Zu "K00602" wurden 60 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ATIC-IN-2
Artikelnummer: Cay44844-10
An IMP cyclohydrolase inhibitor (Ki = 0.13 µM), selective for the IMP cyclohydrolase activity of ATIC over the AICAR transformylase activity of ATIC and over GAR transformylase (Kis = >100 µM for both), has been found in A. leucotrichus. SMILES: O=S(NC1=C(NC=N1)C2=O)(N2)=O. InChi Code:...
| Schlagworte: | AICAR Transformylase/IMP Cyclohydrolase Inhibitor 2, AICAR Transformylase/IMP Cyclohydrolase-IN-2, ATIC Inhibitor 2,... |
| Anwendung: | AICAR transformylase/IMP cyclohydrolase (ATIC) inhibitor |
| CAS | 67095-44-7 |
| MW: | 188.16 D |
ab 69,00 €
Anti-ATIC
Artikelnummer: A304-272A
Protein function: Bifunctional enzyme that catalyzes 2 steps in purine biosynthesis. [The UniProt Consortium]
| Schlagworte: | Anti-PURH, Anti-ATIC, EC=2.1.2.3, EC=3.5.4.10 |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 165,00 €
Anti-ATIC, clone 3H12-C9-H9
Artikelnummer: ARG54092.100
Protein function: Bifunctional enzyme that catalyzes 2 steps in purine biosynthesis. [The UniProt Consortium]
| Schlagworte: | Anti-ATIC, Anti-PURH, EC=2.1.2.3, EC=3.5.4.10, Anti-Inosinicase, Anti-IMP synthase, Anti-IMP cyclohydrolase, Anti-AICAR... |
| Anwendung: | WB |
| Wirt: | Mouse |
| Spezies-Reaktivität: | human, mouse, rat |
658,00 €
Anti-ATIC
Artikelnummer: A304-271A
Protein function: Bifunctional enzyme that catalyzes 2 steps in purine biosynthesis. [The UniProt Consortium]
| Schlagworte: | Anti-PURH, Anti-ATIC, EC=2.1.2.3, EC=3.5.4.10 |
| Anwendung: | WB, IP |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 165,00 €
Anti-ATIC
Artikelnummer: ARG57844.100
Protein function: Bifunctional enzyme that catalyzes 2 steps in purine biosynthesis. [The UniProt Consortium]
| Schlagworte: | Anti-ATIC, Anti-PURH, EC=2.1.2.3, EC=3.5.4.10 |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
707,00 €
Anti-ATIC
Artikelnummer: ATA-HPA021012.100
Protein function: Bifunctional enzyme that catalyzes the last two steps of purine biosynthesis (PubMed:11948179, PubMed:14756554). Acts as a transformylase that incorporates a formyl group to the AMP analog AICAR (5-amino-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide) to produce the intermediate formyl-AICAR...
| Schlagworte: | Anti-PURH |
| Anwendung: | ICC, IHC, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 246,00 €
Anti-ATIC
Artikelnummer: CSB-PA136284.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: ATIC. Antigen Species: Human
| Schlagworte: | Anti-PURH, AICAR formyltransferase/IMP cyclohydrolase antibody, 5 aminoimidazole 4 carboxamide 1 beta D ribonucleotide... |
| Anwendung: | ELISA, WB, IHC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 167,00 €
Anti-ATIC
Artikelnummer: CSB-PA171896.100
Host Species: Rabbit. Isotype: IgG. Buffer: -20°C, pH7.4 PBS, 0.05% NaN3, 40% Glycerol. Storage: Upon receipt, store at -20°C or -80°C. Avoid repeated freeze. Purification Method: Antigen affinity purification. Target Name: ATIC. Antigen Species: Human
| Schlagworte: | Anti-PURH, AICAR formyltransferase/IMP cyclohydrolase antibody, 5 aminoimidazole 4 carboxamide 1 beta D ribonucleotide... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 167,00 €
NEU
Human, ATIC cDNA ORF Clone, N-His tag
Artikelnummer: SNB-HG11295-NH
Protein Function: Bifunctional enzyme that catalyzes the last two steps of purine biosynthesis (PubMed:11948179, PubMed:14756554). Acts as a transformylase that incorporates a formyl group to the AMP analog AICAR (5-amino-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide) to produce the intermediate formyl-AICAR...
| Schlagworte: | ATIC, Bifunctional purine biosynthesis protein ATIC, AICAR transformylase/inosine monophosphate cyclohydrolase |
| Spezies-Reaktivität: | human |
235,00 €
NEU
Human ATIC qPCR Primer Pair
Artikelnummer: SNB-HP101172
Protein Function: Bifunctional enzyme that catalyzes the last two steps of purine biosynthesis (PubMed:11948179, PubMed:14756554). Acts as a transformylase that incorporates a formyl group to the AMP analog AICAR (5-amino-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide) to produce the intermediate formyl-AICAR...
| Schlagworte: | ATIC, Bifunctional purine biosynthesis protein ATIC, AICAR transformylase/inosine monophosphate cyclohydrolase |
| Anwendung: | qPCR |
| Spezies-Reaktivität: | human |
92,00 €
NEU
Human, ATIC cDNA ORF Clone, C-Myc tag
Artikelnummer: SNB-HG11295-CM
Protein Function: Bifunctional enzyme that catalyzes the last two steps of purine biosynthesis (PubMed:11948179, PubMed:14756554). Acts as a transformylase that incorporates a formyl group to the AMP analog AICAR (5-amino-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide) to produce the intermediate formyl-AICAR...
| Schlagworte: | ATIC, Bifunctional purine biosynthesis protein ATIC, AICAR transformylase/inosine monophosphate cyclohydrolase |
| Spezies-Reaktivität: | human |
235,00 €
NEU
Human, ATIC cDNA ORF Clone, N-DYKDDDDK (Flag(R)) tag
Artikelnummer: SNB-HG11295-NF
Protein Function: Bifunctional enzyme that catalyzes the last two steps of purine biosynthesis (PubMed:11948179, PubMed:14756554). Acts as a transformylase that incorporates a formyl group to the AMP analog AICAR (5-amino-1-(5-phospho-beta-D-ribosyl)imidazole-4-carboxamide) to produce the intermediate formyl-AICAR...
| Schlagworte: | ATIC, Bifunctional purine biosynthesis protein ATIC, AICAR transformylase/inosine monophosphate cyclohydrolase |
| Spezies-Reaktivität: | human |
235,00 €