Zu "960531-53-7" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Tripeptide-10 citrulline
Tripeptide-10 citrulline

Artikelnummer: TGM-T80944-50mg

Description: Tripeptide-10 Citrulline (T10-C) is a bioactive peptide recognized for its anti-aging properties and has been documented as an ingredient in cosmetics [1]. Smiles: [C@@H](NC([C@@H](NC([C@H](CCCCN)N)=O)CC(O)=O)=O)(C(N[C@@H](CCCNC(N)=O)C(N)=O)=O)[C@H](CC)C
Schlagworte: T10-C
CAS 960531-53-7
MW: 530.62 D
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Bewerten
Tripeptide-10
Tripeptide-10

Artikelnummer: CSB-DT1705.1

Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...
Schlagworte: Lys-Asp-Ile-Cit-NH2, KDI-Cit-NH2
Anwendung: Cosmetic peptide
CAS 960531-53-7
MW: 530.6 D
268,00 €
Bewerten