Zu "902156-99-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NVP-LCQ195
Artikelnummer: Cay42728-10
NVP-LCQ195 is an inhibitor of cyclin-dependent kinases (CDKs). It selectively inhibits Cdk5/p25, Cdk5/p35, Cdk1/cyclin B, Cdk2/cyclin A, and Cdk2/cyclin E complexes (IC50s = 1, 1, 2, 2, and 5 nM, respectively) over Cdk9/cyclin T1, Cdk3/cyclin E, Cdk6/cyclin D3, and Cdk7/cyclin H complexes (IC50s = 15, 42, 187, and...
| Schlagworte: | AT-9311, LCQ-195, 4-[(2,6-dichlorobenzoyl)amino]-N-[1-(methylsulfonyl)-4-piperidinyl]-1H-pyrazole-3-carboxamide |
| Anwendung: | CDK inhibitor |
| CAS | 902156-99-4 |
| MW: | 460.33 D |
ab 115,00 €
NVP-LCQ195
Artikelnummer: TGM-TQ0068-100mg
Description: NVP-LCQ195 (LCQ-195) (AT9311) is a potent inhibitor of CDK1, CDK2, CDK3 and CDK5 (IC50: 1-42 nM). Target: CDK. Smiles: CS(=O)(=O)N1CCC(CC1)NC(=O)c1[nH]ncc1NC(=O)c1c(Cl)cccc1Cl. References: McMillin DW, Delmore J, Negri J et al. Molecular and cellular effects of multi-targeted cyclin-dependent kinase...
| Schlagworte: | AT9311 , LCQ-195 |
| CAS | 902156-99-4 |
| MW: | 460.33 D |
ab 39,00 €
