Zu "K01335" wurden 68 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-CFB
Artikelnummer: ABS-KC-530.100
Protein function: Factor B which is part of the alternate pathway of the complement system is cleaved by factor D into 2 fragments: Ba and Bb. Bb, a serine protease, then combines with complement factor 3b to generate the C3 or C5 convertase. It has also been implicated in proliferation and differentiation of...
| Schlagworte: | Anti-Complement factor B, Anti-C3/C5 convertase, Anti-Glycine-rich beta glycoprotein, Anti-GBG, Anti-PBF2, Anti-Properdin... |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
ab 232,00 €
Human CFB(Complement Factor B) ELISA Kit
Artikelnummer: ELK-ELK11103.48
The test principle applied in this kit is Sandwich enzyme immunoassay. The microtiter plate provided in this kit has been pre-coated with an antibody specific to Human CFB. Standards or samples are added to the appropriate microtiter plate wells then with a biotin-conjugated antibody specific to Human CFB. Next,...
| Schlagworte: | BF, CFB, EC=3.4.21.47 |
| Anwendung: | ELISA |
| Spezies-Reaktivität: | human |
ab 365,00 €
LNP023
Artikelnummer: Cay41833-1
LNP023 is a complement factor B (CFB) inhibitor (IC50 = 10 nM). It is selective for CFB over a panel of 41 proteases and 110 other enzymes, receptors, and ion channels (IC50s = >30 µM for all). LNP023 inhibits formation of the membrane attack complex induced by zymosan A (Cay-21175) in isolated human whole blood...
| Schlagworte: | Iptacopan, 4-[(2S,4S)-4-ethoxy-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-2-piperidinyl]-benzoic acid |
| Anwendung: | Complement factor B (CFB) inhibitor |
| CAS | 1644670-37-0 |
| MW: | 422.5 D |
ab 48,00 €
Iptacopan hydrochloride
Artikelnummer: TGM-T9189-100mg
Description: Iptacopan hydrochloride (LNP023 hydrochloride) is an orally bioavailable, highly potent and highly selective factor B inhibitor with an IC50 of 10 nM. Iptacopan hydrochloride shows direct, reversible, and high-affinity binding to human factor B with a KD of 7.9 nM. Target: Complement System. Smiles:...
| Schlagworte: | Iptacopan HCl, LNP023 hydrochloride |
| Anwendung: | CFB inhibitor |
| CAS | 1646321-63-2 |
| MW: | 458.98 D |
ab 154,00 €
Iptacopan
Artikelnummer: TGM-T11864-100mg
Description: Iptacopan (LNP023) is an inhibitor with high affinity for factor B. Target: Others. Smiles: CCO[C@H]1CCN(Cc2c(OC)cc(C)c3[nH]ccc23)[C@@H](C1)c1ccc(cc1)C(O)=O. References: Schubart A, et al. Small-molecule factor B inhibitor for the treatment of complement-mediated diseases. Proc Natl Acad Sci U S A. 2019...
| Schlagworte: | LNP023 |
| Anwendung: | Targets complement factor B [EC:3.4.21.47] (CFB) |
| CAS | 1644670-37-0 |
| MW: | 422.52 D |
ab 131,00 €
Anti-CFB antibody(DMC366), IgG1 Chimeric mAb
Artikelnummer: DIM-DMC100366.10
Protein function: Factor B which is part of the alternate pathway of the complement system is cleaved by factor D into 2 fragments: Ba and Bb. Bb, a serine protease, then combines with complement factor 3b to generate the C3 or C5 convertase. It has also been implicated in proliferation and differentiation of...
| Schlagworte: | Anti-AHUS4, Anti-ARMD14, Anti-BF, Anti-BFD, Anti-CFAB, Anti-CFBD, Anti-FB, Anti-FBI12, Anti-GBG, Anti-H2-Bf, Anti-PBF2,... |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 142,00 €
Human CFB Protein, hFc Tag
Artikelnummer: DIM-PME100584.10
Recombinant Human CFB with C-terminal human Fc tag. CFB(Thr26-Leu764) hFc(Glu99-Ala330), Protein function: Factor B which is part of the alternate pathway of the complement system is cleaved by factor D into 2 fragments: Ba and Bb. Bb, a serine protease, then combines with complement factor 3b to generate the C3 or...
| Schlagworte: | AHUS4, ARMD14, BF, BFD, CFAB, CFBD, FB, FBI12, GBG, H2-Bf, PBF2 |
| Exprimiert in: | Human cells |
| Ursprungsart: | human |
| CAS | 12 |
| MW: | 109.2 kD |
ab 103,00 €
Anti-CFB
Artikelnummer: CSB-PA11049A0Rb.100
Host Species: Rabbit. Isotype: IgG. Buffer: Preservative: 0.03% Proclin 300Constituents: 50% Glycerol, 0.01M PBS, PH 7.4. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: >95%, Protein G purified. Target Name: CFB. Antigen Species: Human
| Schlagworte: | Anti-BF, Anti-CFB, EC=3.4.21.47, AHUS4 antibody, B factor properdin antibody, BF antibody, BFD antibody, C3 proaccelerator... |
| Anwendung: | ELISA, WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 167,00 €
Human CFB / Complement factor B ELISA Kit
Artikelnummer: G-HUFI01719.96
| Anwendung: | ELISA |
| Spezies-Reaktivität: | human |
534,00 €
Anti-Complement Factor B / CFB
Artikelnummer: NSJ-R32391
0.5mg/ml if reconstituted with 0.2ml sterile DI water. Complement factor B is a protein that in humans is encoded by the CFB gene. This gene encodes complement factor B, a component of the alternative pathway of complement activation. Factor B circulates in the blood as a single chain polypeptide. Upon activation of...
| Schlagworte: | Anti-BF, Anti-CFB, EC=3.4.21.47, Complement Factor B Antibody / CFB |
| Anwendung: | WB, IHC (paraffin) |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
772,00 €
Human CFB (Complement Factor B) ELISA Kit
Artikelnummer: E-EL-H6056.96
This ELISA kit uses the Sandwich-ELISA principle. The micro ELISA plate provided in this kit has been pre-coated with an antibody specific to Human CFB. Standards or samples are added to the micro ELISA plate wells and combined with the specific antibody. Then a biotinylated detection antibody specific for Human CFB...
| Schlagworte: | BF, CFB, EC=3.4.21.47 |
| Anwendung: | ELISA |
| Spezies-Reaktivität: | human |
555,00 €
Human Complement Factor B ELISA Kit
Artikelnummer: ARG82648.96
Protein function: Factor B which is part of the alternate pathway of the complement system is cleaved by factor D into 2 fragments: Ba and Bb. Bb, a serine protease, then combines with complement factor 3b to generate the C3 or C5 convertase. It has also been implicated in proliferation and differentiation of...
| Schlagworte: | BF, CFB, EC=3.4.21.47 |
| Anwendung: | ELISA |
| Spezies-Reaktivität: | human |
1.315,00 €