Zu "894187-61-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
STF-118804
Artikelnummer: TGM-T6682-100mg
Description: STF-118804, a highly specific NAMPT inhibitor, reduces the viability of most B-ALL cell lines with an IC50 of less than 10 nM. Target: NAMPT, Apoptosis. Smiles: Cc1oc(nc1CS(=O)(=O)c1ccc(C)cc1)-c1ccc(cc1)C(=O)NCc1cccnc1. References: Matheny CJ, et al. Chem Biol. 2013, 20(11), 1352-1363.
| Schlagworte: | STF118804, STF 118804 |
| Anwendung: | NAMPT inhibitor |
| CAS | 894187-61-2 |
| MW: | 461.53 D |
ab 31,00 €
STF-118804
Artikelnummer: Cay15283-1
Nicotinamide phosphoribosyltransferase (Nampt) converts nicotinamide into nicotinamide mononucleotide (NMN), which is subsequently converted to NAD+ by NMN adenyltransferase. Cancer cells commonly have an unusually high rate of NAD+ turnover, suggesting that inhibition of Nampt might selectively target cancer cells....
| Schlagworte: | 4-[5-methyl-4-[[(4-methylphenyl)sulfonyl]methyl]-2-oxazolyl]-N-(3-pyridinylmethyl)-benzamide |
| Anwendung: | NAMPT inhibitor |
| CAS | 894187-61-2 |
| MW: | 461.5 D |
ab 44,00 €
