Zu "929046-33-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Elinzanetant
Artikelnummer: Cay43016-10
Elinzanetant is a dual neurokinin-1 (NK1) and NK3 receptor antagonist.. Solulibility: DMSO: Soluble: =10 mg/ml: Ethanol: Soluble: =10 mg/ml.
| Schlagworte: | BAY-3427080, GSK1144814, NT-814,... |
| Anwendung: | Dual NK1 / NK3 receptor antagonist |
| CAS | 929046-33-3 |
| MW: | 668.66 D |
ab 401,00 €
Elinzanetant
Artikelnummer: TGM-T38144-10mg
Description: Elinzanetant is a dual antagonist of neurokinin (NK) receptors 1 and 3 and modulates reproductive hormone secretion. Target: Neurokinin receptor. Smiles: [H][C@]12COCCN1C[C@@H](CO)N(C2)c1cc(c(cn1)N(C)C(=O)C(C)(C)c1cc(cc(c1)C(F)(F)F)C(F)(F)F)-c1ccc(F)cc1C. References: Alvaro, Giuseppe, Andreotti,...
| Anwendung: | Targets tachykinin receptor 1 (TACR1) |
| CAS | 929046-33-3 |
| MW: | 668.64 D |
ab 91,00 €
