Zu "K00234" wurden 85 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Anti-Zebrafish Sdha / Succinate dehydrogenase A
Artikelnummer: NSJ-RZ1305
0.5mg/ml if reconstituted with 0.2ml sterile DI water. Zebrafish Sdha, also known as succinate dehydrogenase subunit A, is a key component of the mitochondrial respiratory chain complex II. Sdha is an essential flavoprotein that catalyzes the oxidation of succinate to fumarate within the tricarboxylic acid cycle...
| Schlagworte: | Anti-sdha, Anti-Flavoprotein subunit of complex II, Anti-Malate dehydrogenase [quinone] flavoprotein subunit,... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | zebrafish |
948,00 €
Atpenin A5
Artikelnummer: Cay11898-1
Mitochondrial complex II (succinate dehydrogenase or succinate:ubiquinone oxidoreductase) is a functional member of the Krebs cycle and the aerobic respiratory chain that couples the oxidation of succinate to fumarate with the reduction of quinone to quinol. Atpenin A5, an antifungal antibiotic isolated from...
| Schlagworte: | Antibiotic FO-125A5, 3-[(2S,4S,5R)-5,6-dichloro-2,4-dimethyl-1-oxohexyl]-4-hydroxy-5,6-dimethoxy-2(1H)-pyridinone |
| Anwendung: | Succinate-ubiquinone oxidoreductase inhibitor |
| CAS | 119509-24-9 |
| MW: | 366.2 D |
409,00 €
Atpenin A5
Artikelnummer: AG-CN2-0100-C250
Antibiotic, antifungal, potent and specific mitochondrial complex II (succinate-ubiquinone oxidoreductase) inhibitor, mitochondrial ATP-sensitive potassium (mK(ATP)) channel activator, cardioprotective, modulates mitochondrial ROS generation during cardioprotection
| Schlagworte: | 3-[(2S,4S,5R)-5,6-Dichloro-2,4-dimethyl-1-oxohexyl]-4-hydroxy-5,6-dimethoxy-2(1H)-pyridinone |
| Anwendung: | Succinate-ubiquinone oxidoreductase inhibitor |
| CAS | 119509-24-9 |
| MW: | 366,2 D |
ab 143,00 €
Harzianopyridone
Artikelnummer: Cay19620-1
Harzianopyridone is an atpenin-like inhibitor of mammalian and nematode mitochondrial complex II (succinate:ubiquinone oxidoreductase, SQR) with IC50 values of 0.017, 0.2, and 2 µM for bovine, rat, and nematode complex II, respectively. It also inhibits nematode quinol-fumarate reductase (QFR, IC50 = 0.36 µM)....
| Schlagworte: | (-)-Harzianopyridone, 4-hydroxy-5,6-dimethoxy-3-[(2S,4E)-2-methyl-1-oxo-4-hexen-1-yl]-2(1H)-pyridinone |
| Anwendung: | Mitochondrial complex II (succinate:ubiquinone oxidoreductase) inhibitor, antibiotic |
| CAS | 137813-88-8 |
| MW: | 281.3 D |
ab 93,00 €
Harzianopyridone
Artikelnummer: AG-CN2-0149-C250
Isolated from Trichoderma harzianum FKI-1509. Antibiotic. Antifungal and antibacterial compound. Specific mitochondrial complex II (succinate ubiquinone oxidoreductase, succinate dehydrogenase) inhibitor. Herbicidal activity. Anthelmintic compound. Inhibits NADH-fumarate reductase activity of adult Ascaris suum...
| Schlagworte: | (S,E)-4-Hydroxy-5,6-dimethoxy-3-(2-methylhex-4-enoyl)pyridin-2(1H)-one |
| Anwendung: | Antibiotic, mitochondrial complex II inhibitor |
| CAS | 126637-69-2 |
| MW: | 281,3 D |
ab 88,00 €
Penthiopyrad
Artikelnummer: CDX-P0166-M025
Grey powder. Soluble in methanol, acetone or ethyl acetate. Insoluble in water. Systemic broad spectrum fungicide. Interferes with fungal respiration by inhibition of Complex II: succinate-dehydrogenase (SDH). Compound can be used as analytical reference material.
