Zu "K01672" wurden 537 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-CA5B
Artikelnummer: ABS-KC-3127.100
Protein function: Reversible hydration of carbon dioxide. [The UniProt Consortium]
| Schlagworte: | Anti-Carbonic anhydrase 5B, Anti-mitochondrial, Anti-Carbonate dehydratase VB, Anti-Carbonic anhydrase VB, Anti-CA-VB,... |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
Anti-CA14
Artikelnummer: ABS-KC-3280.100
Protein function: Reversible hydration of carbon dioxide. [The UniProt Consortium]
| Schlagworte: | Anti-Carbonic anhydrase 14, Anti-Carbonate dehydratase XIV, Anti-Carbonic anhydrase XIV, Anti-CA-XIV, CA14 Antibody |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
Anti-CA5B
Artikelnummer: ABS-OC-514.100
Protein function: Reversible hydration of carbon dioxide. [The UniProt Consortium]
| Schlagworte: | Anti-Carbonic anhydrase 5B, Anti-mitochondrial, Anti-Carbonate dehydratase VB, Anti-Carbonic anhydrase VB, Anti-CA-VB,... |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
Anti-CA14
Artikelnummer: ABS-OC-579.100
Protein function: Reversible hydration of carbon dioxide. [The UniProt Consortium]
| Schlagworte: | Anti-Carbonic anhydrase 14, Anti-Carbonate dehydratase XIV, Anti-Carbonic anhydrase XIV, Anti-CA-XIV, CA14 Antibody |
| Anwendung: | IHC |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
CA1 (human), recombinant protein
Artikelnummer: ABS-PP-052.20
| Schlagworte: | Carbonic anhydrase 1, Carbonate dehydratase I, Carbonic anhydrase B, CAB, Carbonic anhydrase I, CA-I, Cyanamide hydratase... |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 30 kD |
ab 90,00 €
Anti-CA5B
Artikelnummer: ABS-KC-8385.100
Protein function: Reversible hydration of carbon dioxide. [The UniProt Consortium]
| Schlagworte: | Anti-Carbonic anhydrase 5B, Anti-mitochondrial, Anti-Carbonate dehydratase VB, Anti-Carbonic anhydrase VB, Anti-CA-VB,... |
| Anwendung: | IP |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 206,00 €
Anti-CA9 (Capture/Detector)
Artikelnummer: E-AN003040P.1
Carbonic anhydrases (CAs) are a large family of zinc metalloenzymes that catalyze the reversible hydration of carbon dioxide. They participate in a variety of biological processes, including respiration, calcification, acid-base balance, bone resorption, and the formation of aqueous humor, cerebrospinal fluid,...
| Schlagworte: | Anti-CA9, Anti-G250, Anti-pMW1, Anti-CAIX, Anti-CA-IX, Anti-P54/58N, Anti-Membrane antigen MN, Anti-Carbonic anhydrase 9,... |
| Anwendung: | ELISA Capture/Detector |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 158,00 €
Tiliroside
Artikelnummer: TGM-T5S1172-100mg
Description: 1. Tiliroside (Tribuloside) shows anticarcinogenic activity. 2. Tiliroside shows hepatoprotective activity. 3. Tiliroside shows antioxidant and anti-inflammatory activity, can inhibit neuroinflammation in neurodegenerative disorders. 4. Tiliroside has anti-diabetic effect, are at least partially...
| Schlagworte: | Tribuloside |
| Anwendung: | Bioactive flavonoid glycoside |
| CAS | 20316-62-5 |
| MW: | 594.52 D |
ab 63,00 €
Carbonic anhydrase inhibitor 2
Artikelnummer: TGM-T61120-2mg
Description: Compound 7c, identified as carbonic anhydrase inhibitor 1, effectively inhibits carbonic anhydrase II. This inhibitor, also known as carbonic anhydrase inhibitor 3, lowers intraocular pressure in glaucomatous rabbits [1]. Target: Others. Smiles: N(C(NCC(NCC(OC)=O)=O)=O)C1=CC=C(S(N)(=O)=O)C=C1
| Anwendung: | Carbonic anhydrase inhibitor |
| CAS | 2758231-43-3 |
| MW: | 344.34 D |
60,00 €
Carbonic anhydrase inhibitor 14
Artikelnummer: TGM-T61842-100mg
Description: Carbonic anhydrase inhibitor 14 (Compound 8b) is a potent CA inhibitor, exhibiting K i values of 1203, 99.7, 9.4, and 27.7 nM against hCA I, hCA II, hCA IX, and hCA XII, respectively. Additionally, it effectively inhibits CDK2 with an IC 50 of 20.3 µM and demonstrates significant antitumor activity [1]....
| Anwendung: | Carbonic anhydrase inhibitor |
| CAS | 2410402-75-2 |
| MW: | 395.44 D |
ab 1.520,00 €
Carbonic anhydrase inhibitor 7
Artikelnummer: TGM-T62666-100mg
Description: Carbonic anhydrase inhibitor 7 is a potent inhibitor of human carbonic anhydrase (hCA), acting on hCA IX (Ki: 6.5 nM), hCA II (Ki: 7.1 nM), hCA XII (Ki: 72.1 nM) and hCA I (Ki: 255.8 nM). Target: Others. Smiles: C(NC1=CC=C(S(N)(=O)=O)C=C1)(=O)C=2C3=C(N=C(C2)C=4C=C5C(=CC4)OCO5)C=CC=C3
| Anwendung: | Carbonic anhydrase inhibitor |
| CAS | 546105-61-7 |
| MW: | 447.46 D |
ab 1.520,00 €
Methazolamide-d6
Artikelnummer: TGM-T70186-1mg
Description: Methazolamide-d6 is intended for use as an internal standard for the quantification of methazolamide by GC- or LC-MS. Methazolamide is a carbonic anhydrase inhibitor. It reduces intraocular pressure and cerebrospinal fluid flow in a rat model of glaucoma. Methazolamide reduces electroshock-induced...
| Anwendung: | GC-MS, LC-MS internal standard, quantification, carbonic anhydrase inhibitor |
| CAS | 1795142-30-1 |
| MW: | 242.31 D |
ab 594,00 €