Zu "956613-01-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SB-633825
Artikelnummer: Cay43706-1
SB-633825 is a multi-kinase inhibitor. It inhibits tunica internal endothelial kinase 2 (Tie2), serine/threonine kinase 10 (STK10), and breast tumor kinase (BRK, IC50s = 3.5, 66, and 150 nM, respectively). InChI:...
| Schlagworte: | 4-[5-(6-methoxy-2-naphthalenyl)-1-methyl-2-[2-methyl-4-(methylsulfonyl)phenyl]-1H-imidazol-4-yl]-pyridine |
| Anwendung: | Multi-kinase (Tie2, STK10, BRK) inhibitor |
| CAS | 956613-01-7 |
| MW: | 483,59 D |
ab 81,00 €
SB-633825
Artikelnummer: TGM-T16853-100mg
Description: SB-633825 can inhibit cancer cell growth and angiogenesis. SB-633825 is an effective and ATP-competitive inhibitor of TIE2, LOK, and BRK (IC50s: 3.5 nM, 66 nM, 150 nM, respectively). Target: BTK. Smiles: COc1ccc2cc(ccc2c1)-c1c(nc(-c2ccc(cc2C)S(C)(=O)=O)n1C)-c1ccncc1. References: Elkins JM, et al....
| CAS | 956613-01-7 |
| MW: | 483.58 D |
ab 185,00 €
