Zu "K00789" wurden 150 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
S-(5'-Adenosyl)-L-methionine (tosylate)
Artikelnummer: Cay16376-50
S-(5'-Adenosyl)-L-methionine (SAM) is a methyl donor and cofactor. It is involved in several biological processes, including epigenetic regulation, post-translational modification of proteins, and metabolism. Formulations containing SAM have been used as dietary supplements.Formal Name:...
| Schlagworte: | SAMe, 5'-[[(3S)-3-amino-3-carboxypropyl]methylsulfonio]-5'-deoxy-adenosine, 4-methylbenzenesulfonate |
| Anwendung: | Methyl donor, cosubstrate |
| CAS | 52248-03-0 |
| MW: | 570.6 D |
ab 122,00 €
Anti-MAT2A
Artikelnummer: A304-279A
Protein function: Catalyzes the formation of S-adenosylmethionine from methionine and ATP. The reaction comprises two steps that are both catalyzed by the same enzyme: formation of S-adenosylmethionine (AdoMet) and triphosphate, and subsequent hydrolysis of the triphosphate. [The UniProt Consortium]
| Schlagworte: | Anti-AMS2, Anti-MAT 2, Anti-MAT2A, Anti-MAT-II, Anti-AdoMet synthase 2, Anti-Methionine adenosyltransferase 2,... |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 165,00 €
PF-9366
Artikelnummer: Cay30782-25
PF-9366 is an inhibitor of methionine adenosyltransferase 2A (Mat2A, IC50 = 420 nM for S-adenosyl-L-methionine (SAM) production in an enzyme assay). It is selective for Mat2A over a panel of neurotransmitter transporters, phosphodiesterases, ion channels, and G protein-coupled receptors, as well as a panel of 39...
| Schlagworte: | 7-chloro-N,N-dimethyl-5-phenyl-[1,2,4]triazolo[4,3-a]quinoline-1-ethanamine |
| Anwendung: | Methionine adenosyltransferase 2A (Mat2A) inhibitor |
| CAS | 72882-78-1 |
| MW: | 350.8 D |
ab 122,00 €
AG-270
Artikelnummer: TGM-T9050-1mg
Description: AG-270 is an allosteric and orally active inhibitor of MAT2A. Target: Methionine Adenosyltransferase (MAT). Smiles: COc1ccc(cc1)-c1c(Nc2ccccn2)[nH]c2c(c(nn2c1=O)-c1ccccc1)C1=CCCCC1. References: Zenon Konteatis, et al. Discovery of AG-270, a First-in-Class Oral MAT2A Inhibitor for the Treatment of Tumors...
| Anwendung: | MAT2A (S-adenosylmethionine synthetase) inhibitor |
| CAS | 2201056-66-6 |
| MW: | 489.57 D |
ab 105,00 €
Anti-MAT2A, clone 3A2
Artikelnummer: ARG56979.50
Protein function: Catalyzes the formation of S-adenosylmethionine from methionine and ATP. The reaction comprises two steps that are both catalyzed by the same enzyme: formation of S-adenosylmethionine (AdoMet) and triphosphate, and subsequent hydrolysis of the triphosphate. [The UniProt Consortium]
| Schlagworte: | Anti-AMS2, Anti-MAT2A, Anti-MAT 2, Anti-MAT-II, Anti-AdoMet synthase 2, Anti-Methionine adenosyltransferase 2,... |
| Anwendung: | WB |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human |
518,00 €
MAT2B, His-Tag
Artikelnummer: BPS-79123
Human MAT2B, also known as Methionine Adenosyltransferase 2B, MAT2, and MAT II Beta. GenBank Accession No. NM_013283, a.a. 2-334 (end) with an N-terminal His-tag, expressed in an E. coli cell expression system. MW = 39 kDa.
| Schlagworte: | TGR, MAT2B, MSTP045, MAT II beta, Methionine adenosyltransferase II beta, Methionine adenosyltransferase 2 subunit beta,... |
| Anwendung: | Enzyme assays |
| Ursprungsart: | human |
| MW: | 39 kD |
536,00 €
MAT2A, His-Avi-Tag, Biotin-Labeled
Artikelnummer: BPS-79308-1
Human MAT2A, also known as methionine adenosyltransferase II alpha, MAT2, S-adenosylmethionine synthase isoform type-2, and adoMet synthase 2. GenBank Accession No. NM_005911, a.a. 2-395 (end) with an N-terminal His-Avi-tag, expressed in an E. coli cell expression system. This protein is enzymatically biotinylated...
| Schlagworte: | AMS2, MAT2A, MAT 2, MAT-II, AdoMet synthase 2, Methionine adenosyltransferase 2, Methionine adenosyltransferase II,... |
| Anwendung: | WB positive control |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 45 kD |
ab 468,00 €
Human MAT1A / S-adenosylmethionine synthase isoform...
Artikelnummer: G-HUFI00580.96
| Anwendung: | ELISA |
| Spezies-Reaktivität: | human |
698,00 €
Human MAT2A / S-adenosylmethionine synthase isoform...
Artikelnummer: G-HUFI01163.96
| Anwendung: | ELISA |
| Spezies-Reaktivität: | human |
698,00 €
Mouse MAT1A / S-adenosylmethionine synthase isoform...
Artikelnummer: G-MOFI00211.96
| Anwendung: | ELISA |
| Spezies-Reaktivität: | mouse |
698,00 €
Anti-MAT2B
Artikelnummer: NSJ-R35589-100UG
0.5 mg/ml in 1X TBS, pH7.3, with 0.5% BSA (US sourced) and 0.02% sodium azide. Additional name(s) for this target protein: Methionine adenosyltransferase II, beta Protein function: Non-catalytic regulatory subunit of S-adenosylmethionine synthetase 2 (MAT2A), an enzyme that catalyzes the formation of S-...
| Schlagworte: | Anti-TGR, Anti-MAT2B, Anti-MSTP045, Anti-MAT II beta, Anti-Methionine adenosyltransferase II beta, Anti-Methionine... |
| Anwendung: | WB, ELISA (peptide) |
| Wirt: | Goat |
| Spezies-Reaktivität: | human |
836,00 €
MAT2A, His-Tag
Artikelnummer: BPS-71401-1
Human MAT2A, also known as methionine adenosyltransferase II alpha, MAT2, and adoMet synthase 2. GenBank Accession No. NM_005911, a.a. 2-359 (end) with an N-terminal His-tag, expressed in an E. coli cell expression system. MW = 45 kDa.
| Schlagworte: | AMS2, MAT2A, MAT 2, MAT-II, AdoMet synthase 2, Methionine adenosyltransferase 2, Methionine adenosyltransferase II,... |
| Anwendung: | Protein binding studies, small molecule screening |
| Exprimiert in: | E.coli |
| Ursprungsart: | human |
| MW: | 45 kD |
ab 596,00 €