Zu "913534-05-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CB-65
Artikelnummer: Cay43106-10
CB-65 is a cannabinoid 2 (CB2) receptor inverse agonist. It selectively binds to CB2 over CB1 receptors (Kis = 3. nM and >1,000 nM, respectively) and increases forskolin-induced cAMP production in CHO cells expressing the human CB2 receptor (EC50 = 1. nM). CB-65 (0. 2. and 20 nM) inhibits HepG2 hepatocellular...
| Schlagworte: | 7-chloro-N-cyclohexyl-1,4-dihydro-1-[2-(4-morpholinyl)ethyl]-4-oxo-3-quinolinecarboxamide |
| Anwendung: | CB2 receptor inverse agonist |
| CAS | 913534-05-1 |
| MW: | 417.93 D |
ab 207,00 €
CB 65
Artikelnummer: TGM-T41230-100mg
Description: CB 65 is a high affinity and selective CB2 receptor agonist with Ki values of 3.3 and > 1000 nM for CB2 and CB1 receptors respectively. Target: Cannabinoid Receptor. Smiles: C(CN1CCOCC1)N2C=3C(C(=O)C(C(NC4CCCCC4)=O)=C2)=CC=C(Cl)C3. References: Manera C, et al. Design, synthesis, and biological...
| CAS | 913534-05-1 |
| MW: | 417.93 D |
ab 34,00 €
