- Suchergebnis für K04977
Cookie-Einstellungen
Diese Website benutzt Cookies, die für den technischen Betrieb der Website erforderlich sind und stets gesetzt werden. Andere Cookies, die den Komfort bei Benutzung dieser Website erhöhen, der Direktwerbung dienen oder die Interaktion mit anderen Websites und sozialen Netzwerken vereinfachen sollen, werden nur mit Ihrer Zustimmung gesetzt.
Konfiguration
Technisch erforderlich
Diese Cookies sind für die Grundfunktionen des Shops notwendig.
"Alle Cookies ablehnen" Cookie
"Alle Cookies annehmen" Cookie
Ausgewählter Shop
CSRF-Token
Cookie-Einstellungen
FACT-Finder Tracking
Individuelle Preise
Kundenspezifisches Caching
Session
Währungswechsel
Komfortfunktionen
Diese Cookies werden genutzt um das Einkaufserlebnis noch ansprechender zu gestalten, beispielsweise für die Wiedererkennung des Besuchers.
Facebook-Seite in der rechten Blog - Sidebar anzeigen
Merkzettel
Statistik & Tracking
Endgeräteerkennung
Kauf- und Surfverhalten mit Google Tag Manager
Partnerprogramm
Zu "K04977" wurden 36 Artikel gefunden!
Filter schließen
Filtern nach:
Für die Filterung wurden keine Ergebnisse gefunden!
Artikelnummer: A300-414A
Protein function: Isoform 1: Nonselective, voltage-independent cation channel that mediates Na(+) and Ca(2+) influx, leading to increased cytoplasmic Ca(2+) levels (PubMed:11960981, PubMed:12594222, PubMed:11385575, PubMed:11509734, PubMed:11804595, PubMed:15561722, PubMed:16601673, PubMed:19171771, PubMed:20660597,...
| Schlagworte: | Anti-TrpC7, Anti-TRPM2, Anti-LTrpC2, Anti-LTrpC-2, Anti-Transient receptor potential channel 7, Anti-Transient receptor... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 165,00 €
Artikelnummer: Cay14531-25
N-(p-amylcinnamoyl) Anthranilic acid (ACA) is a channel blocker that acts on several transient receptor potential (TRP) channels, including TRPM2, TRPM8, and TRPC6 (IC50 = 1.7, 3.8, and 2.3 µM, respectively). It is a weak inhibitor of TRPV1. ACA is also an inhibitor of phospholipase A2, blocking the release of...
| Schlagworte: | ACA, 2-[[1-oxo-3-(4-pentylphenyl)-2-propen-1-yl]amino]-benzoic acid |
| Anwendung: | TRP channel blocker |
| CAS | 110683-10-8 |
| MW: | 337.4 D |
ab 93,00 €
Artikelnummer: Cay21417-1
Cyclic ADP-ribose (cADP-ribose) is an endogenous metabolite of NAD+ that mobilizes the release of stored Ca2+ in the endoplasmic reticulum via ryanodine receptors in various cell types.{12737, 11940, 20368, 34320, 34319} This second messenger is generated via the cADP-ribose synthases CD38 and CD157.{20368, 34319,...
| Schlagworte: | cADPR, cADP-Ribose, 1-beta-D-ribofuranosyl-adenosine 5'-(trihydrogen diphosphate), intramol. P',5''-ester, diammonium salt |
| Anwendung: | Endogenous NAD+ metabolite, second messenger |
| MW: | 575.4 D |
ab 320,00 €
Artikelnummer: TGM-T5454-50mg
Description: N-(p-amylcinnamoyl) Anthranilic Acid (ACA) is a broad-spectrum Phospholipase A2 (PLA2) inhibitor and a TRP channel blocker. Target: TRP/TRPV Channel, Phospholipase. Smiles: CCCCCc1ccc(\C=C\C(=O)Nc2ccccc2C(O)=O)cc1. References: Kraft R, et al. Inhibition of TRPM2 cation channels by...
| Schlagworte: | ACA |
| Anwendung: | TRP channel blocker |
| CAS | 110683-10-8 |
| MW: | 337.41 D |
ab 38,00 €
Artikelnummer: ARG40778.50
Protein function: Isoform 1: Nonselective, voltage-independent cation channel that mediates Na(+) and Ca(2+) influx, leading to increased cytoplasmic Ca(2+) levels (PubMed:11960981, PubMed:12594222, PubMed:11385575, PubMed:11509734, PubMed:11804595, PubMed:15561722, PubMed:16601673, PubMed:19171771, PubMed:20660597,...
