Zu "K04464" wurden 42 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
XMD17-109
Artikelnummer: TGM-T1842-100mg
Description: XMD17-109 (ERK5-IN-1) is a new selective ERK-5 inhibitor (EC50: 4.2 uM, HEK293 cells). Target: ERK. Smiles: CCOc1cc(ccc1Nc1ncc2N(C)C(=O)c3ccccc3N(C3CCCC3)c2n1)C(=O)N1CCC(CC1)N1CCN(C)CC1. References: Denq X, et al. Eur J Med Chem. 2013, 70, 758-767.
| Schlagworte: | XMD17 109, ERK5-IN-1 |
| Anwendung: | Selective ERK5 inhibitor |
| CAS | 1435488-37-1 |
| MW: | 638.8 D |
ab 37,00 €
XMD8-92
Artikelnummer: TGM-T1843-100mg
Description: XMD8-92 is an effective and specific BMK1/ERK5 inhibitor (Kd: 80 nM). Target: Epigenetic Reader Domain, ERK, BMI-1. Smiles: CCOc1cc(ccc1Nc1ncc2N(C)C(=O)c3ccccc3N(C)c2n1)N1CCC(O)CC1. References: Yang Q, et al. Cancer Cell. 2010, 18(3), 258-267.
| Anwendung: | ERK5 inhibitor |
| CAS | 1234480-50-2 |
| MW: | 474.55 D |
ab 48,00 €
ERK5-IN-1
Artikelnummer: TGM-T5184-100mg
Description: ERK5-IN-1 is a potent ERK5 inhibitor (IC50: 87 nM) and also inhibits LRRK2[G2019S] (IC50: 26 nM). Target: ERK. Smiles: COc1cc(ccc1Nc1ncc2N(C)C(=O)c3ccccc3N(C)c2n1)N1CCN(C)CC1. References: Deng X, et al. Structural determinants for ERK5 (MAPK7) and leucine rich repeat kinase 2 activities of...
| Anwendung: | ERK5 inhibitor |
| CAS | 1234479-76-5 |
| MW: | 459.54 D |
ab 48,00 €
Anti-MAPK7
Artikelnummer: CSB-PA080162.100
Host Species: Rabbit. Isotype: IgG. Buffer: PBS, pH 7.4, containing 0.02% sodium azide as Preservative and 50% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Affinity purification. Target Name: MAPK7. Antigen Species: Human
| Schlagworte: | Anti-BMK1, Anti-BMK-1, Anti-ERK-5, Anti-MAPK7, Anti-MAPK 7, EC=2.7.11.24, Anti-MAP kinase 7, Anti-Big MAP kinase 1,... |
| Anwendung: | WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 126,00 €
Anti-MAPK7
Artikelnummer: CSB-PA080163.100
Host Species: Rabbit. Isotype: IgG. Buffer: PBS, pH 7.4, containing 0.02% sodium azide as Preservative and 50% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Affinity purification. Target Name: MAPK7. Antigen Species: Human
| Schlagworte: | Anti-BMK1, Anti-BMK-1, Anti-ERK-5, Anti-MAPK7, Anti-MAPK 7, EC=2.7.11.24, Anti-MAP kinase 7, Anti-Big MAP kinase 1,... |
| Anwendung: | WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 126,00 €
Anti-MAPK7
Artikelnummer: CSB-PA556658.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: MAPK7. Antigen Species: Human
| Schlagworte: | Anti-BMK1, Anti-BMK-1, Anti-ERK-5, Anti-MAPK7, Anti-MAPK 7, EC=2.7.11.24, Anti-MAP kinase 7, Anti-Big MAP kinase 1,... |
| Anwendung: | ELISA, WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 167,00 €
Anti-MAPK7
Artikelnummer: CSB-PA905442.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: MAPK7. Antigen Species: Human
| Schlagworte: | Anti-BMK1, Anti-BMK-1, Anti-ERK-5, Anti-MAPK7, Anti-MAPK 7, EC=2.7.11.24, Anti-MAP kinase 7, Anti-Big MAP kinase 1,... |
| Anwendung: | ELISA, WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 167,00 €
XMD8-92
Artikelnummer: Cay19173-10
XMD8-92 is an ERK5 inhibitor (Kd = 80 nM) that less potently inhibits DCAMKL2, TNK1, and Plk4 (Kds = 190, 890, and 600 nM, respectively) in a panel of 402 kinases. It blocks ERK5 autophosphorylation, ERK5-mediated phosphorylation of promyelocytic leukemia protein (PML), and PML-dependent activation of p21. XMD8-92...
| Schlagworte: | 2-[[2-ethoxy-4-(4-hydroxy-1-piperidinyl)phenyl]amino]-5,11-dihydro-5,11-dimethyl-6H-pyrimido[4,5-b][1,4]benzodiazepin-6-one |
| Anwendung: | ERK5 inhibitor |
| CAS | 1234480-50-2 |
| MW: | 474.6 D |
ab 44,00 €
XMD17-109
Artikelnummer: Cay25448-5
XMD17-109 is a selective ERK5 inhibitor (IC50 = 0.162 µM in an enzyme assay). It is selective for ERK5 over a panel of more than 200 kinases, inhibiting only ERK5 with greater than 90% target occupancy at a concentration of 10 µM. XMD17-109 inhibits ERK5 phosphorylation (IC50 = 0.09 µM in HeLa cells) and decreases...
| Schlagworte: | ERK5-IN-1,... |
| Anwendung: | Selective ERK5 inhibitor |
| CAS | 1435488-37-1 |
| MW: | 638.8 D |
ab 45,00 €
XMD8-85
Artikelnummer: Cay29662-5
XMD8-85 is an ERK5 inhibitor (IC50 = 87 nM in an enzyme assay). It is selective for ERK5 over tyrosine non-receptor kinase 2 (TNK2, IC50 = 959 nM), but does inhibit the leucine-rich repeat kinase 2 (LRRK2) mutant LRRK2G2019S (IC50 = 26 nM), which has been found in patients with Parkinson's disease. XMD8-85 inhibits...
| Schlagworte: | ERK5-IN-1,... |
| Anwendung: | ERK5 inhibitor |
| CAS | 1234479-76-5 |
| MW: | 459.5 D |
ab 61,00 €
Anti-ERK5
Artikelnummer: A302-655A
Protein function: Plays a role in various cellular processes such as proliferation, differentiation and cell survival. The upstream activator of MAPK7 is the MAPK kinase MAP2K5. Upon activation, it translocates to the nucleus and phosphorylates various downstream targets including MEF2C. EGF activates MAPK7 through...
| Schlagworte: | Anti-BMK1, Anti-MAPK7, Anti-ERK-5, Anti-BMK-1, Anti-MAPK 7, EC=2.7.11.24, Anti-MAP kinase 7, Anti-Big MAP kinase 1,... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 178,00 €
Anti-ERK5
Artikelnummer: A302-656A
Protein function: Plays a role in various cellular processes such as proliferation, differentiation and cell survival. The upstream activator of MAPK7 is the MAPK kinase MAP2K5. Upon activation, it translocates to the nucleus and phosphorylates various downstream targets including MEF2C. EGF activates MAPK7 through...
| Schlagworte: | Anti-BMK1, Anti-MAPK7, Anti-ERK-5, Anti-BMK-1, Anti-MAPK 7, EC=2.7.11.24, Anti-MAP kinase 7, Anti-Big MAP kinase 1,... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 178,00 €