Zu "928006-88-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Acetyl Tetrapeptide-11
Artikelnummer: Cay42985-1
Acetyl tetrapeptide-11 is a peptide inducer of syndecan-1 (SYND1) and collagen XVII.1 It increases SYND1 and collagen XVII levels in primary human keratinocytes when used at a concentration of 2.6 µg/ml. Formulations containing acetyl tetrapeptide-11 have been used in skin care cosmetics. SMILES...
| Schlagworte: | Ac-Pro-Pro-Tyr-Leu-OH, 1-acetyl-L-prolyl-L-prolyl-L-tyrosyl-L-leucine |
| Anwendung: | SYND1 / collagen XVII peptide inducer |
| CAS | 928006-88-6 |
| MW: | 530.62 D |
ab 38,00 €
Acetyltetrapeptide 11
Artikelnummer: TGM-T83190-50mg
Description: Acetyltetrapeptide-11, a bioactive peptide with anti-aging properties, is reported to be utilized as an ingredient in cosmetics [1]. Smiles: C(=O)(N1[C@H](C(N[C@@H](CC2=CC=C(O)C=C2)C(N[C@@H](CC(C)C)C(O)=O)=O)=O)CCC1)[C@H]3N(C(C)=O)CCC3
| CAS | 928006-88-6 |
| MW: | 530.61 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Acetyl Tetrapeptide-11
Artikelnummer: CSB-DT1716.1
Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...
| Schlagworte: | Ac-Pro-Pro-Tyr-Leu, Ac-PPYL |
| Anwendung: | Cosmetic peptide |
| CAS | 928006-88-6 |
| MW: | 530.621 D |
210,00 €
