Zu "K03237" wurden 69 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-Recombinant eIF2alpha, clone 5C3
Artikelnummer: E-AN300883L.100
The translation initiation factor EIF2 catalyzes the first regulated step of protein synthesis initiation, promoting the binding of the initiator tRNA to 40S ribosomal subunits. Binding occurs as a ternary complex of methionyl-tRNA, EIF2, and GTP. EIF2 is composed of 3 nonidentical subunits, the 36-kD EIF2-alpha...
| Schlagworte: | Anti-EIF2S1, Anti-Eukaryotic translation initiation factor 2 subunit 1, Anti-Eukaryotic translation initiation factor 2... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 258,00 €
Anti-Recombinant EIF2S1, clone A211
Artikelnummer: E-AN301512L.100
The eukaryotic translation initiation factor 2-alpha subunit (EIF2S1) is the first regulatory step that catalyzes the initiation of protein synthesis and promotes the binding of the initial tRNA to the 40S ribosomal subunit. As an important translation initiation factor, the eukaryotic initiation factor 2-alpha...
| Schlagworte: | Anti-EIF2S1, Anti-Eukaryotic translation initiation factor 2 subunit 1, Anti-Eukaryotic translation initiation factor 2... |
| Anwendung: | WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, rat, mouse |
ab 304,00 €
Anti-Phospho-eIF2alpha (Ser51) Monoclonal Recombinant...
Artikelnummer: E-AN300145L.100
The translation initiation factor EIF2 catalyzes the first regulated step of protein synthesis initiation, promoting the binding of the initiator tRNA to 40S ribosomal subunits. Binding occurs as a ternary complex of methionyl-tRNA, EIF2, and GTP. EIF2 is composed of 3 nonidentical subunits, the 36-kD EIF2-alpha...
| Schlagworte: | EIF2A, eIF-2A, eIF2-alpha, eIF-2alpha, eIF-2-alpha, Eukaryotic translation initiation factor 2 subunit 1, Eukaryotic... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 182,00 €
Salubrinal
Artikelnummer: Cay14735-1
Salubrinal is a selective phosphatase inhibitor that prevents dephosphorylation of eukaryotic translation initiation factor 2 subunit alpha (eIF2alpha), protecting PC12 cells from endoplasmic reticulum stress-mediated apoptosis (EC50 = 15 µM). It appears to block the action of protein phosphatase 1 (PP1) on...
| Schlagworte: | (2E)-3-phenyl-N-[2,2,2-trichloro-1-[[(8-quinolinylamino)thioxomethyl]amino]ethyl]-2-propenamide |
| Anwendung: | eIF2alpha dephosphorylation (PP1) inhibitor |
| CAS | 405060-95-9 |
| MW: | 479.8 D |
ab 40,00 €
Anti-eIF2alpha/EIF2S1
Artikelnummer: A300-721A
Protein function: Functions in the early steps of protein synthesis by forming a ternary complex with GTP and initiator tRNA. This complex binds to a 40S ribosomal subunit, followed by mRNA binding to form a 43S preinitiation complex. Junction of the 60S ribosomal subunit to form the 80S initiation complex is...
| Schlagworte: | Anti-EIF2A, Anti-EIF2S1, Anti-eIF-2A, Anti-eIF-2alpha, Anti-eIF-2-alpha, Anti-Eukaryotic translation initiation factor 2... |
| Anwendung: | WB, IP, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 165,00 €
Sal-003
Artikelnummer: Cay23414-5
Sal-003 dose-dependently prevents dephosphorylation of eukaryotic translation initiation factor 2 subunit alpha (eIF2alpha). It is a more potent derivative of salubrinal (Cay-14735) that increases eIF2alpha phosphorylation in mouse embryonic fibroblasts (MEFs) when used at a concentration of 10 µM. It impairs...
