Zu "98665-22-6" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Ganoderic Acid G
Ganoderic Acid G

Artikelnummer: Cay34675-1

Ganoderic acid G is a triterpenoid that has been found in G. lucidum and has anticancer and anti-inflammatory activities. It inhibits the proliferation of Meth A sarcoma cells (IC50 = 6.8 µg/ml). Ganoderic acid G inhibits the production of nitric oxide (NO) in LPS-induced BV-2 microglial cells (IC50 = 5.77...
Schlagworte: 3beta,7beta,12beta-trihydroxy-11,15,23-trioxo-lanost-8-en-26-oic acid
Anwendung: Triterpenoid, anticancer / antiinflammatory agent
CAS 98665-22-6
MW: 532.7 D
ab 93,00 €
Bewerten
Ganoderic acid G
Ganoderic acid G

Artikelnummer: TGM-T3S1149-100mg

Description: Ganoderic acid G is isolated from the surface of Ganoderma lucidum tube layer. Target: Others. Smiles: [H][C@@]12C[C@H](O)C3=C(C(=O)[C@@H](O)[C@]4(C)[C@H](CC(=O)[C@@]34C)[C@H](C)CC(=O)CC(C)C(O)=O)[C@@]1(C)CC[C@H](O)C2(C)C. References: Ganoderic acid G and I and ganolucidic acid A and B, new...
CAS 98665-22-6
MW: 532.67 D
ab 72,00 €
Bewerten