Zu "99514-99-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
5-bromo-3-phenyl Salicylic Acid
Artikelnummer: Cay13379-1
The aldo-keto reductase (AKR) enzymes constitute a family of related NADPH-dependent oxidoreductases. The 1C subfamily (AKR1C) includes four human hydroxysteroid dehydrogenases (HSDs), with AKR1C1 being a 20alpha-HSD and the other three being 3alpha-HSDs. AKR1C1 metabolizes progesterone to an inactive progestin,...
| Schlagworte: | 5-bromo-2-hydroxy-[1,1'-biphenyl]-3-carboxylic acid |
| Anwendung: | AKR1C1 inhibitor |
| CAS | 99514-99-5 |
| MW: | 293.1 D |
ab 85,00 €
5-bromo-3-phenyl Salicylic Acid
Artikelnummer: TGM-T22519-10mg
Description: AKR1C1 inhibitor. Target: Others. Smiles: OC1=C(C=C(Br)C=C1C(O)=O)C2=CC=CC=C2
| CAS | 99514-99-5 |
| MW: | 293.11 D |
ab 185,00 €
