Zu "K02320" wurden 30 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cytarabine
Artikelnummer: Cay16069-10
Cytarabine (ara-C) is a nucleoside analog and prodrug form of the DNA polymerase inhibitor ara-CTP. It is triphosphorylated to ara-CTP by the successive actions of deoxycytidine kinase, deoxycytidylate kinase, and nucleoside diphosphate kinase. Ara-C inhibits proliferation of HL-60, ML-1, Raji, and Jurkat human...
| Schlagworte: | 1-beta-D-Arabinofuranosylcytosine, NSC 287459, NSC 63878, U-19920A, 4-amino-1-beta-D-arabinofuranosyl-2(1H)-pyrimidinone |
| Anwendung: | Competitive DNA polymerase inhibitor |
| CAS | 147-94-4 |
| MW: | 243.2 D |
ab 76,00 €
GEM144
Artikelnummer: Cay44647-1
GEM144 is a dual inhibitor of DNA polymerase alpha (POLA1) and histone deacetylase 11 (HDAC11). It inhibits the primer extension activity of POLA1 in a cell-free assay when used at concentrations ranging from 10 to 50 µM and increases acetylation of alpha-tubulin at lysine 40 in H460 lung cancer cells at 0.4 µM. It...
| Schlagworte: | (2E)-3-[4'-[2-(hydroxyamino)-1-methyl-2-oxoethoxy]-3'-tricyclo[3.3.1.13,7]dec-1-yl[1,1'-biphenyl]-4-yl]-2-propenoic acid |
| Anwendung: | POLA1 / HDAC11 dual inhibitor |
| CAS | 2487526-28-1 |
| MW: | 461.56 D |
ab 69,00 €
(+)-Aphidicolin
Artikelnummer: BVT-0307-M005
Antibiotic, Reversible inhibitor of eukaryotic nuclear DNA replication, Useful for cell synchronization, Blocks the cell cycle at early S phase, Prolongs the half life of DNA methyltransferase, Specific DNA polymerase alpha and delta inhibitor in eukaryotic cells and in some viruses of animal origin, Acts...
| Schlagworte: | NSC234714, BRN4689958, ICI69653 |
| Anwendung: | Eukaryotic nuclear DNA replication inhibitor |
| CAS | 38966-21-1 |
| MW: | 338,5 D |
ab 75,00 €
CX-5461
Artikelnummer: Cay18392-1
CX-5461 is an inhibitor of ribosomal RNA (rRNA) synthesis. It selectively inhibits RNA polymerase I-driven transcription of rRNA in HCT116, A375, and MIA PaCa-2 tumor cells (IC50s = 142, 113, and 54 nM, respectively) without affecting RNA polymerase II (IC50 > 25µM), DNA replication, or protein translation. At 50...
| Schlagworte: | 2-(hexahydro-4-methyl-1H-1,4-diazepin-1-yl)-N-[(5-methyl-2-pyrazinyl)methyl]-5-oxo-5H-benzothiazolo[3,2-a][1,8]naphthyridi... |
| Anwendung: | rRNA synthesis inhibitor |
| CAS | 1138549-36-6 |
| MW: | 513.6 D |
ab 69,00 €
Anti-PolA1
Artikelnummer: A302-851A-T
Protein function: Plays an essential role in the initiation of DNA replication. During the S phase of the cell cycle, the DNA polymerase alpha complex (composed of a catalytic subunit POLA1/p180, a regulatory subunit POLA2/p70 and two primase subunits PRIM1/p49 and PRIM2/p58) is recruited to DNA at the replicative...
| Schlagworte: | Anti-POLA, Anti-POLA1, EC=2.7.7.7, Anti-DNA polymerase alpha catalytic subunit, Anti-DNA polymerase alpha catalytic... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 165,00 €
Aphidicolin
Artikelnummer: LKT-A6229.1
White solid. A DNA polymerase inhibitor. Potentiates apoptosis induced by therapeutic nucleosides.