| Schlagworte: | Anti-TrpC7, Anti-TRPM2, Anti-LTrpC2, Anti-LTrpC-2, Anti-Transient receptor potential channel 7, Anti-Transient receptor... |
| Anwendung: | IHC (paraffin), WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
584,00 €
Artikelnummer: ARG40825.100
Protein function: Isoform 1: Nonselective, voltage-independent cation channel that mediates Na(+) and Ca(2+) influx, leading to increased cytoplasmic Ca(2+) levels (PubMed:11960981, PubMed:12594222, PubMed:11385575, PubMed:11509734, PubMed:11804595, PubMed:15561722, PubMed:16601673, PubMed:19171771, PubMed:20660597,...
| Schlagworte: | Anti-TrpC7, Anti-TRPM2, Anti-LTrpC2, Anti-LTrpC-2, Anti-Transient receptor potential channel 7, Anti-Transient receptor... |
| Anwendung: | ICC, IF |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | mouse, rat |
707,00 €
Artikelnummer: ATA-HPA030976.100
Protein function: [Isoform 1]: Nonselective, voltage-independent cation channel that mediates Na(+) and Ca(2+) influx, leading to increased cytoplasmic Ca(2+) levels (PubMed:11960981, PubMed:12594222, PubMed:11385575, PubMed:11509734, PubMed:11804595, PubMed:15561722, PubMed:16601673, PubMed:19171771,...
| Schlagworte: | Anti-TrpC7, Anti-TRPM2, Anti-LTrpC2, Anti-LTrpC-2, Anti-Transient receptor potential channel 7, Anti-Transient receptor... |
| Anwendung: | ICC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 330,00 €
Artikelnummer: ATA-HPA035260.100
Protein function: [Isoform 1]: Nonselective, voltage-independent cation channel that mediates Na(+) and Ca(2+) influx, leading to increased cytoplasmic Ca(2+) levels (PubMed:11960981, PubMed:12594222, PubMed:11385575, PubMed:11509734, PubMed:11804595, PubMed:15561722, PubMed:16601673, PubMed:19171771,...
| Schlagworte: | Anti-TrpC7, Anti-TRPM2, Anti-LTrpC2, Anti-LTrpC-2, Anti-Transient receptor potential channel 7, Anti-Transient receptor... |
| Anwendung: | IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 330,00 €
Artikelnummer: NSJ-RQ6967
0.5mg/ml if reconstituted with 0.2ml sterile DI water. Transient receptor potential cation channel subfamily M member 2 (TRPM2), also known as Estrogen-responsive element-associated gene 1 (EREG1), is a protein that in humans is encoded by the TRPM2 gene. Using a cosmid/BAC contig, this gene is mapped to chromosome...
| Schlagworte: | Anti-TrpC7, Anti-TRPM2, Anti-LTrpC2, Anti-LTrpC-2, Anti-Transient receptor potential channel 7, Anti-Transient receptor... |
| Anwendung: | WB, FC, Direct ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
790,00 €
Artikelnummer: Cay38356-500
2'-Deoxyadenosine-5'-O-diphosphoribose is a transient receptor potential melastatin 2 (TRPM2) agonist. It increases calcium-induced currents in an inside-out patch clamp assay using HEK293 cells expressing human TRPM2 when used at a concentration of 30 µM. 2'-Deoxyadenosine-5'-O-diphosphoribose has been found in...
| Schlagworte: | 2'-deoxy ADPR, 2'-deoxy-adenosine 5'-(trihydrogen diphosphate), P'->5-ester with D-ribose, disodium salt |
| Anwendung: | TRPM2 agonist |
| MW: | 587.3 D |
644,00 €
Artikelnummer: Cay38386-600
2'-deoxy NAD+ is a transient receptor potential melastatin 2 (TRPM2) agonist. It increases calcium-induced currents in an inside-out patch clamp assay using HEK293 cells expressing human TRPM2 when used at a concentration of 30 µM. 2'-deoxy NAD+ has been found in Jurkat T cells. It also is a substrate of...
| Schlagworte: | 2'-deoxy-Nicotinamide adenine dinucleotide, 2'-deoxy-adenosine 5'-(trihydrogen diphosphate), P'->5'-ester with... |
| Anwendung: | TRPM2 agonist |
| CAS | 1514900-83-4 |
| MW: | 669.4 D |
560,00 €
Artikelnummer: Cay37447-1
Tat-M2NX is a peptide antagonist of transient receptor potential melastatin 2 (TRPM2). It inhibits hydrogen peroxide-induced calcium influx in HEK293 cells expressing human TRPM2 when used at concentrations ranging from 25 to 100 µM. In vivo, Tat-M2NX (20 mg/kg) reduces brain infarct volume in male, but not female,...
| Anwendung: | Peptide TRPM2 antagonist |
| MW: | 4354.2 D |
ab 100,00 €