Zu "91809-66-4" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
5-TAMRA
Artikelnummer: TGM-T18891-100mg
Description: 5-TAMRA (5-Carboxytetramethylrhodamine) (5-Carboxytetramethylrhodamine) yields bright, pH-insensitive orange-red fluorescence (approximate excitation/emission maxima ~546/579) with good photostability. Target: Others. Smiles: CN(C)c1ccc2c(-c3ccc(cc3C([O-])=O)C(O)=O)c3ccc(cc3[o+]c2c1)N(C)C
| Schlagworte: | 5-Carboxytetramethylrhodamine |
| CAS | 91809-66-4 |
| MW: | 430.45 D |
ab 40,00 €
5-TAMRA
Artikelnummer: CDX-C0055-M025
Free acid form of 5-carboxytetramethylrhodamine single isomer. Widely used fluorophore for preparing bioconjugates, especially fluorescent antibody and avidin derivatives used in immunochemistry. Used as a dye for oligonucleotide labeling and automated DNA sequencing applications.
| Schlagworte: | 5-Carboxytetramethylrhodamine |
| Anwendung: | Fluorescent dye |
| CAS | 91809-66-4 |
| MW: | 430,45 D |
ab 183,00 €
5-TAMRA (5-Carboxytetramethylrhodamine) *Validated for...
Artikelnummer: ABD-364
5-TAMRA is the purified single isomer of 5(6)-TAMRA. the minor positional difference between 5-TAMRA and 6-TAMRA might affect some biological properties of the underlying conjugates.
| Anwendung: | Labeling |
| CAS | 91809-66-4 |
ab 110,00 €
5-Carboxytetramethylrhodamine
Artikelnummer: Cay34598-5
5-Carboxytetramethylrhodamine is a fluorescent dye that has commonly been used for the covalent labeling of oligonucleotides for DNA analysis. It displays excitation and emission maxima of 546 and 580 nm, respectively. 5-Carboxytetramethylrhodamine has also been used in various fluorescence polarization assays and...
| Schlagworte: | 5-TAMRA, 9-(2,4-dicarboxyphenyl)-3,6-bis(dimethylamino)-xanthylium, inner salt |
| Anwendung: | Fluorescent dye |
| CAS | 91809-66-4 |
| MW: | 430.5 D |
ab 67,00 €
