Zu "K05011" wurden 26 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Lubiprostone
Artikelnummer: TGM-T6307-100mg
Description: Lubiprostone (RU-0211), an activator of ClC-2 chloride channels, is used in the therapy of idiopathic chronic constipation. Target: Chloride channel. Smiles: CCCCC(F)(F)C(=O)CC[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(O)=O. References: Bijvelds MJ, et al. Gastroenterology, 2009, 137(3), 976-1985.
| Schlagworte: | RU-0211, SPI-0211 |
| Anwendung: | ClC-2 activator |
| CAS | 136790-76-6 |
| MW: | 390.46 D |
ab 46,00 €
Anti-CLCN2, Internal
Artikelnummer: ARG65190.100
Protein function: Voltage-gated chloride channel. Chloride channels have several functions including the regulation of cell volume, membrane potential stabilization, signal transduction and transepithelial transport. [The UniProt Consortium]
| Schlagworte: | Anti-CLCN2, Anti-ClC-2, Anti-Chloride channel protein 2 |
| Anwendung: | ELISA, WB |
| Wirt: | Goat |
| Spezies-Reaktivität: | human |
822,00 €
Anti-CLCN2
Artikelnummer: NSJ-R35412-100UG
0.5 mg/ml in 1X TBS, pH7.3, with 0.5% BSA (US sourced) and 0.02% sodium azide. Additional name(s) for this target protein: Chloride channel 2 Protein function: Voltage-gated chloride channel. Chloride channels have several functions including the regulation of cell volume, membrane potential stabilization, signal...
| Schlagworte: | Anti-CLCN2, Anti-ClC-2, Anti-Chloride channel protein 2, CLCN2 Antibody |
| Anwendung: | WB, ELISA (peptide) |
| Wirt: | Goat |
| Spezies-Reaktivität: | human |
790,00 €
Lubiprostone
Artikelnummer: Cay10010487-10
Lubiprostone is an activator of chloride channel protein 2 (ClC-2) and a bicyclic derivative of prostaglandin E1 (PGE1, Cay-13010). It induces chloride currents in HEK293 cells expressing recombinant human ClC-2 (EC50 = ~17 nM), but not CFTR, chloride channels. Lubiprostone (1 µM) induces short-circuit currents, a...
| Schlagworte: | RU-0211, SPI-0211, 16,16-difluoro-11alpha-hydroxy-9,15-dioxo-prostan-1-oic acid |
| Anwendung: | ClC-2 activator |
| CAS | 136790-76-6 |
| MW: | 390.5 D |
ab 85,00 €
Anti-CLCN2
Artikelnummer: ATA-HPA014545.100
Protein function: Voltage-gated chloride channel. Chloride channels have several functions including the regulation of cell volume, membrane potential stabilization, signal transduction and transepithelial transport. Involved in the regulation of aldosterone production. The opening of CLCN2 channels at...
| Schlagworte: | Anti-CLCN2, Anti-ClC-2, Anti-Chloride channel protein 2 |
| Anwendung: | ICC, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 358,00 €
Anti-CLCN2
Artikelnummer: ATA-HPA024108.100
Protein function: Voltage-gated chloride channel. Chloride channels have several functions including the regulation of cell volume, membrane potential stabilization, signal transduction and transepithelial transport. Involved in the regulation of aldosterone production. The opening of CLCN2 channels at...
| Schlagworte: | Anti-CLCN2, Anti-ClC-2, Anti-Chloride channel protein 2 |
| Anwendung: | IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 358,00 €
NEU
Anti-clh-3
Artikelnummer: CSB-PA190466XA01CXY.2
Make to order. Production time: 70-80 business days. Deliverables: 1. 200 µg antigen (used as positive control), 2. 1 ml pre-immune serum (used as negative control) , 3. Rabbit polyclonal antibody, antigen affinity purified. Quality Guarantee: 1. Antibody purity > 90% confirmed by SDS-PAGE, 2. Antibody titer > 1:...
| Schlagworte: | Anti-Chloride channel protein clh-3, clh-3 Antibody |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | Caenorhabditis elegans |
ab 1.529,00 €
NEU
Anti-Clcn2
Artikelnummer: CSB-PA005481XA01RA.2
Make to order. Production time: 70-80 business days. Deliverables: 1. 200 µg antigen (used as positive control), 2. 1 ml pre-immune serum (used as negative control) , 3. Rabbit polyclonal antibody, antigen affinity purified. Quality Guarantee: 1. Antibody purity > 90% confirmed by SDS-PAGE, 2. Antibody titer > 1:...
| Schlagworte: | Anti-Clcn2, Anti-ClC-2, Anti-Chloride channel protein 2, Clcn2 Antibody |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | Rattus norvegicus (Rat) |
ab 1.529,00 €
NEU
Anti-ClC-a
Artikelnummer: CSB-PA894220XA01DLU.2
Make to order. Production time: 70-80 business days. Deliverables: 1. 200 µg antigen (used as positive control), 2. 1 ml pre-immune serum (used as negative control) , 3. Rabbit polyclonal antibody, antigen affinity purified. Quality Guarantee: 1. Antibody purity > 90% confirmed by SDS-PAGE, 2. Antibody titer > 1:...
| Schlagworte: | Anti-ClC-2, Anti-ClC-a, Anti-DmClC-2, Anti-CG31116, Anti-Chloride channel-a, Anti-Chloride channel protein 2, ClC-a Antibody |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | Drosophila melanogaster (Fruit fly) |
ab 1.529,00 €
NEU
Nanodisc Human CLCN2 Protein
Artikelnummer: G-HDFP527.10
Protein function: Voltage-gated chloride channel. Chloride channels have several functions including the regulation of cell volume, membrane potential stabilization, signal transduction and transepithelial transport. Involved in the regulation of aldosterone production. The opening of CLCN2 channels at...
| Schlagworte: | ClC-2, CLCN2, Chloride channel protein 2 |
| Exprimiert in: | Human cells |
| Ursprungsart: | human |
1.486,00 €
NEU
Nanodisc Human CLCN2-Strep Protein
Artikelnummer: G-HDFP1242.10
Protein function: Voltage-gated chloride channel. Chloride channels have several functions including the regulation of cell volume, membrane potential stabilization, signal transduction and transepithelial transport. Involved in the regulation of aldosterone production. The opening of CLCN2 channels at...
| Schlagworte: | ClC-2, CLCN2, Chloride channel protein 2 |
| Exprimiert in: | Human cells |
| Ursprungsart: | human |
1.336,00 €
Human CLCN2 full length protein-synthetic nanodisc
Artikelnummer: DIM-FLP100619.10
This gene encodes a voltage-gated chloride channel. The encoded protein is a transmembrane protein that maintains chloride ion homeostasis in various cells. Defects in this gene may be a cause of certain epilepsies. Four transcript variants encoding different isoforms have been found for this gene. [provided by...
| Schlagworte: | CLCN2, ClC-2, Chloride channel protein 2 |
| Anwendung: | Full length transmembrane protein, FA, ELISA, screening, immunization, cell-based assays, crystallization |
| Exprimiert in: | Human cells |
| Ursprungsart: | human |
| MW: | 98.5 kD |
ab 1.291,00 €