer: A301-567A
Protein function: The METTL3-METTL14 heterodimer forms a N6- methyltransferase complex that methylates adenosine residues of some RNAs and regulates the circadian clock, differentiation of embryonic stem cells and primary miRNA processing (PubMed:22575960, PubMed:24284625, PubMed:25719671, PubMed:25799998,...
| Schlagworte: | Anti-MTA70, Anti-MT-A70, Anti-METTL3, Anti-hMETTL3, Anti-Methyltransferase-like protein 3,... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 165,00 €
Anti-METTL3/MT-A70
Artikelnummer: A301-568A
Protein function: The METTL3-METTL14 heterodimer forms a N6- methyltransferase complex that methylates adenosine residues of some RNAs and regulates the circadian clock, differentiation of embryonic stem cells and primary miRNA processing (PubMed:22575960, PubMed:24284625, PubMed:25719671, PubMed:25799998,...
| Schlagworte: | Anti-MTA70, Anti-MT-A70, Anti-METTL3, Anti-hMETTL3, Anti-Methyltransferase-like protein 3,... |
| Anwendung: | WB, IP, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 165,00 €
Anti-METTL3
Artikelnummer: ARG56406.100
Protein function: The METTL3-METTL14 heterodimer forms a N6- methyltransferase complex that methylates adenosine residues of some RNAs and regulates the circadian clock, differentiation of embryonic stem cells and primary miRNA processing (PubMed:22575960, PubMed:24284625, PubMed:25719671, PubMed:25799998,...
| Schlagworte: | Anti-MTA70, Anti-METTL3, Anti-MT-A70, Anti-hMETTL3, Anti-Methyltransferase-like protein 3,... |
| Anwendung: | WB, IHC (paraffin) |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
723,00 €
Anti-METTL3/MT-A70 (IHC)
Artikelnummer: IHC-00342
Protein function: The METTL3-METTL14 heterodimer forms a N6- methyltransferase complex that methylates adenosine residues of some RNAs and regulates the circadian clock, differentiation of embryonic stem cells and primary miRNA processing (PubMed:22575960, PubMed:24284625, PubMed:25719671, PubMed:25799998,...
| Schlagworte: | Anti-MTA70, Anti-MT-A70, Anti-METTL3, Anti-hMETTL3, Anti-Methyltransferase-like protein 3,... |
| Anwendung: | IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 165,00 €
METTL3, FLAG-Tag
Artikelnummer: BPS-100055
Human Methyltransferase-like 3 (METTL3), GenBank Accession No. NM_019852, 2-580 (end) with N-terminal FLAG-tag, expressed by baculovirus in Sf9 insect cells. MW = 66 kDa.
| Schlagworte: | MTA70, MT-A70, hMETTL3, Methyltransferase-like protein 3, N6-adenosine-methyltransferase 70 kDa subunit,... |
| Anwendung: | Positive control for Western blot studies |
| Exprimiert in: | insect cells |
| Ursprungsart: | human |
| MW: | 66 kD |
573,00 €
Anti-METTL3
Artikelnummer: E-AB-63141.120
This gene encodes the 70 kDa subunit of MT-A which is part of N6-adenosine-methyltransferase. This enzyme is involved in the posttranscriptional methylation of internal adenosine residues in eukaryotic mRNAs, forming N6-methyladenosine. Protein function: The METTL3-METTL14 heterodimer forms a N6- methyltransferase...
| Schlagworte: | Anti-MTA70, Anti-MT-A70, Anti-hMETTL3, Anti-Methyltransferase-like protein 3, Anti-N6-adenosine-methyltransferase 70 kDa... |
| Anwendung: | WB, IHC, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 243,00 €
Anti-METTL3 / M6A
Artikelnummer: NSJ-RQ4669
0.5mg/ml if reconstituted with 0.2ml sterile DI water. N6-adenosine-methyltransferase 70 kDa subunit (METTL3) is an enzyme that in humans is encoded by the METTL3 gene. It is mapped to 14q11.2. This gene encodes the 70 kDa subunit of MT-A which is part of N6-adenosine-methyltransferase. This enzyme is involved in...
| Schlagworte: | Anti-MTA70, Anti-MT-A70, Anti-hMETTL3, Anti-Methyltransferase-like protein 3, Anti-N6-adenosine-methyltransferase 70 kDa... |
| Anwendung: | WB, FC, Direct ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
790,00 €
Anti-METTL3
Artikelnummer: ARG43451.50
Protein function: The METTL3-METTL14 heterodimer forms a N6-methyltransferase complex that methylates adenosine residues at the N(6) position of some RNAs and regulates various processes such as the circadian clock, differentiation of embryonic and hematopoietic stem cells, cortical neurogenesis, response to DNA...
| Schlagworte: | Anti-MTA70, Anti-MT-A70, Anti-MT-A70, Anti-hMETTL3, Anti-hMETTL3, Anti-Methyltransferase-like protein 3,... |
| Anwendung: | FC, ICC, IF, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
551,00 €
N6-adenosine-methyltransferase catalytic subunit...
Artikelnummer: CSB-EP773027HU.1
Organism: Homo sapiens (Human). Source: E.coli. Expression Region: 2-580aa. Protein Length: Full Length of Mature Protein. Tag Info: N-terminal 10xHis-tagged. Target Protein Sequence: SDTWSSIQAH KKQLDSLRER LQRRRKQDSG HLDLRNPEAA LSPTFRSDSP VPTAPTSGGP KPSTASAVPE LATDPELEKK LLHHLSDLAL TLPTDAVSIC LAISTPDAPA TQDGVESLLQ...
| Schlagworte: | MTA70, MT-A70, hMETTL3, Methyltransferase-like protein 3, N6-adenosine-methyltransferase 70 kDa subunit,... |
| Anwendung: | Activity not tested |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 70.4 kD |
ab 292,00 €
STM2457
Artikelnummer: TGM-T9060-10mg
Description: STM2457 is an inhibitor of the RNA methyltransferase METTL3 (IC50=16.9 nM) with selective and oral activity.STM2457 can be used in acute myeloid leukemia (AML) studies. Target: Apoptosis, Others. Smiles: O=C(NCc1cn2cc(CNCC3CCCCC3)ccc2n1)c1cc(=O)n2ccccc2n1. References: Yankova E, et al. Small-molecule...
| Anwendung: | The METTL3/14 complex inhibitor |
| CAS | 2499663-01-1 |
| MW: | 444.53 D |
ab 95,00 €