Zu "955005-63-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AR-102
Artikelnummer: Cay9000362-1
An FP receptor agonist, a derivative of PGF, and a prodrug form of AR-102. Formulation: A solid. InChI: InChI=1S/C28H42O8S/c29-15-28(16-30,17-31)18-36-27(35)10-4-2-1-3-8-20-21(24(34)14-23(20)33)11-12-22(32)26-13-19-7-5-6-9-25(19)37-26/h5-7,9,13,20-24,29-34H,1-4,8,10-12,14-18H2/t20-,21-,22-,23+,24-/m1/s1. InChIKey:...
| Schlagworte: | Dukeprost pentaerthrityl ester,... |
| Anwendung: | FP receptor agonist, AR-102 prodrug |
| CAS | 955005-63-7 |
| MW: | 538.7 D |
ab 112,00 €
AR-102
Artikelnummer: TGM-T30113-25mg
Description: AR-102 is a bio-active chemical. Target: Others. Smiles: C(C[C@@H](O)C1=CC=2C(S1)=CC=CC2)[C@@H]3[C@@H](CCCCCCC(OCC(CO)(CO)CO)=O)[C@@H](O)C[C@H]3O
| Schlagworte: | UNII-54923Z352W |
| CAS | 955005-63-7 |
| MW: | 538.69 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
