Zu "96922-64-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Z-FA-FMK
Artikelnummer: Cay42444-1
Z-FA-FMK is an inhibitor of cathepsin B (Ki = 1. µM). It also is an inhibitor of caspase-2, -3, -6, -7, and -9 (IC50 = 6. 15. 32. 9. and 110. µM, respectively). Z-FA-FMK inhibits severe acute respiratory syndrome coronavirus 2 (SARS-CoV-2) main protease (Mpro), also known as 3C-like protease (3CLpro), in a cell-free...
| Schlagworte: | Cathepsin B Inhibitor, Z-Phe-Ala-Fluoromethyl Ketone,... |
| Anwendung: | Cathepsin B inhibitor |
| CAS | 96922-64-4 |
| MW: | 386.42 D |
186,00 €
Mdl 201053
Artikelnummer: TGM-T33262-25mg
Description: Mdl 201053 is a biochemical. Target: Others. Smiles: CC(NC(=O)C(Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)CF. References: Ferrão PM, d'Avila-Levy CM, Araujo-Jorge TC, Degrave WM, Gonçalves Ada S, Garzoni LR, Lima AP, Feige JJ, Bailly S, Mendonça-Lima L, Waghabi MC. Cruzipain Activates Latent TGF-beta from Host...
| Schlagworte: | Mdl 201117 |
| CAS | 96922-64-4 |
| MW: | 386.423 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