| Schlagworte: | ICI-69653, NSC-234714 |
| Anwendung: | DNA polymerase inhibitor |
| CAS | 38966-21-1 |
| MW: | 338,48 D |
ab 331,00 €
Cytarabine
Artikelnummer: LKT-C9778.1
Cytarabine is an antimetabolite compound which is proven to be one of the most effective agents available to treat leukemia. It induces its cytotoxic effect by inactivating DNA polymerases alpha, delta, and epsilon and consequently inhibit semi-conservative DNA replication and repair. It also has a potential to...
| Schlagworte: | Ara-C, Arabinofuranosyl Cytidine, cytosine arabinoside |
| Anwendung: | DNA replication inhibitor |
| CAS | 147-94-4 |
| MW: | 243,22 D |
ab 72,00 €
Cytarabine-13C3
Artikelnummer: Cay28805-1
Cytarabine-13C3 (ara-C-13C3) is intended for use as an internal standard for the quantification of ara-C (Cay-16069) by GC- or LC-MS. Ara-C is a nucleoside analog and prodrug form of the DNA polymerase inhibitor ara-CTP. It is triphosphorylated to ara-CTP by the successive actions of deoxycytidine kinase,...
| Schlagworte: | 1-beta-D-Arabinofuranosylcytosine-13C3, Ara-C-13C3, 4-amino-1-beta-D-arabinofuranosyl-2(1H)-pyrimidinone-4,5,6-13C3 |
| Anwendung: | GC-MS, LC-MS, internal standard, quantification |
| MW: | 246.2 D |
404,00 €
Anti-PolA1
Artikelnummer: A302-850A-T
Protein function: Plays an essential role in the initiation of DNA replication. During the S phase of the cell cycle, the DNA polymerase alpha complex (composed of a catalytic subunit POLA1/p180, a regulatory subunit POLA2/p70 and two primase subunits PRIM1/p49 and PRIM2/p58) is recruited to DNA at the replicative...
| Schlagworte: | Anti-POLA, Anti-POLA1, EC=2.7.7.7, Anti-DNA polymerase alpha catalytic subunit, Anti-DNA polymerase alpha catalytic... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 165,00 €
CX-5461
Artikelnummer: TGM-T2100-1mg
Description: CX5461 is an rRNA synthesis inhibitor with oral activity that inhibits Pol I-driven rRNA transcription. CX5461 activates the DNA damage response and has antitumor activity in tumors such as ovarian cancer. Target: DNA/RNA Synthesis. Smiles: CN1CCCN(CC1)c1ccc2c(n1)n1c3ccccc3sc1c(C(=O)NCc1cnc(C)cn1)c2=O
| Anwendung: | rRNA synthesis inhibitor |
| CAS | 1138549-36-6 |
| MW: | 513.61 D |
ab 30,00 €
Aphidicolin 17-acetate
Artikelnummer: BVT-0337-C250
White to off-white solid. Soluble in DMSO or methanol. Phytotoxin (inhibits root growth of seeding), specific inhibitor of eukaryotic DNA polymerase alpha and DNA synthesis (competition with dCTP).
| Schlagworte: | 17-O-Acetylaphidicolin, Aphidicolin 17-monoacetate |
| Anwendung: | Eukaryotic DNA polymerase alpha inhibitor |
| CAS | 51103-57-2 |
| MW: | 380,5 D |
100,00 €
Anti-POLA1
Artikelnummer: ATA-HPA002947.100
Protein function: Catalytic subunit of the DNA polymerase alpha complex (also known as the alpha DNA polymerase-primase complex) which plays an essential role in the initiation of DNA synthesis. During the S phase of the cell cycle, the DNA polymerase alpha complex (composed of a catalytic subunit POLA1, a...
| Schlagworte: | Anti-POLA, Anti-POLA1, Anti-DNA polymerase alpha catalytic subunit, Anti-DNA polymerase alpha catalytic subunit p180 |
| Anwendung: | ICC, IHC, ChIP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 246,00 €