Zu "949004-12-0" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
(25S)-Delta7-Dafachronic Acid
(25S)-Delta7-Dafachronic Acid

Artikelnummer: Cay14101-100

During unfavorable environmental conditions, C. elegans larvae undergo arrest and form dauer larvae that can attach to other animals as a parasitic strategy for survival. DAF-12 is an orphan nuclear hormone receptor that regulates dauer larva diapause, reproductive development, fat metabolism, and life...
Schlagworte: UPF-1404, (5alpha,25S)-3-oxo-cholest-7-en-26-oic acid
Anwendung: DAF-12 inhibitor
CAS 949004-12-0
MW: 414.6 D
ab 429,00 €
Bewerten
(25S)-delta7-Dafachronic acid
(25S)-delta7-Dafachronic acid

Artikelnummer: TGM-T26370-1mg

Description: (25S)-delta7-Dafachronic acid, an orphan nuclear receptor DAF-12 ligand, inhibits the dauer-promoting activity of DAF-12. Target: Others. Smiles: C[C@@]12[C@](C=3[C@@]([C@]4(C)[C@@](CC3)(CC(=O)CC4)[H])(CC1)[H])(CC[C@@]2([C@@H](CCC[C@@H](C(O)=O)C)C)[H])[H]. References: Martin R, Däbritz F, Entchev EV,...
CAS 949004-12-0
MW: 414.62 D
ab 934,00 €
Bewerten