| Schlagworte: | (2E)-3-phenyl-N-[2,2,2-trichloro-1-[[[(4-chlorophenyl)amino]thioxomethyl]amino]ethyl]-2-propenamide |
| Anwendung: | EIF2A dephosphorylation inhibitor |
| CAS | 1164470-53-4 |
| MW: | 463.2 D |
ab 145,00 €
Salubrinal
Artikelnummer: TGM-T3045-2mg
Description: Salubrinal, a phosphatases (PP1) inhibitor(IC50=1.7 µM), exhibits function on the eukaryotic translation initiation factor 2 subunit (eIF2alpha). Target: HSV, Apoptosis, PERK, Phosphatase, Autophagy. Smiles: ClC(Cl)(Cl)C(NC(=S)NC1=CC=CC2=CC=CN=C12)NC(=O)\C=C\C1=CC=CC=C1. References: Boyce M, et al....
| Anwendung: | eIF2alpha dephosphorylation (PP1) inhibitor |
| CAS | 405060-95-9 |
| MW: | 479.81 D |
ab 34,00 €
Anti-phospho-eIF2 alpha (Ser51)
Artikelnummer: ARG51760.100
Protein function: Functions in the early steps of protein synthesis by forming a ternary complex with GTP and initiator tRNA. This complex binds to a 40S ribosomal subunit, followed by mRNA binding to form a 43S preinitiation complex. Junction of the 60S ribosomal subunit to form the 80S initiation complex is...
| Schlagworte: | Anti-phospho-EIF2A, Anti-phospho-EIF2S1, Anti-phospho-eIF-2A, Anti-phospho-eIF-2alpha, Anti-phospho-eIF-2-alpha,... |
| Anwendung: | ICC, IF, IHC (paraffin), WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 471,00 €
Anti-phospho-eIF2 alpha (Ser49)
Artikelnummer: ARG51812.100
Protein function: Functions in the early steps of protein synthesis by forming a ternary complex with GTP and initiator tRNA. This complex binds to a 40S ribosomal subunit, followed by mRNA binding to form a 43S preinitiation complex. Junction of the 60S ribosomal subunit to form the 80S initiation complex is...
| Schlagworte: | Anti-phospho-EIF2A, Anti-phospho-EIF2S1, Anti-phospho-eIF-2A, Anti-phospho-eIF-2alpha, Anti-phospho-eIF-2-alpha,... |
| Anwendung: | ICC, IF, IHC (paraffin), WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 471,00 €
Anti-eIF2 alpha, clone 5E10
Artikelnummer: ARG57111.50
Protein function: Functions in the early steps of protein synthesis by forming a ternary complex with GTP and initiator tRNA. This complex binds to a 40S ribosomal subunit, followed by mRNA binding to form a 43S preinitiation complex. Junction of the 60S ribosomal subunit to form the 80S initiation complex is...
| Schlagworte: | Anti-EIF2A, Anti-EIF2S1, Anti-eIF-2A, Anti-eIF-2alpha, Anti-eIF-2-alpha, Anti-Eukaryotic translation initiation factor 2... |
| Anwendung: | WB, FC, ICC, IF |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
518,00 €
Anti-phospho-EIF2A (pS51) (recombinant antibody), clone...
Artikelnummer: NSJ-R20320-0.1ML
Antibody in PBS with 50% Glycerol, 1% BSA and 0.09% sodium azide. This antibody reacts to human eIF-2a (Eukaryotic translation initiation factor 2 subunit alpha) only when phosphorylated at Ser51. There is no cross-reactivity to eIF-2a without phosphorylation at Ser51. Protein function: Functions in the early steps...
| Schlagworte: | Anti-EIF2A, Anti-eIF-2A, Anti-EIF2S1, Anti-eIF-2alpha, Anti-eIF-2-alpha, Anti-Eukaryotic translation initiation factor 2... |
| Anwendung: | WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
772,00 €
Anti-EIF2S1
Artikelnummer: NSJ-R31138
0.5mg/ml if reconstituted with 0.2ml sterile DI water. Eukaryotic Translation Initiation Factor 2, Subunit 1, also called EIF2-alpha or EIF2A, is a protein that in humans is encoded by the EIF2S1 gene. Hartz(2010) mapped the gene to chromosome 14q23.3 based on an alignment of the EIF2S1 sequence with the genomic...
| Schlagworte: | Anti-EIF2A, Anti-eIF-2A, Anti-EIF2S1, Anti-eIF-2alpha, Anti-eIF-2-alpha, Anti-Eukaryotic translation initiation factor 2... |
| Anwendung: | WB, IHC (paraffin) |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
790,00 €