Zu "K05190" wurden 39 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Bilobalide
Artikelnummer: TGM-T2808-1mL
Description: Bilobalide ((-)-Bilobalide), a bioactive from Gingko Biloba, is active on hypoxia-induced alterations. Target: Endogenous Metabolite, Apoptosis, Autophagy. Smiles: [H][C@]12C[C@@](O)(C(C)(C)C)[C@]34[C@@H](O)C(=O)O[C@@]3([H])OC(=O)[C@]14CC(=O)O2. References: Lu L, et al. Clin Exp Dermatol. 2015 Jul 14.
| Schlagworte: | (-)-Bilobalide |
| Anwendung: | Metabolic studies |
| CAS | 33570-04-6 |
| MW: | 326.3 D |
49,00 €
Anti-GABRR1
Artikelnummer: CSB-PA911901.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: GABRR1. Antigen Species: Human
| Schlagworte: | Anti-GABRR1, Anti-GABA(C) receptor, Anti-GABA(A) receptor subunit rho-1, Anti-Gamma-aminobutyric acid receptor subunit... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 167,00 €
TPMPA (hydrate)
Artikelnummer: Cay24302-10
TPMPA is a GABAA-rho1 (rho1 GABAC) receptor antagonist that is 8-fold selective for GABAA-rho1 over GABAA-rho2 (rho2 GABAC) receptors expressed in X. laevis oocytes (Kbs = 2 and 16 µM, respectively). In rat hippocampal slices, TPMPA blocks the inhibitory effect of the GABAB agonist 3-APMPA on excitatory postsynaptic...
| Schlagworte: | P-methyl-P-(1,2,3,6-tetrahydro-4-pyridinyl)-phosphinic acid, hydrate |
| Anwendung: | Gamma-aminobutyric acid receptor subunit rho-1 antagonist |
| MW: | 161.1 D |
ab 49,00 €
(-)-Bilobalide
Artikelnummer: LKT-B3345.10
Bilobalide is a naturally occuring diterpene from Gingko biloba. It has anti-ischemic and anti-convulsant properties.
| Anwendung: | Metabolic studies |
| CAS | 33570-04-6 |
| MW: | 326,3 D |
ab 99,00 €
Anti-GABRR1
Artikelnummer: E-AB-67510.120
GABA is the major inhibitory neurotransmitter in the mammalian brain where it acts at GABA receptors, which are ligand-gated chloride channels. GABRR1 is a member of the rho subunit family. Several transcript variants encoding different isoforms have been found for this gene. Protein function: GABA, the major...
| Schlagworte: | Anti-GABRR1, Anti-GABA(C) receptor, Anti-GABA(A) receptor subunit rho-1, Anti-Gamma-aminobutyric acid receptor subunit... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 243,00 €
TACA
Artikelnummer: Cay35217-10
TACA is an agonist of the rho1 subunit-containing homomeric GABAA receptor, previously known as the GABAC receptor. It binds to homomeric GABAA receptors (Ki = 0.36 µM) and induces chloride currents in X. laevis oocytes expressing the human receptor (EC50 = 0.53 µM). TACA (20 mg/kg) inhibits anxiolytic-like activity...
| Schlagworte: | trans-4-Aminocrotonic Acid, 4-amino-2E-butenoic acid |
| Anwendung: | Homomeric GABAA receptors agonist |
| CAS | 38090-53-8 |
| MW: | 101.1 D |
ab 70,00 €
Nanodisc Human GBRR3-Strep Protein
Artikelnummer: G-HDFP1440.10
Protein function: GABA, the major inhibitory neurotransmitter in the vertebrate brain, mediates neuronal inhibition by binding to the GABA/benzodiazepine receptor and opening an integral chloride channel. [The UniProt Consortium]
| Schlagworte: | GABRR3, GABA(C) receptor, GABA(A) receptor subunit rho-3, Gamma-aminobutyric acid receptor subunit rho-3 |
| Exprimiert in: | Human cells |
| Ursprungsart: | human |
1.336,00 €
Nanodisc Human GBRR1 Protein
Artikelnummer: G-HDFP723.10
Protein function: GABA, the major inhibitory neurotransmitter in the vertebrate brain, mediates neuronal inhibition by binding to the GABA/benzodiazepine receptor and opening an integral chloride channel. Rho-1 GABA receptor could play a role in retinal neurotransmission. [The UniProt Consortium]
| Schlagworte: | GABRR1, GABA(C) receptor, GABA(A) receptor subunit rho-1, Gamma-aminobutyric acid receptor subunit rho-1 |
| Exprimiert in: | Human cells |
| Ursprungsart: | human |
1.486,00 €
Nanodisc Human GBRR1-Strep Protein
Artikelnummer: G-HDFP1438.10
Protein function: GABA, the major inhibitory neurotransmitter in the vertebrate brain, mediates neuronal inhibition by binding to the GABA/benzodiazepine receptor and opening an integral chloride channel. Rho-1 GABA receptor could play a role in retinal neurotransmission. [The UniProt Consortium]
| Schlagworte: | GABRR1, GABA(C) receptor, GABA(A) receptor subunit rho-1, Gamma-aminobutyric acid receptor subunit rho-1 |
| Exprimiert in: | Human cells |
| Ursprungsart: | human |
1.336,00 €
Nanodisc Human GBRR2-Strep Protein
Artikelnummer: G-HDFP1439.10
Protein function: GABA, the major inhibitory neurotransmitter in the vertebrate brain, mediates neuronal inhibition by binding to the GABA/benzodiazepine receptor and opening an integral chloride channel. Rho-2 GABA receptor could play a role in retinal neurotransmission. [The UniProt Consortium]
| Schlagworte: | GABRR2, GABA(C) receptor, GABA(A) receptor subunit rho-2, Gamma-aminobutyric acid receptor subunit rho-2 |
| Exprimiert in: | Human cells |
| Ursprungsart: | human |
1.336,00 €
Nanodisc Human GBRR2 Protein
Artikelnummer: G-HDFP724.10
Protein function: GABA, the major inhibitory neurotransmitter in the vertebrate brain, mediates neuronal inhibition by binding to the GABA/benzodiazepine receptor and opening an integral chloride channel. Rho-2 GABA receptor could play a role in retinal neurotransmission. [The UniProt Consortium]
| Schlagworte: | GABRR2, GABA(C) receptor, GABA(A) receptor subunit rho-2, Gamma-aminobutyric acid receptor subunit rho-2 |
| Exprimiert in: | Human cells |
| Ursprungsart: | human |
1.486,00 €
Nanodisc Human GBRR3 Protein
Artikelnummer: G-HDFP725.10
Protein function: GABA, the major inhibitory neurotransmitter in the vertebrate brain, mediates neuronal inhibition by binding to the GABA/benzodiazepine receptor and opening an integral chloride channel. [The UniProt Consortium]
| Schlagworte: | GABRR3, GABA(C) receptor, GABA(A) receptor subunit rho-3, Gamma-aminobutyric acid receptor subunit rho-3 |
| Exprimiert in: | Human cells |
| Ursprungsart: | human |
1.486,00 €