Zu "905-99-7" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cryptochlorogenic acid
Artikelnummer: TGM-T6S1537-1mL
Description: 1. Cryptochlorogenic acid (4-O-Caffeoylquinic acid) has antioxidant activity. Target: Antioxidant, Endogenous Metabolite. Smiles: O[C@@H]1C[C@](O)(C[C@@H](O)[C@H]1OC(=O)\C=C\c1ccc(O)c(O)c1)C(O)=O. References: Nakatani N , Kayano S I , Kikuzaki H , et al. Identification, quantitative determination, and...
| Schlagworte: | 4-O-Caffeoylquinic acid, 4-Caffeoylquinic acid |
| CAS | 905-99-7 |
| MW: | 354.31 D |
ab 57,00 €
Cryptochlorogenic Acid
Artikelnummer: Cay25098-10
Cryptochlorogenic acid is a phenolic acid that has been found in various plant species, including Artemisia, honeysuckle, and H. sabdariffa, and has diverse biological activities. It inhibits rat lens aldose reductase (RLAR) in vitro (IC50 = 11.13 µM). Cryptochlorogenic acid inhibits the growth of S. aureus (MIC =...
| Schlagworte: | 4-O-Caffeoylquinic Acid,... |
| Anwendung: | Bioactive phenolic acid |
| CAS | 905-99-7 |
| MW: | 354.3 D |
ab 200,00 €
4-O-Caffeoylquinic acid
Artikelnummer: CDX-C0702-M010
White to off-white powder. Soluble in DMSO (50mg/ml), DMF (50mg/ml) or ethanol (20mg/ml). Chemical. CAS: 905-99-7. Formula: C16H18O9. MW: 354.31. Isolated from plant source. Cryptochlorogenic acid (isomer of chlorogenic acid) is a phenolic acid found in various plant species, displaying diverse biological...
| Schlagworte: | 4-O-(3,4-Dihydroxycinnamoyl)-D-quinic acid, Cryptochlorogenic acid |
| Anwendung: | Natural product, bioactive phenolic acid |
| CAS | 905-99-7 |
| MW: | 354,31 D |
ab 183,00 €
