Zu "921-60-8" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
L-GLUCOSE
Artikelnummer: TGM-T5113-100mg
Description: L-Glucose (L-(-)-Glucose), an enantiomer of D-glucose, is not bioavailable to cells as an energy source because it cannot be phosphorylated by hexokinase. Target: Others. Smiles: OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)C=O. References: Shimizu T, et al. An L-glucose catabolic pathway in Paracoccus species...
| Schlagworte: | L-(-)-Glucose |
| Anwendung: | Laxative, Colon cleansing |
| CAS | 921-60-8 |
| MW: | 180.16 D |
42,00 €
L-(-)-Glucose
Artikelnummer: Cay20829-250
L-(-)-Glucose is an enantiomer of the more common D-glucose. L-Glucose is not bioavailable to cells as an energy source because it cannot be phosphorylated by hexokinase. However, certain L-glucose-utilizing bacteria that contain NAD+-dependent L-glucose dehydrogenases capable of oxidizing L-glucose have been...
| Schlagworte: | Levoglucose, L-Glucopyranose, L-glucose |
| Anwendung: | Usually not bioavailable enantiomer |
| CAS | 921-60-8 |
| MW: | 180.2 D |
ab 52,00 €
