Zu "K04246" wurden 38 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
G-36
Artikelnummer: Cay14397-1
G protein-coupled estrogen receptor (GPER), or GPR30, specifically binds natural and man-made estrogens. It is thought to be involved in estrogen-sensitive cancers. GPER knockout mice are fertile, although they exhibit thymic atrophy, impaired glucose tolerance, and altered bone growth. G-36 is a cell-permeable...
| Schlagworte: | (4S)-rel-4-(6-bromo-1,3-benzodioxol-5-yl)-3aR,4,5,9bS-tetrahydro-8-(1-methylethyl)-3H-cyclopenta[c]quinoline |
| Anwendung: | GPER antagonist |
| CAS | 1392487-51-2 |
| MW: | 412.3 D |
ab 49,00 €
G-1
Artikelnummer: Cay10008933-1
GPR30 is a transmembrane G protein-coupled receptor (GPCR) localized to endoplasmic reticulum (ER) that binds estradiol with high affinity, activating multiple intracellular signaling pathways. G-1 is a nonsteroidal, high-affinity, selective agonist of GPR30 that binds with a Ki value of 11 nM. Competitive binding...
| Schlagworte: | rel-1-[4-(6-bromo-1,3-benzodioxol-5-yl)-3aR,4S,5,9bS-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]-ethanone |
| Anwendung: | GPR30 agonist |
| CAS | 881639-98-1 |
| MW: | 412.3 D |
ab 53,00 €
G-15
Artikelnummer: Cay14673-1
G protein-coupled estrogen receptor (GPER), or GPR30, specifically binds natural and man-made estrogens. It is thought to be involved in estrogen-sensitive cancers. GPER knockout mice are fertile, although they exhibit thymic atrophy, impaired glucose tolerance, and altered bone growth. G-15 is a cell-permeable...
| Schlagworte: | (3aS,4R,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| Anwendung: | GPER / GPR30 antagonist |
| CAS | 1161002-05-6 |
| MW: | 370.2 D |
ab 93,00 €
G-1
Artikelnummer: TGM-T15364-10mg
Description: G-1 is a nonsteroidal, high-affinity, and selective GPR30 agonist (Ki: 11 nM). Target: Estrogen Receptor/ERR, GPR. Smiles: [H][C@@]12CC=C[C@]1([H])c1cc(ccc1N[C@@H]2c1cc2OCOc2cc1Br)C(C)=O. References: Cheng Q, et al. G-1 exerts neuroprotective effects through G protein-coupled estrogen receptor 1...
| Anwendung: | GPR30 agonist |
| CAS | 881639-98-1 |
| MW: | 412.28 D |
ab 41,00 €
Anti-GPER
Artikelnummer: ARG57533.100
Protein function: G-protein coupled estrogen receptor that binds to 17- beta-estradiol (E2) with high affinity, leading to rapid and transient activation of numerous intracellular signaling pathways. Stimulates cAMP production, calcium mobilization and tyrosine kinase Src inducing the release of heparin-bound...
| Schlagworte: | Anti-mER, Anti-CEPR, Anti-FEG-1, Anti-GPER1, Anti-LYGPR, Anti-GPCR-Br, Anti-IL8-related receptor DRY12, Anti-Membrane... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
616,00 €
Human GPER / G-protein coupled estrogen receptor 1 ELISA Kit
Artikelnummer: G-HUFI01093.96
| Anwendung: | ELISA |
| Spezies-Reaktivität: | human |
698,00 €
Mouse GPER / G-protein coupled estrogen receptor 1 ELISA Kit
Artikelnummer: G-MOFI00361.96
| Anwendung: | ELISA |
| Spezies-Reaktivität: | mouse |
698,00 €
Anti-GPR30
Artikelnummer: NSJ-R31359
0.5mg/ml if reconstituted with 0.2ml sterile DI water. G-protein coupled estrogen receptor 1 (GPER1), also known as the GPR30 or CEPR, is a G protein-coupled receptor that in humans is encode d by the GPER gene. This gene is a member of the G-protein coupled receptor 1 family and encodes a multi-pass membrane...
| Schlagworte: | Anti-mER, Anti-CEPR, Anti-FEG-1, Anti-LYGPR, Anti-GPER1, Anti-GPCR-Br, Anti-Membrane estrogen receptor, Anti-IL8-related... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat, monkey |
790,00 €
Anti-GPER1 / GPCR30
Artikelnummer: ARG57743.50
Protein function: G-protein coupled estrogen receptor that binds to 17- beta-estradiol (E2) with high affinity, leading to rapid and transient activation of numerous intracellular signaling pathways. Stimulates cAMP production, calcium mobilization and tyrosine kinase Src inducing the release of heparin-bound...
| Schlagworte: | Anti-mER, Anti-CEPR, Anti-GPER1, Anti-LYGPR, Anti-FEG-1, Anti-GPCR-Br, Anti-IL8-related receptor DRY12, Anti-Membrane... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, monkey |
559,00 €
Human GPER1 (G Protein Coupled Estrogen Receptor 1) CLIA Kit
Artikelnummer: G-HUES00671.96
ELISA Type: CLIA. Sensitivity: 9.375 pg/mL. Range: 15.625--1000 pg/mL. Protein function: G-protein coupled estrogen receptor that binds to 17-beta- estradiol (E2) with high affinity, leading to rapid and transient activation of numerous intracellular signaling pathways. Stimulates cAMP production, calcium...
| Schlagworte: | mER, FEG-1, LYGPR, GPCR-Br, Membrane estrogen receptor, IL8-related receptor DRY12, G-protein coupled receptor 30,... |
| Anwendung: | CLIA |
| Spezies-Reaktivität: | human |
641,00 €
Human GPER1 (G Protein Coupled Estrogen Receptor 1) ELISA...
Artikelnummer: G-HUES02240.96
ELISA Type: Sandwich. Sensitivity: 0.188ng/mL. Range: 0.313--20ng/mL. Protein function: G-protein coupled estrogen receptor that binds to 17-beta- estradiol (E2) with high affinity, leading to rapid and transient activation of numerous intracellular signaling pathways. Stimulates cAMP production, calcium...
| Schlagworte: | mER, FEG-1, LYGPR, GPCR-Br, Membrane estrogen receptor, IL8-related receptor DRY12, G-protein coupled receptor 30,... |
| Anwendung: | Sandwich ELISA |
| Spezies-Reaktivität: | human |
708,00 €
Anti-GPER1
Artikelnummer: ATA-HPA027052.100
Protein function: G-protein coupled estrogen receptor that binds to 17-beta- estradiol (E2) with high affinity, leading to rapid and transient activation of numerous intracellular signaling pathways. Stimulates cAMP production, calcium mobilization and tyrosine kinase Src inducing the release of heparin-bound...
| Schlagworte: | Anti-mER, Anti-FEG-1, Anti-LYGPR, Anti-GPCR-Br, Anti-IL8-related receptor DRY12, Anti-Membrane estrogen receptor,... |
| Anwendung: | IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 330,00 €