Zu "946369-04-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
TG53
Artikelnummer: Cay42514-10
TG53 is an inhibitor of the protein-protein interaction between transglutaminase 2 (TG2) and fibronectin (IC50 = 10 µM in a cell-free assay). It inhibits the adhesion of SKOV3 ovarian cancer cells to fibronectin-coated wells when used at a concentration of 25 µM. TG53 (10 µM) inhibits migration and invasion in a...
| Schlagworte: | 5-chloro-N-[4-[[4-(dimethylamino)-6-methyl-2-pyrimidinyl]amino]phenyl]-2-methoxy-benzamide |
| Anwendung: | TG2-fibronectin protein-protein interaction inhibitor |
| CAS | 946369-04-6 |
| MW: | 411.88 D |
ab 109,00 €
TG53
Artikelnummer: TGM-T26265-100mg
Description: TG53 is a tissue transglutaminase (TG2) and fibronectin (FN) protein-protein interaction inhibitor. Target: Others. Smiles: COC1=CC=C(Cl)C=C1C(=O)NC1=CC=C(NC2=NC(C)=CC(=N2)N(C)C)C=C1. References: Yakubov B, Chen L, Belkin AM, Zhang S, Chelladurai B, Zhang ZY, Matei D. Small molecule inhibitors target...
| Schlagworte: | TG-53, TG 53 |
| CAS | 946369-04-6 |
| MW: | 411.88 D |
ab 1.520,00 €
