Zu "897613-29-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
S1QEL1.1
Artikelnummer: Cay20982-1
S1QEL1.1 is a small molecule that suppresses superoxide production during reverse electron transport through the IQ site of the mitochondrial respiratory complex I (IC50 = 70 nM) without affecting oxidative phosphorylation. It diminishes endogenous oxidative damage in primary astrocytes, reduces stress-induced...
| Schlagworte: | S1QEL, N1-(3-acetamidophenyl)-N2-(2-(4-methyl-2-(p-tolyl)thiazol-5-yl)ethyl)oxalamide |
| Anwendung: | Superoxide production suppressor |
| CAS | 897613-29-5 |
| MW: | 436.5 D |
ab 40,00 €
S1QEL
Artikelnummer: TGM-T34472-10mg
Description: S1QEL is a suppressor of mitochondrial respiratory complex I site IQ electron leak which suppresses superoxide and/or H2O2 production without altering oxidative phosphorylation. Target: Others. Smiles: CC(=O)NC1=CC(NC(=O)C(=O)NCCC2=C(C)N=C(S2)C2=CC=C(C)C=C2)=CC=C1. References: Wong HS, Benoit B, Brand...
| Schlagworte: | S1QEL1.1, S1-QEL, S1 QEL, S 1QEL, S-1QEL |
| CAS | 897613-29-5 |
| MW: | 436.53 D |
ab 104,00 €
