Zu "92090-94-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Kazusamycin A
Artikelnummer: Cay20137-100
Kazusamycin A is an antibiotic from Streptomyces and a hydroxy analog of Leptomycin B (Cay-10004976) that demonstrates cytotoxic activity against various human and mouse tumor lines. Additionally, at nanomolar concentrations, it inhibits nuclear export and translocation of Rev, a regulatory gene product in the HIV...
| Schlagworte: | CL 1,957B, Hydroxyelactocin, Hydroxyleptomycin B, PD 114721,... |
| Anwendung: | Antibiotic |
| CAS | 92090-94-3 |
| MW: | 556.7 D |
ab 534,00 €
Kazusamycin A
Artikelnummer: TGM-T24253-1mg
Description: Kazusamycin A is a new antitumor antibiotic. Target: Others. Smiles: CC\C(\C=C\[C@@H]1OC(=O)C=C[C@@H]1C)=C\[C@H](C)C\C=C\C(\C)=C\[C@@H](CO)C(=O)[C@@H](C)[C@H](O)[C@@H](C)C\C(C)=C\C(O)=O , c:9, . References: Ando R, Amano Y, Nakamura H, Arai N, Kuwajima I. Design, synthesis, and evaluation of novel...
| Schlagworte: | Antibiotic 81-484, PD 114721, Antibiotic CL1957B |
| CAS | 92090-94-3 |
| MW: | 556.74 D |
2.636,00 €
