Zu "960539-70-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Daprodustat
Artikelnummer: TGM-T3197-10mg
Description: Daprodustat (GSK1278863) is a HIF-prolyl hydroxylase inhibitor. Target: HIF/HIF Prolyl-Hydroxylase, HIF. Smiles: OC(=O)CNC(=O)C1C(=O)N(C2CCCCC2)C(=O)N(C2CCCCC2)C1=O. References: Brigandi RA, et al. Am J Kidney Dis. 2016. doi: 10.1053/j.ajkd.2015.11. 021.
| Schlagworte: | GSK1278863 |
| Anwendung: | Targets hypoxia-inducible factor prolyl hydroxylase [EC:1.14.11.29] (EGLN, HPH) |
| CAS | 960539-70-2 |
| MW: | 393.43 D |
ab 49,00 €
Daprodustat
Artikelnummer: Cay19915-5
Daprodustat is an inhibitor of hypoxia-inducible factor prolyl hydroxylase 1 (HIF-PH1), HIF-PH2, and HIF-PH3 (IC50s = 3.5, 22.2, 5.5 nM, respectively). It is selective for HIF-PH1, -2, and -3 over factor-inhibiting HIF (FIH) and collagen prolyl hydroxylase (CP4H, IC50s = 9,800 and >200,000 nM, respectively)....
| Schlagworte: | GSK1278863, N-[(1,3-dicyclohexylhexahydro-2,4,6-trioxo-5-pyrimidinyl)carbonyl]-glycine |
| Anwendung: | HIF-prolyl hydroxylase inhibitor |
| CAS | 960539-70-2 |
| MW: | 393.4 D |
ab 44,00 €
