Zu "959610-24-3" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Myristoyl tetrapeptide-12
Myristoyl tetrapeptide-12

Artikelnummer: TGM-T80628-50mg

Description: Myristoyl Tetrapeptide-12 activates SMAD2 and facilitates the association of SMAD3 with DNA, promoting eyelash hair growth [1] [2]. Target: TGF-beta/Smad. Smiles: CCCCCCCCCC CCCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(N)=O
CAS 959610-24-3
MW: 625.89 D
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Bewerten
Myristoyl Tetrapeptide-12
Myristoyl Tetrapeptide-12

Artikelnummer: CSB-DT1735.1

Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...
Schlagworte: Myr-Lys-Lys-Ala-Ala-NH2, Myr-KKAA-NH2
Anwendung: Cosmetic peptide
CAS 959610-24-3
MW: 625.896 D
248,00 €
Bewerten