Zu "905837-93-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
2,3-Indolobetulonic Acid
Artikelnummer: Cay33065-1
2,3-Indolobetulonic acid is pentacyclic triterpenoid derivative of betulonic acid (Cay-29765) and an inhibitor of alpha-glucosidase (IC50 = 1.8 µM).Formal Name: 1'H-lupa-2,20(29)-dieno[3,2-b]indol-28-oic acid. CAS Number: 905837-93-6. Molecular Formula: C36H49NO2. Formula Weight: 527.8. Purity: >95%. Formulation:...
| Schlagworte: | 1'H-lupa-2,20(29)-dieno[3,2-b]indol-28-oic acid |
| Anwendung: | alpha-glucosidase inhibitor |
| CAS | 905837-93-6 |
| MW: | 527.8 D |
ab 51,00 €
2,3-Indolobetulonic Acid
Artikelnummer: TGM-T37782-10mg
Description: 2,3-Indolobetulonic acid is pentacyclic triterpenoid derivative of betulonic acid and an inhibitor of alpha-glucosidase (IC50= 1.8 µM).1. Target: Others. Smiles: [H][C@]12[C@@H](CC[C@@]1(CC[C@]1(C)[C@]2([H])CC[C@]2([H])[C@@]3(C)Cc4c([nH]c5ccccc45)C(C)(C)[C@]3([H])CC[C@@]12C)C(O)=O)C(C)=C. References:...
| Anwendung: | alpha-glucosidase inhibitor |
| CAS | 905837-93-6 |
| MW: | 527.793 D |
ab 74,00 €
