Zu "890888-12-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
S3QEL-2
Artikelnummer: Cay18556-5
S3QEL-2 is a cell-permeable, selective suppressor of electron leak from mitochondrial respiratory complex III, inhibiting site IIIQo superoxide production (IC50 = 1.7 µM) without altering normal bioenergetics function. It reduces production of H2O2 during oxidation of glutamate plus malate to 25% of the control...
| Schlagworte: | 1-(3,4-dimethylphenyl)-N,N-dipropyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Anwendung: | Mitochondrial complex III superoxide production suppressor |
| CAS | 890888-12-7 |
| MW: | 323.4 D |
ab 56,00 €
S3QEL-2
Artikelnummer: TGM-T26172-1mL
Description: S3QEL-2 is a retrograde signaling modulator. It acts by strongly mitigating the oxidative stress-induced apoptosis that limits the yield of functional ß-cells from intact islets. Target: Others. Smiles: CCCN(CCC)c1ncnc2n(ncc12)-c1ccc(C)c(C)c1. References: Orr AL, Vargas L, Turk CN, Baaten JE, Matzen JT,...
| Schlagworte: | S3QEL 2, S3QEL2 |
| CAS | 890888-12-7 |
| MW: | 323.44 D |
44,00 €
