Zu "93987-29-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
BI-6015
Artikelnummer: Cay12032-5
Hepatocyte nuclear factor 4alpha (HNF4alpha) is a nuclear receptor transcription factor that controls the expression of many genes including those involved in glucose and lipid homeostasis and maintenance of epithelial differentiation. BI-6015 is a small molecule antagonist of HNF4alpha that has been shown to...
| Schlagworte: | 2-methyl-1-[(2-methyl-5-nitrophenyl)sulfonyl]-1H-benzimidazole |
| Anwendung: | HNF-4alpha antagonist |
| CAS | 93987-29-2 |
| MW: | 331.3 D |
ab 74,00 €
NEU
BI-6015
Artikelnummer: TGM-T21867-10mg
Description: BI 6015 is an antagonist of HNF4alpha. HNF4alpha is a nuclear receptor that regulates gene expression in the intestine cells, liver cells, and pancreas-beta cells. Target: Others. Smiles: Cc1nc2ccccc2n1S(=O)(=O)c1cc(ccc1C)[N+]([O-])=O. References: Kiselyuk A, Lee SH, Farber-Katz S, et al. HNF4a...
| CAS | 93987-29-2 |
| MW: | 331.35 D |
ab 33,00 €