| Schlagworte: | (RS)-N-[2-(1,3-Dimethylbutyl)-3-thienyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide, DPX-LEM 17, Gaia, MTF753,... |
| Anwendung: | Fungicide, Complex II: succinate-dehydrogenase (SDH) inhibitor, Analytical reference material |
| CAS | 183675-82-3 |
| MW: | 359,4 D |
183,00 €
Thifluzamide
Artikelnummer: CDX-T0118-M010
White to beige or faint brown powder. Soluble in chloroform. Thiazole fungicide used in agrochemistry. Succinate dehydrogenase inhibitor (SDHI) which interferes with succinate ubiquinone reductase in the mitochondrial electron transport chain of fungi.Compound can be used as analytical reference material.
| Schlagworte: | 2',6'-Dibromo-2-methyl-4'-trifluoromethoxy-4-trifluoromethyl-1,3-thiazole-5-carboxanilide |
| Anwendung: | Fungicide, Succinate dehydrogenase inhibitor, Analytical reference material |
| CAS | 130000-40-7 |
| MW: | 528,1 D |
ab 91,00 €
Atpenin A5
Artikelnummer: TGM-T9714-10mg
Description: Atpenin A5 is a potent and highly specific complex II inhibitor (IC50 ~10 nM), as well as an effective mKATP channel agonist and cardioprotective agent [1]. Target: Potassium Channel. Smiles: COc1[nH]c(=O)c(C(=O)[C@@H](C)C[C@H](C)[C@@H](Cl)CCl)c(O)c1OC
| Anwendung: | Succinate-ubiquinone oxidoreductase inhibitor |
| CAS | 119509-24-9 |
| MW: | 366.24 D |
ab 240,00 €
Anti-SDHA
Artikelnummer: NSJ-R30807
0.5mg/ml if reconstituted with 0.2ml sterile DI water. Succinate dehydrogenase complex, subunit a, flavoprotein is a protein that in humans is encoded by the SDHA gene. The gene that codes for the protein is nuclear, even though the protein is located in the inner membrane of the mitochondria. Heterozygous carriers...
| Schlagworte: | Anti-Fp, Anti-SDH2, Anti-SDHA, Anti-Flavoprotein subunit of complex II, Anti-Succinate dehydrogenase [ubiquinone]... |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat, monkey |
790,00 €
Anti-SDHA
Artikelnummer: NSJ-R32062
0.5mg/ml if reconstituted with 0.2ml sterile DI water. Complex II of the mitochondrial respiratory chain, also known as succinate dehydrogenase or succinate:ubiquinone oxidoreductase, consists of 4 nuclear-encoded polypeptides, these are the flavoprotein subunit (SDHA), the iron sulfur protein subunit (SDHB), and...
| Schlagworte: | Anti-Fp, Anti-SDHA, Anti-SDH2, Anti-Flavoprotein subunit of complex II, Anti-Malate dehydrogenase [quinone] flavoprotein... |
| Anwendung: | WB, IHC (paraffin), IF, FC |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
790,00 €
Anti-SDHA
Artikelnummer: NSJ-F52276-0.08ML
In 1X PBS, pH 7.4, with 0.09% sodium azide. Flavoprotein (FP) subunit of succinate dehydrogenase (SDH) that is involved in complex II of the mitochondrial electron transport chain and is responsible for transferring electrons from succinate to ubiquinone (coenzyme Q). Can act as a tumor suppressor. Protein function:...
| Schlagworte: | Anti-Fp, Anti-SDH2, Anti-SDHA, Anti-Flavoprotein subunit of complex II, Anti-Succinate dehydrogenase [ubiquinone]... |
| Anwendung: | IHC, WB, ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human |
ab 361,00 €
Anti-SDHA
Artikelnummer: E-AB-17013.120
This gene encodes a major catalytic subunit of succinate-ubiquinone oxidoreductase, a complex of the mitochondrial respiratory chain. The complex is composed of four nuclear-encoded subunits and is localized in the mitochondrial inner membrane. Mutations in this gene have been associated with a form of mitochondrial...
| Schlagworte: | Anti-Fp, Anti-SDHA, Anti-SDH2, Anti-Flavoprotein subunit of complex II, Anti-Succinate dehydrogenase [ubiquinone]... |
| Anwendung: | WB, IHC, ELISA |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse, rat |
ab 89,00 €