Zu "K04799" wurden 69 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-Recombinant FEN1, clone A638
Artikelnummer: E-AN301922L.100
Flap endonuclease-1 (FEN-1) is a structure-specific nuclease with multiple functions in DNA processing pathways. The replication and DNA repair activities of FEN-1 are critical for genomic stability in the eukaryotic cell. Through interaction with proliferation cell nuclear antigen (PCNA), FEN-1 helps coordinate...
| Schlagworte: | Anti-FEN1, Anti-DNase IV, Anti-Maturation factor 1, Anti-Flap endonuclease 1, Anti-Flap structure-specific endonuclease 1,... |
| Anwendung: | WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, rat |
ab 304,00 €
SC-13
Artikelnummer: Cay39717-1
SC-13 is an inhibitor of flap endonuclease 1 (FEN1, IC50 = 4.2 nM) and an activator of stimulator of interferon genes (STING). It increases the levels of gamma histone H2AX (gammaH2AX) in MCF-7 and MDA-MB-231 breast cancer cells when used at a concentration of 40 µM. SC13 (20 or 50 µM) induces chromosomal...
| Schlagworte: | FEN1 inhibitor SC-13, FEN1-IN-SC-13, Flap Endonuclease 1 Inhibitor SC-13, Flap Endonuclease 1-IN-SC-13,... |
| Anwendung: | FEN1 inhibitor, STING activator |
| CAS | 2098776-03-3 |
| MW: | 433.5 D |
ab 38,00 €
FEN1-IN-1
Artikelnummer: TGM-T15274-2mg
Description: FEN1-IN-1 (LNT-1) is an inhibitor of flap endonuclease 1 (FEN1). FEN1-IN-1 binds to the active site of FEN1. It partly achieves inhibition by the co-ordination of Mg2+ ions. Target: Others. Smiles: On1c(=O)n(CC2COc3ccccc3O2)c2ccsc2c1=O. References: Ward TA, et al. Small molecule inhibitors uncover...
| Schlagworte: | LNT-1 |
| Anwendung: | FEN1 inhibitor |
| CAS | 824983-91-7 |
| MW: | 332.33 D |
ab 30,00 €
FEN1-IN-4
Artikelnummer: TGM-T8545-2mg
Description: FEN1-IN-4 (FEN1 Inhibitor C2) is an inhibitor of human flap endonuclease-1 (hFEN1). Target: Others. Smiles: On1c(=O)n(CC2CC2)c2ccccc2c1=O. References: Jack C Exell, et al. Cellularly Active N-hydroxyurea FEN1 Inhibitors Block Substrate Entry to the Active Site. Nat Chem Biol. 2016 Oct,12(10):815-21.
| Schlagworte: | FEN1 Inhibitor C2 |
| Anwendung: | FEN1 inhibitor |
| CAS | 1995893-58-7 |
| MW: | 232.24 D |
ab 39,00 €
Anti-FEN1, clone 7H8-F4-C11
Artikelnummer: ARG54167.100
Protein function: Structure-specific nuclease with 5'-flap endonuclease and 5'-3' exonuclease activities involved in DNA replication and repair. During DNA replication, cleaves the 5'-overhanging flap structure that is generated by displacement synthesis when DNA polymerase encounters the 5'-end of a downstream...
| Schlagworte: | Anti-MF1, Anti-RAD2, Anti-FEN-1, Anti-hFEN-1, Anti-DNase IV, Anti-Flap endonuclease 1, Anti-Maturation factor 1, Anti-Flap... |
| Anwendung: | WB, ICC, IF |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human, mouse, rat, monkey, hamster |
658,00 €
Anti-FEN1, clone 1E7-A6-H6
Artikelnummer: ARG54168.100
Protein function: Structure-specific nuclease with 5'-flap endonuclease and 5'-3' exonuclease activities involved in DNA replication and repair. During DNA replication, cleaves the 5'-overhanging flap structure that is generated by displacement synthesis when DNA polymerase encounters the 5'-end of a downstream...
