Zu "97151-02-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
alpha-hydroxy Tamoxifen
Artikelnummer: Cay17204-1
alpha-hydroxy Tamoxifen is a reactive metabolite of the estrogen receptor (ER) modulator tamoxifen (Cay-13258) that is formed by the action of cytochrome P450 3A4 in human liver. It can be further converted into genotoxic DNA adducts though a mechanism involving reversible O-sulfonation of the hydroxyl moiety, which...
| Schlagworte: | (betaE)-[[4-[2-(dimethylamino)ethoxy]phenyl]phenylmethylene]-alpha-methyl-benzeneethanol |
| Anwendung: | Reactive tamoxifen metabolite |
| CAS | 97151-02-5 |
| MW: | 387.5 D |
ab 49,00 €
alpha-Hydroxytamoxifen
Artikelnummer: TGM-T19192-10mg
Description: alpha-Hydroxytamoxifen, a metabolite of tamoxifen, reacts with DNA and forms DNA adducts. Target: Others. Smiles: C(=C(/C(C)O)\C1=CC=CC=C1)(\C2=CC=C(OCCN(C)C)C=C2)/C3=CC=CC=C3. References: Phillips DH, et al. alpha-Hydroxytamoxifen, a metabolite of tamoxifen with exceptionally high DNA-binding activity...
| Schlagworte: | alpha-OHTAM, (E)-alpha-Hydroxy tamoxifen |
| Anwendung: | Reactive tamoxifen metabolite |
| CAS | 97151-02-5 |
| MW: | 387.51 D |
ab 74,00 €