| Schlagworte: | Anti-MF1, Anti-RAD2, Anti-FEN-1, Anti-hFEN-1, Anti-DNase IV, Anti-Flap endonuclease 1, Anti-Maturation factor 1, Anti-Flap... |
| Anwendung: | WB, IP |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human, mouse, rat |
658,00 €
Anti-Fen1
Artikelnummer: A300-255A
Protein function: Structure-specific nuclease with 5'-flap endonuclease and 5'-3' exonuclease activities involved in DNA replication and repair. During DNA replication, cleaves the 5'-overhanging flap structure that is generated by displacement synthesis when DNA polymerase encounters the 5'-end of a downstream...
| Schlagworte: | Anti-MF1, Anti-RAD2, Anti-FEN-1, Anti-hFEN-1, Anti-DNase IV, Anti-Maturation factor 1, Anti-Flap endonuclease 1, Anti-Flap... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 165,00 €
Anti-Fen1
Artikelnummer: A300-256A
Protein function: Structure-specific nuclease with 5'-flap endonuclease and 5'-3' exonuclease activities involved in DNA replication and repair. During DNA replication, cleaves the 5'-overhanging flap structure that is generated by displacement synthesis when DNA polymerase encounters the 5'-end of a downstream...
| Schlagworte: | Anti-MF1, Anti-RAD2, Anti-FEN-1, Anti-hFEN-1, Anti-DNase IV, Anti-Maturation factor 1, Anti-Flap endonuclease 1, Anti-Flap... |
| Anwendung: | WB, IP, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 165,00 €
FEN1 (human, recombinant)
Artikelnummer: Cay14199-100
Flap endonuclease 1 (FEN1), a RAD2 Class II nuclease, plays a crucial role in DNA repair, replication, and genomic stability. FEN1 removes the 5'-unannealed flap during Okazaki fragment processing in lagging strand DNA synthesis. Removal of the DNA flap is also critical in long-patch base excision repair and...
| Schlagworte: | FLAP Endonuclease 1, hFEN-1 |
| Anwendung: | Enzyme activity, WB |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 43.8 kD |
588,00 €
Anti-Fen1 (IHC)
Artikelnummer: IHC-00335
Protein function: Structure-specific nuclease with 5'-flap endonuclease and 5'-3' exonuclease activities involved in DNA replication and repair. During DNA replication, cleaves the 5'-overhanging flap structure that is generated by displacement synthesis when DNA polymerase encounters the 5'-end of a downstream...
| Schlagworte: | Anti-MF1, Anti-RAD2, Anti-FEN-1, Anti-hFEN-1, Anti-DNase IV, Anti-Maturation factor 1, Anti-Flap endonuclease 1, Anti-Flap... |
| Anwendung: | IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 165,00 €
Anti-FEN1
Artikelnummer: ARG57833.100
Protein function: Structure-specific nuclease with 5'-flap endonuclease and 5'-3' exonuclease activities involved in DNA replication and repair. During DNA replication, cleaves the 5'-overhanging flap structure that is generated by displacement synthesis when DNA polymerase encounters the 5'-end of a downstream...
| Schlagworte: | Anti-MF1, Anti-RAD2, Anti-FEN-1, Anti-hFEN-1, Anti-DNase IV, Anti-Maturation factor 1, Anti-Flap endonuclease 1, Anti-Flap... |
| Anwendung: | ICC, IF, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
707,00 €
Anti-FEN-1
Artikelnummer: NSJ-RQ5695
0.5mg/ml if reconstituted with 0.2ml sterile DI water. Flap endonuclease 1 is an enzyme that in humans is encoded by the FEN1 gene. It is mapped to 11q12.2. The protein encoded by this gene removes 5' overhanging flaps in DNA repair and processes the 5' ends of Okazaki fragments in lagging strand DNA synthesis....
| Schlagworte: | Anti-MF1, Anti-RAD2, Anti-FEN-1, Anti-hFEN-1, Anti-DNase IV, Anti-Flap endonuclease 1, Anti-Maturation factor 1, Anti-Flap... |
| Anwendung: | WB, IHC (paraffin), IF, FC, Direct ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
790,00 €